mirror of
https://github.com/plexusorg/Plex-FAWE.git
synced 2025-04-23 23:23:01 +00:00
It started on work with commands then I got carried away.
This commit is contained in:
parent
01c371df9c
commit
ff5860113d
@ -5,7 +5,6 @@ import com.boydti.fawe.IFawe;
|
||||
import com.boydti.fawe.beta.implementation.QueueHandler;
|
||||
import com.boydti.fawe.bukkit.beta.BukkitQueue;
|
||||
import com.boydti.fawe.bukkit.beta.BukkitQueueHandler;
|
||||
import com.boydti.fawe.bukkit.chat.BukkitChatManager;
|
||||
import com.boydti.fawe.bukkit.listener.BrushListener;
|
||||
import com.boydti.fawe.bukkit.listener.BukkitImageListener;
|
||||
import com.boydti.fawe.bukkit.listener.CFIPacketListener;
|
||||
@ -97,11 +96,6 @@ public class FaweBukkit implements IFawe, Listener {
|
||||
if (Bukkit.getVersion().contains("git-Paper") && Settings.IMP.EXPERIMENTAL.DYNAMIC_CHUNK_RENDERING > 1) {
|
||||
new RenderListener(plugin);
|
||||
}
|
||||
try {
|
||||
Fawe.get().setChatManager(new BukkitChatManager());
|
||||
} catch (Throwable throwable) {
|
||||
throwable.printStackTrace();
|
||||
}
|
||||
} catch (final Throwable e) {
|
||||
e.printStackTrace();
|
||||
Bukkit.getServer().shutdown();
|
||||
|
@ -1,64 +0,0 @@
|
||||
package com.boydti.fawe.bukkit.chat;
|
||||
|
||||
import com.boydti.fawe.bukkit.BukkitPlayer;
|
||||
import com.boydti.fawe.config.BBC;
|
||||
import com.boydti.fawe.object.FawePlayer;
|
||||
import com.boydti.fawe.util.chat.ChatManager;
|
||||
import com.boydti.fawe.util.chat.Message;
|
||||
|
||||
import java.util.ArrayList;
|
||||
import java.util.List;
|
||||
import org.bukkit.ChatColor;
|
||||
|
||||
public class BukkitChatManager implements ChatManager<FancyMessage> {
|
||||
|
||||
@Override
|
||||
public FancyMessage builder() {
|
||||
return new FancyMessage("");
|
||||
}
|
||||
|
||||
@Override
|
||||
public void color(Message message, String color) {
|
||||
message.$(this).color(ChatColor.getByChar(BBC.color(color).substring(1)));
|
||||
}
|
||||
|
||||
@Override
|
||||
public void tooltip(Message message, Message... tooltips) {
|
||||
List<FancyMessage> lines = new ArrayList<>();
|
||||
for (Message tooltip : tooltips) {
|
||||
lines.add(tooltip.$(this));
|
||||
}
|
||||
message.$(this).formattedTooltip(lines);
|
||||
}
|
||||
|
||||
@Override
|
||||
public void command(Message message, String command) {
|
||||
message.$(this).command(command);
|
||||
}
|
||||
|
||||
@Override
|
||||
public void text(Message message, String text) {
|
||||
message.$(this).color(BBC.color(text));
|
||||
}
|
||||
|
||||
@Override
|
||||
public void send(Message Message, FawePlayer player) {
|
||||
if (!(player instanceof BukkitPlayer)) {
|
||||
player.sendMessage(Message.$(this).toOldMessageFormat());
|
||||
} else {
|
||||
Message.$(this).send(((BukkitPlayer) player).parent);
|
||||
}
|
||||
}
|
||||
|
||||
@Override
|
||||
public void suggest(Message Message, String command) {
|
||||
Message.$(this).suggest(command);
|
||||
}
|
||||
|
||||
@Override
|
||||
public void link(Message Message, String url) {
|
||||
Message.$(this).link(url);
|
||||
}
|
||||
|
||||
|
||||
}
|
@ -1,874 +0,0 @@
|
||||
package com.boydti.fawe.bukkit.chat;
|
||||
|
||||
import static com.boydti.fawe.bukkit.chat.TextualComponent.rawText;
|
||||
|
||||
import com.google.gson.JsonArray;
|
||||
import com.google.gson.JsonElement;
|
||||
import com.google.gson.JsonObject;
|
||||
import com.google.gson.JsonParser;
|
||||
import com.google.gson.stream.JsonWriter;
|
||||
import java.io.IOException;
|
||||
import java.io.StringWriter;
|
||||
import java.lang.reflect.Constructor;
|
||||
import java.lang.reflect.Field;
|
||||
import java.lang.reflect.InvocationTargetException;
|
||||
import java.lang.reflect.Method;
|
||||
import java.lang.reflect.Modifier;
|
||||
import java.util.ArrayDeque;
|
||||
import java.util.ArrayList;
|
||||
import java.util.Arrays;
|
||||
import java.util.Collections;
|
||||
import java.util.HashMap;
|
||||
import java.util.Iterator;
|
||||
import java.util.List;
|
||||
import java.util.Map;
|
||||
import java.util.function.Consumer;
|
||||
import java.util.logging.Level;
|
||||
import org.bukkit.Bukkit;
|
||||
import org.bukkit.ChatColor;
|
||||
import org.bukkit.command.CommandSender;
|
||||
import org.bukkit.configuration.serialization.ConfigurationSerializable;
|
||||
import org.bukkit.configuration.serialization.ConfigurationSerialization;
|
||||
import org.bukkit.entity.Player;
|
||||
import org.jetbrains.annotations.NotNull;
|
||||
|
||||
/**
|
||||
* Represents a formattable message. Such messages can use elements such as colors, formatting
|
||||
* codes, hover and click data, and other features provided by the vanilla Minecraft <a
|
||||
* href="http://minecraft.gamepedia.com/Tellraw#Raw_JSON_Text">JSON message formatter</a>. This
|
||||
* class allows plugins to emulate the functionality of the vanilla Minecraft <a
|
||||
* href="http://minecraft.gamepedia.com/Commands#tellraw">tellraw command</a>.
|
||||
* <p>
|
||||
* This class follows the builder pattern, allowing for method chaining. It is set up such that
|
||||
* invocations of property-setting methods will affect the current editing component, and a call to
|
||||
* {@link #then()} or {@link #then(String)} will append a new editing component to the end of the
|
||||
* message, optionally initializing it with text. Further property-setting method calls will affect
|
||||
* that editing component.
|
||||
* </p>
|
||||
*/
|
||||
public class FancyMessage implements JsonRepresentedObject, Cloneable, Iterable<MessagePart>,
|
||||
ConfigurationSerializable {
|
||||
|
||||
static {
|
||||
ConfigurationSerialization.registerClass(FancyMessage.class);
|
||||
}
|
||||
|
||||
private List<MessagePart> messageParts;
|
||||
private int index;
|
||||
private String jsonString;
|
||||
private boolean dirty;
|
||||
|
||||
private static Constructor<?> nmsPacketPlayOutChatConstructor;
|
||||
|
||||
@Override
|
||||
public FancyMessage clone() throws CloneNotSupportedException {
|
||||
FancyMessage instance = (FancyMessage) super.clone();
|
||||
instance.messageParts = new ArrayList<>(messageParts.size());
|
||||
for (int i = 0; i < messageParts.size(); i++) {
|
||||
instance.messageParts.add(i, messageParts.get(i).clone());
|
||||
}
|
||||
instance.index = index;
|
||||
instance.dirty = false;
|
||||
instance.jsonString = null;
|
||||
return instance;
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates a JSON message with text.
|
||||
*
|
||||
* @param firstPartText The existing text in the message.
|
||||
*/
|
||||
public FancyMessage(String firstPartText) {
|
||||
this(rawText(firstPartText));
|
||||
}
|
||||
|
||||
private FancyMessage(TextualComponent firstPartText) {
|
||||
messageParts = new ArrayList<>();
|
||||
messageParts.add(new MessagePart(firstPartText));
|
||||
index = messageParts.size();
|
||||
jsonString = null;
|
||||
dirty = false;
|
||||
if (nmsPacketPlayOutChatConstructor == null) {
|
||||
try {
|
||||
nmsPacketPlayOutChatConstructor = Reflection.getNMSClass("PacketPlayOutChat")
|
||||
.getDeclaredConstructor(Reflection.getNMSClass("IChatBaseComponent"));
|
||||
nmsPacketPlayOutChatConstructor.setAccessible(true);
|
||||
} catch (NoSuchMethodException e) {
|
||||
Bukkit.getLogger()
|
||||
.log(Level.SEVERE, "Could not find Minecraft method or constructor.", e);
|
||||
} catch (SecurityException e) {
|
||||
Bukkit.getLogger().log(Level.WARNING, "Could not access constructor.", e);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates a JSON message without text.
|
||||
*/
|
||||
public FancyMessage() {
|
||||
this((TextualComponent) null);
|
||||
}
|
||||
|
||||
/**
|
||||
* Sets the text of the current editing component to a value.
|
||||
*
|
||||
* @param text The new text of the current editing component.
|
||||
* @return This builder instance.
|
||||
*/
|
||||
public FancyMessage text(String text) {
|
||||
MessagePart latest = latest();
|
||||
latest.text = rawText(text);
|
||||
dirty = true;
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Sets the text of the current editing component to a value.
|
||||
*
|
||||
* @param text The new text of the current editing component.
|
||||
* @return This builder instance.
|
||||
*/
|
||||
public FancyMessage text(TextualComponent text) {
|
||||
MessagePart latest = latest();
|
||||
latest.text = text;
|
||||
dirty = true;
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @param text Text with coloring
|
||||
* @return This builder instance.
|
||||
* @throws IllegalArgumentException If the specified {@code ChatColor} enumeration value is not
|
||||
* a color (but a format value).
|
||||
*/
|
||||
public FancyMessage color(String text) {
|
||||
index = messageParts.size();
|
||||
boolean color = false;
|
||||
ArrayDeque<ChatColor> colors = new ArrayDeque<>();
|
||||
int last = 0;
|
||||
for (int i = 0; i < text.length(); i++) {
|
||||
char c = text.charAt(i);
|
||||
if (color != (color = false)) {
|
||||
ChatColor chatColor = ChatColor.getByChar(c);
|
||||
if (chatColor != null) {
|
||||
if (i - last > 1) {
|
||||
append(text.substring(last, i - 1));
|
||||
colors.forEach(this::color);
|
||||
colors.clear();
|
||||
}
|
||||
colors.add(chatColor);
|
||||
last = i + 1;
|
||||
}
|
||||
}
|
||||
if (c == '\u00A7') {
|
||||
color = true;
|
||||
}
|
||||
}
|
||||
if (text.length() - last > 0) {
|
||||
append(text.substring(last));
|
||||
colors.forEach(this::color);
|
||||
}
|
||||
index++;
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Sets the color of the current editing component to a value.<br /> Setting the color will
|
||||
* clear current styles
|
||||
*
|
||||
* @param color The new color of the current editing component.
|
||||
* @return This builder instance.
|
||||
* @throws IllegalArgumentException If the specified {@code ChatColor} enumeration value is not
|
||||
* a color (but a format value).
|
||||
*/
|
||||
public FancyMessage color(ChatColor color) {
|
||||
if (!color.isColor()) {
|
||||
if (color.isFormat()) {
|
||||
return style(color);
|
||||
}
|
||||
if (color == ChatColor.RESET) {
|
||||
color = ChatColor.WHITE;
|
||||
}
|
||||
} else {
|
||||
latest().styles.clear();
|
||||
}
|
||||
latest().color = color;
|
||||
dirty = true;
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Sets the stylization of the current editing component.
|
||||
*
|
||||
* @param styles The array of styles to apply to the editing component.
|
||||
* @return This builder instance.
|
||||
* @throws IllegalArgumentException If any of the enumeration values in the array do not
|
||||
* represent formatters.
|
||||
*/
|
||||
public FancyMessage style(ChatColor... styles) {
|
||||
for (ChatColor style : styles) {
|
||||
if (!style.isFormat()) {
|
||||
color(style);
|
||||
}
|
||||
}
|
||||
latest().styles.addAll(Arrays.asList(styles));
|
||||
dirty = true;
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the behavior of the current editing component to instruct the client to open a file on
|
||||
* the client side filesystem when the currently edited part of the {@code FancyMessage} is
|
||||
* clicked.
|
||||
*
|
||||
* @param path The path of the file on the client filesystem.
|
||||
* @return This builder instance.
|
||||
*/
|
||||
public FancyMessage file(String path) {
|
||||
onClick("open_file", path);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the behavior of the current editing component to instruct the client to open a webpage in
|
||||
* the client's web browser when the currently edited part of the {@code FancyMessage} is
|
||||
* clicked.
|
||||
*
|
||||
* @param url The URL of the page to open when the link is clicked.
|
||||
* @return This builder instance.
|
||||
*/
|
||||
public FancyMessage link(String url) {
|
||||
onClick("open_url", url);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the behavior of the current editing component to instruct the client to replace the chat
|
||||
* input box content with the specified string when the currently edited part of the {@code
|
||||
* FancyMessage} is clicked. The client will not immediately send the command to the server to
|
||||
* be executed unless the client player submits the command/chat message, usually with the enter
|
||||
* key.
|
||||
*
|
||||
* @param command The text to display in the chat bar of the client.
|
||||
* @return This builder instance.
|
||||
*/
|
||||
public FancyMessage suggest(String command) {
|
||||
onClick("suggest_command", command);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the behavior of the current editing component to instruct the client to append the chat
|
||||
* input box content with the specified string when the currently edited part of the {@code
|
||||
* FancyMessage} is SHIFT-CLICKED. The client will not immediately send the command to the
|
||||
* server to be executed unless the client player submits the command/chat message, usually with
|
||||
* the enter key.
|
||||
*
|
||||
* @param command The text to append to the chat bar of the client.
|
||||
* @return This builder instance.
|
||||
*/
|
||||
public FancyMessage insert(String command) {
|
||||
onCurrent(m -> m.insertionData = command);
|
||||
dirty = true;
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the behavior of the current editing component to instruct the client to send the
|
||||
* specified string to the server as a chat message when the currently edited part of the {@code
|
||||
* FancyMessage} is clicked. The client <b>will</b> immediately send the command to the server
|
||||
* to be executed when the editing component is clicked.
|
||||
*
|
||||
* @param command The text to display in the chat bar of the client.
|
||||
* @return This builder instance.
|
||||
*/
|
||||
public FancyMessage command(String command) {
|
||||
onClick("run_command", command);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the behavior of the current editing component to display raw text when the client hovers
|
||||
* over the text.
|
||||
* <p>Tooltips do not inherit display characteristics, such as color and styles, from the
|
||||
* message component on which they are applied.</p>
|
||||
*
|
||||
* @param text The text, which supports newlines, which will be displayed to the client upon
|
||||
* hovering.
|
||||
* @return This builder instance.
|
||||
*/
|
||||
public FancyMessage tooltip(String text) {
|
||||
onHover("show_text", new JsonString(text));
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the behavior of the current editing component to display raw text when the client hovers
|
||||
* over the text.
|
||||
* <p>Tooltips do not inherit display characteristics, such as color and styles, from the
|
||||
* message component on which they are applied.</p>
|
||||
*
|
||||
* @param lines The lines of text which will be displayed to the client upon hovering. The
|
||||
* iteration order of this object will be the order in which the lines of the
|
||||
* tooltip are created.
|
||||
* @return This builder instance.
|
||||
*/
|
||||
public FancyMessage tooltip(Iterable<String> lines) {
|
||||
tooltip(ArrayWrapper.toArray(lines, String.class));
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the behavior of the current editing component to display raw text when the client hovers
|
||||
* over the text.
|
||||
* <p>Tooltips do not inherit display characteristics, such as color and styles, from the
|
||||
* message component on which they are applied.</p>
|
||||
*
|
||||
* @param lines The lines of text which will be displayed to the client upon hovering.
|
||||
* @return This builder instance.
|
||||
*/
|
||||
public FancyMessage tooltip(String... lines) {
|
||||
StringBuilder builder = new StringBuilder();
|
||||
for (int i = 0; i < lines.length; i++) {
|
||||
builder.append(lines[i]);
|
||||
if (i != lines.length - 1) {
|
||||
builder.append('\n');
|
||||
}
|
||||
}
|
||||
tooltip(builder.toString());
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the behavior of the current editing component to display formatted text when the client
|
||||
* hovers over the text.
|
||||
* <p>Tooltips do not inherit display characteristics, such as color and styles, from the
|
||||
* message component on which they are applied.</p>
|
||||
*
|
||||
* @param text The formatted text which will be displayed to the client upon hovering.
|
||||
* @return This builder instance.
|
||||
*/
|
||||
public FancyMessage formattedTooltip(FancyMessage text) {
|
||||
for (MessagePart component : text.messageParts) {
|
||||
if (component.clickActionData != null && component.clickActionName != null) {
|
||||
throw new IllegalArgumentException("The tooltip text cannot have click data.");
|
||||
} else if (component.hoverActionData != null && component.hoverActionName != null) {
|
||||
throw new IllegalArgumentException("The tooltip text cannot have a tooltip.");
|
||||
}
|
||||
}
|
||||
onHover("show_text", text);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the behavior of the current editing component to display the specified lines of formatted
|
||||
* text when the client hovers over the text.
|
||||
* <p>Tooltips do not inherit display characteristics, such as color and styles, from the
|
||||
* message component on which they are applied.</p>
|
||||
*
|
||||
* @param lines The lines of formatted text which will be displayed to the client upon
|
||||
* hovering.
|
||||
* @return This builder instance.
|
||||
*/
|
||||
public FancyMessage formattedTooltip(FancyMessage... lines) {
|
||||
if (lines.length < 1) {
|
||||
onHover(null, null); // Clear tooltip
|
||||
return this;
|
||||
}
|
||||
|
||||
FancyMessage result = new FancyMessage();
|
||||
result.messageParts
|
||||
.clear(); // Remove the one existing text component that exists by default, which destabilizes the object
|
||||
|
||||
for (int i = 0; i < lines.length; i++) {
|
||||
try {
|
||||
for (MessagePart component : lines[i]) {
|
||||
if (component.clickActionData != null && component.clickActionName != null) {
|
||||
throw new IllegalArgumentException(
|
||||
"The tooltip text cannot have click data.");
|
||||
} else if (component.hoverActionData != null
|
||||
&& component.hoverActionName != null) {
|
||||
throw new IllegalArgumentException(
|
||||
"The tooltip text cannot have a tooltip.");
|
||||
}
|
||||
if (component.hasText()) {
|
||||
result.messageParts.add(component.clone());
|
||||
result.index = result.messageParts.size();
|
||||
}
|
||||
}
|
||||
if (i != lines.length - 1) {
|
||||
result.messageParts.add(new MessagePart(rawText("\n")));
|
||||
result.index = result.messageParts.size();
|
||||
}
|
||||
} catch (CloneNotSupportedException e) {
|
||||
Bukkit.getLogger().log(Level.WARNING, "Failed to clone object", e);
|
||||
return this;
|
||||
}
|
||||
}
|
||||
return formattedTooltip(
|
||||
result.messageParts.isEmpty() ? null : result); // Throws NPE if size is 0, intended
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the behavior of the current editing component to display the specified lines of formatted
|
||||
* text when the client hovers over the text.
|
||||
* <p>Tooltips do not inherit display characteristics, such as color and styles, from the
|
||||
* message component on which they are applied.</p>
|
||||
*
|
||||
* @param lines The lines of text which will be displayed to the client upon hovering. The
|
||||
* iteration order of this object will be the order in which the lines of the
|
||||
* tooltip are created.
|
||||
* @return This builder instance.
|
||||
*/
|
||||
public FancyMessage formattedTooltip(Iterable<FancyMessage> lines) {
|
||||
return formattedTooltip(ArrayWrapper.toArray(lines, FancyMessage.class));
|
||||
}
|
||||
|
||||
/**
|
||||
* If the text is a translatable key, and it has replaceable values, this function can be used
|
||||
* to set the replacements that will be used in the message.
|
||||
*
|
||||
* @param replacements The replacements, in order, that will be used in the language-specific
|
||||
* message.
|
||||
* @return This builder instance.
|
||||
*/
|
||||
public FancyMessage translationReplacements(String... replacements) {
|
||||
for (String str : replacements) {
|
||||
latest().translationReplacements.add(new JsonString(str));
|
||||
}
|
||||
dirty = true;
|
||||
|
||||
return this;
|
||||
}
|
||||
/*
|
||||
|
||||
/**
|
||||
* If the text is a translatable key, and it has replaceable values, this function can be used to set the replacements that will be used in the message.
|
||||
* @param replacements The replacements, in order, that will be used in the language-specific message.
|
||||
* @return This builder instance.
|
||||
*/ /* ------------
|
||||
public FancyMessage translationReplacements(final Iterable<? extends CharSequence> replacements){
|
||||
for(CharSequence str : replacements){
|
||||
latest().translationReplacements.add(new JsonString(str));
|
||||
}
|
||||
|
||||
return this;
|
||||
}
|
||||
|
||||
*/
|
||||
|
||||
/**
|
||||
* If the text is a translatable key, and it has replaceable values, this function can be used
|
||||
* to set the replacements that will be used in the message.
|
||||
*
|
||||
* @param replacements The replacements, in order, that will be used in the language-specific
|
||||
* message.
|
||||
* @return This builder instance.
|
||||
*/
|
||||
public FancyMessage translationReplacements(FancyMessage... replacements) {
|
||||
Collections.addAll(latest().translationReplacements, replacements);
|
||||
|
||||
dirty = true;
|
||||
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* If the text is a translatable key, and it has replaceable values, this function can be used
|
||||
* to set the replacements that will be used in the message.
|
||||
*
|
||||
* @param replacements The replacements, in order, that will be used in the language-specific
|
||||
* message.
|
||||
* @return This builder instance.
|
||||
*/
|
||||
public FancyMessage translationReplacements(Iterable<FancyMessage> replacements) {
|
||||
return translationReplacements(
|
||||
ArrayWrapper.toArray(replacements, FancyMessage.class));
|
||||
}
|
||||
|
||||
/**
|
||||
* Terminate construction of the current editing component, and begin construction of a new
|
||||
* message component. After a successful call to this method, all setter methods will refer to a
|
||||
* new message component, created as a result of the call to this method.
|
||||
*
|
||||
* @param text The text which will populate the new message component.
|
||||
* @return This builder instance.
|
||||
*/
|
||||
public FancyMessage then(String text) {
|
||||
return then(rawText(text));
|
||||
}
|
||||
|
||||
private FancyMessage append(String text) {
|
||||
if (!latest().hasText()) {
|
||||
throw new IllegalStateException("previous message part has no text");
|
||||
}
|
||||
MessagePart latest = latest();
|
||||
messageParts.add(new MessagePart(rawText(text)));
|
||||
latest().color = latest.color;
|
||||
latest().styles.addAll(latest.styles);
|
||||
dirty = true;
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Terminate construction of the current editing component, and begin construction of a new
|
||||
* message component. After a successful call to this method, all setter methods will refer to a
|
||||
* new message component, created as a result of the call to this method.
|
||||
*
|
||||
* @param text The text which will populate the new message component.
|
||||
* @return This builder instance.
|
||||
*/
|
||||
public FancyMessage then(TextualComponent text) {
|
||||
if (!latest().hasText()) {
|
||||
throw new IllegalStateException("previous message part has no text");
|
||||
}
|
||||
messageParts.add(new MessagePart(text));
|
||||
index = messageParts.size();
|
||||
dirty = true;
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Terminate construction of the current editing component, and begin construction of a new
|
||||
* message component. After a successful call to this method, all setter methods will refer to a
|
||||
* new message component, created as a result of the call to this method.
|
||||
*
|
||||
* @return This builder instance.
|
||||
*/
|
||||
public FancyMessage then() {
|
||||
if (!latest().hasText()) {
|
||||
throw new IllegalStateException("previous message part has no text");
|
||||
}
|
||||
messageParts.add(new MessagePart());
|
||||
index = messageParts.size();
|
||||
dirty = true;
|
||||
return this;
|
||||
}
|
||||
|
||||
@Override
|
||||
public void writeJson(JsonWriter writer) throws IOException {
|
||||
if (messageParts.size() == 1) {
|
||||
latest().writeJson(writer);
|
||||
} else {
|
||||
writer.beginObject().name("text").value("").name("extra").beginArray();
|
||||
for (MessagePart part : this) {
|
||||
part.writeJson(writer);
|
||||
}
|
||||
writer.endArray().endObject();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Serialize this fancy message, converting it into syntactically-valid JSON using a {@link
|
||||
* JsonWriter}. This JSON should be compatible with vanilla formatter commands such as {@code
|
||||
* /tellraw}.
|
||||
*
|
||||
* @return The JSON string representing this object.
|
||||
*/
|
||||
public String toJSONString() {
|
||||
if (!dirty && jsonString != null) {
|
||||
return jsonString;
|
||||
}
|
||||
StringWriter string = new StringWriter();
|
||||
JsonWriter json = new JsonWriter(string);
|
||||
try {
|
||||
writeJson(json);
|
||||
json.close();
|
||||
} catch (IOException e) {
|
||||
throw new RuntimeException("invalid message");
|
||||
}
|
||||
jsonString = string.toString();
|
||||
dirty = false;
|
||||
return jsonString;
|
||||
}
|
||||
|
||||
/**
|
||||
* Sends this message to a player. The player will receive the fully-fledged formatted display
|
||||
* of this message.
|
||||
*
|
||||
* @param player The player who will receive the message.
|
||||
*/
|
||||
public void send(Player player) {
|
||||
send(player, toJSONString());
|
||||
}
|
||||
|
||||
private void send(CommandSender sender, String jsonString) {
|
||||
if (!(sender instanceof Player)) {
|
||||
sender.sendMessage(toOldMessageFormat());
|
||||
return;
|
||||
}
|
||||
Player player = (Player) sender;
|
||||
try {
|
||||
Object handle = Reflection.getHandle(player);
|
||||
Object connection = Reflection.getField(handle.getClass(), "playerConnection")
|
||||
.get(handle);
|
||||
Reflection
|
||||
.getMethod(connection.getClass(), "sendPacket", Reflection.getNMSClass("Packet"))
|
||||
.invoke(connection, createChatPacket(jsonString));
|
||||
} catch (IllegalArgumentException e) {
|
||||
Bukkit.getLogger().log(Level.WARNING, "Argument could not be passed.", e);
|
||||
} catch (IllegalAccessException e) {
|
||||
Bukkit.getLogger().log(Level.WARNING, "Could not access method.", e);
|
||||
} catch (InstantiationException e) {
|
||||
Bukkit.getLogger().log(Level.WARNING, "Underlying class is abstract.", e);
|
||||
} catch (InvocationTargetException e) {
|
||||
Bukkit.getLogger()
|
||||
.log(Level.WARNING, "A error has occurred during invoking of method.", e);
|
||||
} catch (NoSuchMethodException e) {
|
||||
Bukkit.getLogger().log(Level.WARNING, "Could not find method.", e);
|
||||
} catch (ClassNotFoundException e) {
|
||||
Bukkit.getLogger().log(Level.WARNING, "Could not find class.", e);
|
||||
}
|
||||
}
|
||||
|
||||
// The ChatSerializer's instance of Gson
|
||||
private static Object nmsChatSerializerGsonInstance;
|
||||
private static Method fromJsonMethod;
|
||||
|
||||
private Object createChatPacket(String json)
|
||||
throws IllegalArgumentException, IllegalAccessException, InstantiationException, InvocationTargetException, NoSuchMethodException, ClassNotFoundException {
|
||||
if (nmsChatSerializerGsonInstance == null) {
|
||||
// Find the field and its value, completely bypassing obfuscation
|
||||
Class<?> chatSerializerClazz;
|
||||
|
||||
// Get the three parts of the version string (major version is currently unused)
|
||||
// vX_Y_RZ
|
||||
// X = major
|
||||
// Y = minor
|
||||
// Z = revision
|
||||
final String version = Reflection.getVersion();
|
||||
String[] split = version.substring(1, version.length() - 1)
|
||||
.split("_"); // Remove trailing dot
|
||||
//int majorVersion = Integer.parseInt(split[0]);
|
||||
int minorVersion = Integer.parseInt(split[1]);
|
||||
int revisionVersion = Integer.parseInt(split[2].substring(1)); // Substring to ignore R
|
||||
|
||||
if (minorVersion < 8 || minorVersion == 8 && revisionVersion == 1) {
|
||||
chatSerializerClazz = Reflection.getNMSClass("ChatSerializer");
|
||||
} else {
|
||||
chatSerializerClazz = Reflection.getNMSClass("IChatBaseComponent$ChatSerializer");
|
||||
}
|
||||
|
||||
if (chatSerializerClazz == null) {
|
||||
throw new ClassNotFoundException("Can't find the ChatSerializer class");
|
||||
}
|
||||
|
||||
for (Field declaredField : chatSerializerClazz.getDeclaredFields()) {
|
||||
if (Modifier.isFinal(declaredField.getModifiers()) && Modifier
|
||||
.isStatic(declaredField.getModifiers()) && declaredField.getType().getName()
|
||||
.endsWith("Gson")) {
|
||||
// We've found our field
|
||||
declaredField.setAccessible(true);
|
||||
nmsChatSerializerGsonInstance = declaredField.get(null);
|
||||
fromJsonMethod = nmsChatSerializerGsonInstance.getClass()
|
||||
.getMethod("fromJson", String.class, Class.class);
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Since the method is so simple, and all the obfuscated methods have the same name, it's easier to reimplement 'IChatBaseComponent a(String)' than to reflectively call it
|
||||
// Of course, the implementation may change, but fuzzy matches might break with signature changes
|
||||
Object serializedChatComponent = fromJsonMethod.invoke(nmsChatSerializerGsonInstance, json,
|
||||
Reflection.getNMSClass("IChatBaseComponent"));
|
||||
|
||||
return nmsPacketPlayOutChatConstructor.newInstance(serializedChatComponent);
|
||||
}
|
||||
|
||||
/**
|
||||
* Sends this message to a command sender. If the sender is a player, they will receive the
|
||||
* fully-fledged formatted display of this message. Otherwise, they will receive a version of
|
||||
* this message with less formatting.
|
||||
*
|
||||
* @param sender The command sender who will receive the message.
|
||||
* @see #toOldMessageFormat()
|
||||
*/
|
||||
public void send(CommandSender sender) {
|
||||
send(sender, toJSONString());
|
||||
}
|
||||
|
||||
/**
|
||||
* Sends this message to multiple command senders.
|
||||
*
|
||||
* @param senders The command senders who will receive the message.
|
||||
* @see #send(CommandSender)
|
||||
*/
|
||||
public void send(Iterable<? extends CommandSender> senders) {
|
||||
String string = toJSONString();
|
||||
for (CommandSender sender : senders) {
|
||||
send(sender, string);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Convert this message to a human-readable string with limited formatting. This method is used
|
||||
* to send this message to clients without JSON formatting support.
|
||||
* <p>
|
||||
* Serialization of this message by using this message will include (in this order for each
|
||||
* message part):
|
||||
* <ol>
|
||||
* <li>The color of each message part.</li>
|
||||
* <li>The applicable stylizations for each message part.</li>
|
||||
* <li>The core text of the message part.</li>
|
||||
* </ol>
|
||||
* The primary omissions are tooltips and clickable actions. Consequently, this method should be used only as a last resort.
|
||||
* </p>
|
||||
* <p>
|
||||
* Color and formatting can be removed from the returned string by using {@link ChatColor#stripColor(String)}.</p>
|
||||
*
|
||||
* @return A human-readable string representing limited formatting in addition to the core text
|
||||
* of this message.
|
||||
*/
|
||||
public String toOldMessageFormat() {
|
||||
StringBuilder result = new StringBuilder();
|
||||
for (MessagePart part : this) {
|
||||
result.append(part.color == null ? "" : part.color);
|
||||
for (ChatColor formatSpecifier : part.styles) {
|
||||
result.append(formatSpecifier);
|
||||
}
|
||||
result.append(part.text);
|
||||
}
|
||||
return result.toString();
|
||||
}
|
||||
|
||||
private void onCurrent(Consumer<MessagePart> call) {
|
||||
for (int i = index - 1; i < messageParts.size(); i++) {
|
||||
call.accept(messageParts.get(i));
|
||||
}
|
||||
}
|
||||
|
||||
private MessagePart latest() {
|
||||
return messageParts.get(messageParts.size() - 1);
|
||||
}
|
||||
|
||||
private void onClick(String name, String data) {
|
||||
onCurrent(m -> {
|
||||
m.clickActionName = name;
|
||||
m.clickActionData = data;
|
||||
});
|
||||
dirty = true;
|
||||
}
|
||||
|
||||
private void onHover(String name, JsonRepresentedObject data) {
|
||||
onCurrent(m -> {
|
||||
m.hoverActionName = name;
|
||||
m.hoverActionData = data;
|
||||
});
|
||||
dirty = true;
|
||||
}
|
||||
|
||||
// Doc copied from interface
|
||||
@Override
|
||||
public Map<String, Object> serialize() {
|
||||
HashMap<String, Object> map = new HashMap<>();
|
||||
map.put("messageParts", messageParts);
|
||||
// map.put("JSON", toJSONString());
|
||||
return map;
|
||||
}
|
||||
|
||||
/**
|
||||
* Deserializes a JSON-represented message from a mapping of key-value pairs. This is called by
|
||||
* the Bukkit serialization API. It is not intended for direct public API consumption.
|
||||
*
|
||||
* @param serialized The key-value mapping which represents a fancy message.
|
||||
*/
|
||||
@SuppressWarnings("unchecked")
|
||||
public static FancyMessage deserialize(Map<String, Object> serialized) {
|
||||
FancyMessage msg = new FancyMessage();
|
||||
msg.messageParts = (List<MessagePart>) serialized.get("messageParts");
|
||||
msg.jsonString = serialized.containsKey("JSON") ? serialized.get("JSON").toString() : null;
|
||||
msg.dirty = !serialized.containsKey("JSON");
|
||||
return msg;
|
||||
}
|
||||
|
||||
/**
|
||||
* <b>Internally called method. Not for API consumption.</b>
|
||||
*/
|
||||
@Override
|
||||
@NotNull
|
||||
public Iterator<MessagePart> iterator() {
|
||||
return messageParts.iterator();
|
||||
}
|
||||
|
||||
private static JsonParser _stringParser = new JsonParser();
|
||||
|
||||
/**
|
||||
* Deserializes a fancy message from its JSON representation. This JSON representation is of the
|
||||
* format of that returned by {@link #toJSONString()}, and is compatible with vanilla inputs.
|
||||
*
|
||||
* @param json The JSON string which represents a fancy message.
|
||||
* @return A {@code FancyMessage} representing the parameterized JSON message.
|
||||
*/
|
||||
public static FancyMessage deserialize(String json) {
|
||||
JsonObject serialized = _stringParser.parse(json).getAsJsonObject();
|
||||
JsonArray extra = serialized.getAsJsonArray("extra"); // Get the extra component
|
||||
FancyMessage returnVal = new FancyMessage();
|
||||
returnVal.messageParts.clear();
|
||||
for (JsonElement mPrt : extra) {
|
||||
MessagePart component = new MessagePart();
|
||||
JsonObject messagePart = mPrt.getAsJsonObject();
|
||||
for (Map.Entry<String, JsonElement> entry : messagePart.entrySet()) {
|
||||
// Deserialize text
|
||||
if (TextualComponent.isTextKey(entry.getKey())) {
|
||||
// The map mimics the YAML serialization, which has a "key" field and one or more "value" fields
|
||||
Map<String, Object> serializedMapForm = new HashMap<>(); // Must be object due to Bukkit serializer API compliance
|
||||
serializedMapForm.put("key", entry.getKey());
|
||||
if (entry.getValue().isJsonPrimitive()) {
|
||||
// Assume string
|
||||
serializedMapForm.put("value", entry.getValue().getAsString());
|
||||
} else {
|
||||
// Composite object, but we assume each element is a string
|
||||
for (Map.Entry<String, JsonElement> compositeNestedElement : entry
|
||||
.getValue().getAsJsonObject().entrySet()) {
|
||||
serializedMapForm.put("value." + compositeNestedElement.getKey(),
|
||||
compositeNestedElement.getValue().getAsString());
|
||||
}
|
||||
}
|
||||
component.text = TextualComponent.deserialize(serializedMapForm);
|
||||
} else if (MessagePart.stylesToNames.inverse().containsKey(entry.getKey())) {
|
||||
if (entry.getValue().getAsBoolean()) {
|
||||
component.styles
|
||||
.add(MessagePart.stylesToNames.inverse().get(entry.getKey()));
|
||||
}
|
||||
} else if (entry.getKey().equals("color")) {
|
||||
component.color = ChatColor.valueOf(entry.getValue().getAsString().toUpperCase());
|
||||
} else if (entry.getKey().equals("clickEvent")) {
|
||||
JsonObject object = entry.getValue().getAsJsonObject();
|
||||
component.clickActionName = object.get("action").getAsString();
|
||||
component.clickActionData = object.get("value").getAsString();
|
||||
} else if (entry.getKey().equals("hoverEvent")) {
|
||||
JsonObject object = entry.getValue().getAsJsonObject();
|
||||
component.hoverActionName = object.get("action").getAsString();
|
||||
if (object.get("value").isJsonPrimitive()) {
|
||||
// Assume string
|
||||
component.hoverActionData = new JsonString(
|
||||
object.get("value").getAsString());
|
||||
} else {
|
||||
// Assume composite type
|
||||
// The only composite type we currently store is another FancyMessage
|
||||
// Therefore, recursion time!
|
||||
component.hoverActionData = deserialize(object.get("value")
|
||||
.toString() /* This should properly serialize the JSON object as a JSON string */);
|
||||
}
|
||||
} else if (entry.getKey().equals("insertion")) {
|
||||
component.insertionData = entry.getValue().getAsString();
|
||||
} else if (entry.getKey().equals("with")) {
|
||||
for (JsonElement object : entry.getValue().getAsJsonArray()) {
|
||||
if (object.isJsonPrimitive()) {
|
||||
component.translationReplacements
|
||||
.add(new JsonString(object.getAsString()));
|
||||
} else {
|
||||
// Only composite type stored in this array is - again - FancyMessages
|
||||
// Recurse within this function to parse this as a translation replacement
|
||||
component.translationReplacements.add(deserialize(object.toString()));
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
returnVal.messageParts.add(component);
|
||||
returnVal.index = returnVal.messageParts.size();
|
||||
}
|
||||
return returnVal;
|
||||
}
|
||||
|
||||
}
|
@ -1,156 +0,0 @@
|
||||
package com.boydti.fawe.bukkit.chat;
|
||||
|
||||
import com.google.common.collect.BiMap;
|
||||
import com.google.common.collect.ImmutableBiMap;
|
||||
import com.google.gson.stream.JsonWriter;
|
||||
import java.io.IOException;
|
||||
import java.util.ArrayList;
|
||||
import java.util.HashMap;
|
||||
import java.util.Map;
|
||||
import java.util.logging.Level;
|
||||
import org.bukkit.Bukkit;
|
||||
import org.bukkit.ChatColor;
|
||||
import org.bukkit.configuration.serialization.ConfigurationSerializable;
|
||||
import org.bukkit.configuration.serialization.ConfigurationSerialization;
|
||||
|
||||
/**
|
||||
* Internal class: Represents a component of a JSON-serializable {@link FancyMessage}.
|
||||
*/
|
||||
final class MessagePart implements JsonRepresentedObject, ConfigurationSerializable, Cloneable {
|
||||
|
||||
ChatColor color = ChatColor.WHITE;
|
||||
ArrayList<ChatColor> styles = new ArrayList<>();
|
||||
String clickActionName = null;
|
||||
String clickActionData = null;
|
||||
String hoverActionName = null;
|
||||
JsonRepresentedObject hoverActionData = null;
|
||||
TextualComponent text = null;
|
||||
String insertionData = null;
|
||||
ArrayList<JsonRepresentedObject> translationReplacements = new ArrayList<>();
|
||||
|
||||
MessagePart(final TextualComponent text) {
|
||||
this.text = text;
|
||||
}
|
||||
|
||||
MessagePart() {
|
||||
this.text = null;
|
||||
}
|
||||
|
||||
boolean hasText() {
|
||||
return text != null;
|
||||
}
|
||||
|
||||
@Override
|
||||
@SuppressWarnings("unchecked")
|
||||
public MessagePart clone() throws CloneNotSupportedException {
|
||||
MessagePart obj = (MessagePart) super.clone();
|
||||
obj.styles = (ArrayList<ChatColor>) styles.clone();
|
||||
if (hoverActionData instanceof JsonString) {
|
||||
obj.hoverActionData = new JsonString(((JsonString) hoverActionData).getValue());
|
||||
} else if (hoverActionData instanceof FancyMessage) {
|
||||
obj.hoverActionData = ((FancyMessage) hoverActionData).clone();
|
||||
}
|
||||
obj.translationReplacements = (ArrayList<JsonRepresentedObject>) translationReplacements.clone();
|
||||
return obj;
|
||||
|
||||
}
|
||||
|
||||
static final BiMap<ChatColor, String> stylesToNames;
|
||||
|
||||
static {
|
||||
ImmutableBiMap.Builder<ChatColor, String> builder = ImmutableBiMap.builder();
|
||||
for (final ChatColor style : ChatColor.values()) {
|
||||
if (!style.isFormat()) {
|
||||
continue;
|
||||
}
|
||||
|
||||
String styleName;
|
||||
switch (style) {
|
||||
case MAGIC:
|
||||
styleName = "obfuscated";
|
||||
break;
|
||||
case UNDERLINE:
|
||||
styleName = "underlined";
|
||||
break;
|
||||
default:
|
||||
styleName = style.name().toLowerCase();
|
||||
break;
|
||||
}
|
||||
|
||||
builder.put(style, styleName);
|
||||
}
|
||||
stylesToNames = builder.build();
|
||||
}
|
||||
|
||||
public void writeJson(JsonWriter json) {
|
||||
try {
|
||||
json.beginObject();
|
||||
text.writeJson(json);
|
||||
json.name("color").value(color.name().toLowerCase());
|
||||
for (final ChatColor style : styles) {
|
||||
json.name(stylesToNames.get(style)).value(true);
|
||||
}
|
||||
if (clickActionName != null && clickActionData != null) {
|
||||
json.name("clickEvent")
|
||||
.beginObject()
|
||||
.name("action").value(clickActionName)
|
||||
.name("value").value(clickActionData)
|
||||
.endObject();
|
||||
}
|
||||
if (hoverActionName != null && hoverActionData != null) {
|
||||
json.name("hoverEvent")
|
||||
.beginObject()
|
||||
.name("action").value(hoverActionName)
|
||||
.name("value");
|
||||
hoverActionData.writeJson(json);
|
||||
json.endObject();
|
||||
}
|
||||
if (insertionData != null) {
|
||||
json.name("insertion").value(insertionData);
|
||||
}
|
||||
if (translationReplacements.size() > 0 && text != null && TextualComponent.isTranslatableText(text)) {
|
||||
json.name("with").beginArray();
|
||||
for (JsonRepresentedObject obj : translationReplacements) {
|
||||
obj.writeJson(json);
|
||||
}
|
||||
json.endArray();
|
||||
}
|
||||
json.endObject();
|
||||
} catch (IOException e) {
|
||||
Bukkit.getLogger().log(Level.WARNING, "A problem occured during writing of JSON string", e);
|
||||
}
|
||||
}
|
||||
|
||||
public Map<String, Object> serialize() {
|
||||
HashMap<String, Object> map = new HashMap<>();
|
||||
map.put("text", text);
|
||||
map.put("styles", styles);
|
||||
map.put("color", color.getChar());
|
||||
map.put("hoverActionName", hoverActionName);
|
||||
map.put("hoverActionData", hoverActionData);
|
||||
map.put("clickActionName", clickActionName);
|
||||
map.put("clickActionData", clickActionData);
|
||||
map.put("insertion", insertionData);
|
||||
map.put("translationReplacements", translationReplacements);
|
||||
return map;
|
||||
}
|
||||
|
||||
@SuppressWarnings("unchecked")
|
||||
public static MessagePart deserialize(Map<String, Object> serialized) {
|
||||
MessagePart part = new MessagePart((TextualComponent) serialized.get("text"));
|
||||
part.styles = (ArrayList<ChatColor>) serialized.get("styles");
|
||||
part.color = ChatColor.getByChar(serialized.get("color").toString());
|
||||
part.hoverActionName = (String) serialized.get("hoverActionName");
|
||||
part.hoverActionData = (JsonRepresentedObject) serialized.get("hoverActionData");
|
||||
part.clickActionName = (String) serialized.get("clickActionName");
|
||||
part.clickActionData = (String) serialized.get("clickActionData");
|
||||
part.insertionData = (String) serialized.get("insertion");
|
||||
part.translationReplacements = (ArrayList<JsonRepresentedObject>) serialized.get("translationReplacements");
|
||||
return part;
|
||||
}
|
||||
|
||||
static {
|
||||
ConfigurationSerialization.registerClass(MessagePart.class);
|
||||
}
|
||||
|
||||
}
|
@ -26,7 +26,9 @@ import com.sk89q.worldedit.event.platform.Interaction;
|
||||
import com.sk89q.worldedit.extension.platform.PlatformManager;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
|
||||
import com.sk89q.worldedit.util.formatting.text.TextComponent.Builder;
|
||||
import java.lang.reflect.InvocationTargetException;
|
||||
import java.net.URI;
|
||||
import java.util.List;
|
||||
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
@ -59,7 +61,7 @@ public class CFIPacketListener implements Listener {
|
||||
// Direct digging to the virtual world
|
||||
registerBlockEvent(PacketType.Play.Client.BLOCK_DIG, false, new RunnableVal3<PacketEvent, VirtualWorld, BlockVector3>() {
|
||||
@Override
|
||||
public void run(PacketEvent event, VirtualWorld gen, BlockVector3 pt) {
|
||||
public void run(Builder event, URI gen, String pt) {
|
||||
try {
|
||||
Player plr = event.getPlayer();
|
||||
BlockVector3 realPos = pt.add(gen.getOrigin().toBlockPoint());
|
||||
@ -75,7 +77,7 @@ public class CFIPacketListener implements Listener {
|
||||
// Direct placing to the virtual world
|
||||
RunnableVal3<PacketEvent, VirtualWorld, BlockVector3> placeTask = new RunnableVal3<PacketEvent, VirtualWorld, BlockVector3>() {
|
||||
@Override
|
||||
public void run(PacketEvent event, VirtualWorld gen, BlockVector3 pt) {
|
||||
public void run(Builder event, URI gen, String pt) {
|
||||
try {
|
||||
Player plr = event.getPlayer();
|
||||
List<EnumWrappers.Hand> hands = event.getPacket().getHands().getValues();
|
||||
@ -112,7 +114,7 @@ public class CFIPacketListener implements Listener {
|
||||
// Cancel block change packets where the real world overlaps with the virtual one
|
||||
registerBlockEvent(PacketType.Play.Server.BLOCK_CHANGE, false, new RunnableVal3<PacketEvent, VirtualWorld, BlockVector3>() {
|
||||
@Override
|
||||
public void run(PacketEvent event, VirtualWorld gen, BlockVector3 pt) {
|
||||
public void run(Builder event, URI gen, String pt) {
|
||||
// Do nothing
|
||||
}
|
||||
});
|
||||
|
@ -3,7 +3,7 @@ package com.boydti.fawe.bukkit.regions;
|
||||
import com.boydti.fawe.object.FawePlayer;
|
||||
import com.boydti.fawe.object.RegionWrapper;
|
||||
import com.boydti.fawe.regions.FaweMask;
|
||||
import com.boydti.fawe.util.Perm;
|
||||
import com.boydti.fawe.util.Permission;
|
||||
import com.massivecraft.factions.FLocation;
|
||||
import com.sk89q.worldedit.bukkit.BukkitAdapter;
|
||||
import org.bukkit.Chunk;
|
||||
@ -30,7 +30,8 @@ public class FactionsOneFeature extends BukkitMaskManager implements Listener {
|
||||
public FaweMask getMask(final FawePlayer<Player> fp, MaskType type) {
|
||||
final Player player = fp.parent;
|
||||
final Chunk chunk = player.getLocation().getChunk();
|
||||
final boolean perm = Perm.hasPermission(FawePlayer.wrap(player), "fawe.factions.wilderness");
|
||||
final boolean perm = Permission
|
||||
.hasPermission(fp.toWorldEditPlayer(), "fawe.factions.wilderness");
|
||||
final World world = player.getWorld();
|
||||
|
||||
RegionWrapper locs = new RegionWrapper(chunk.getX(), chunk.getX(), chunk.getZ(), chunk.getZ());
|
||||
@ -40,7 +41,7 @@ public class FactionsOneFeature extends BukkitMaskManager implements Listener {
|
||||
if (this.isAdded(locs, world, player, perm, type)) {
|
||||
boolean hasPerm = true;
|
||||
|
||||
while (hasPerm && (count > 0)) {
|
||||
while (hasPerm && count > 0) {
|
||||
count--;
|
||||
|
||||
hasPerm = false;
|
||||
|
@ -4,7 +4,7 @@ import com.boydti.fawe.bukkit.FaweBukkit;
|
||||
import com.boydti.fawe.object.FawePlayer;
|
||||
import com.boydti.fawe.object.RegionWrapper;
|
||||
import com.boydti.fawe.regions.FaweMask;
|
||||
import com.boydti.fawe.util.Perm;
|
||||
import com.boydti.fawe.util.Permission;
|
||||
import com.massivecraft.factions.Board;
|
||||
import com.massivecraft.factions.FLocation;
|
||||
import com.massivecraft.factions.Faction;
|
||||
@ -28,7 +28,8 @@ public class FactionsUUIDFeature extends BukkitMaskManager implements Listener {
|
||||
public FaweMask getMask(final FawePlayer<Player> fp, MaskType type) {
|
||||
final Player player = fp.parent;
|
||||
final Chunk chunk = player.getLocation().getChunk();
|
||||
final boolean perm = Perm.hasPermission(FawePlayer.wrap(player), "fawe.factions.wilderness");
|
||||
final boolean perm = Permission
|
||||
.hasPermission(fp.toWorldEditPlayer(), "fawe.factions.wilderness");
|
||||
final World world = player.getWorld();
|
||||
|
||||
RegionWrapper locs = new RegionWrapper(chunk.getX(), chunk.getX(), chunk.getZ(), chunk.getZ());
|
||||
@ -38,7 +39,7 @@ public class FactionsUUIDFeature extends BukkitMaskManager implements Listener {
|
||||
if (this.isAdded(locs, world, player, perm, type)) {
|
||||
boolean hasPerm = true;
|
||||
|
||||
while (hasPerm && (count > 0)) {
|
||||
while (hasPerm && count > 0) {
|
||||
count--;
|
||||
|
||||
hasPerm = false;
|
||||
|
@ -1,15 +1,15 @@
|
||||
package com.boydti.fawe.bukkit.wrapper.state;
|
||||
|
||||
import com.boydti.fawe.bukkit.chat.FancyMessage;
|
||||
import com.boydti.fawe.bukkit.wrapper.AsyncBlock;
|
||||
import com.boydti.fawe.bukkit.wrapper.AsyncBlockState;
|
||||
import com.boydti.fawe.util.ReflectionUtils;
|
||||
import com.sk89q.jnbt.CompoundTag;
|
||||
import com.sk89q.jnbt.StringTag;
|
||||
import com.sk89q.jnbt.Tag;
|
||||
import com.sk89q.worldedit.util.formatting.text.TextComponent;
|
||||
import com.sk89q.worldedit.util.formatting.text.serializer.gson.GsonComponentSerializer;
|
||||
import com.sk89q.worldedit.util.formatting.text.serializer.legacy.LegacyComponentSerializer;
|
||||
import java.util.Map;
|
||||
|
||||
import net.minecraft.server.v1_14_R1.TileEntitySign;
|
||||
import org.bukkit.DyeColor;
|
||||
import org.bukkit.block.Sign;
|
||||
import org.bukkit.persistence.PersistentDataContainer;
|
||||
@ -37,18 +37,18 @@ public class AsyncSign extends AsyncBlockState implements Sign {
|
||||
|
||||
private String fromJson(String jsonInput) {
|
||||
if (jsonInput == null || jsonInput.isEmpty()) return "";
|
||||
return FancyMessage.deserialize(jsonInput).toOldMessageFormat();
|
||||
return GsonComponentSerializer.INSTANCE.deserialize(jsonInput).toString();
|
||||
}
|
||||
|
||||
private String toJson(String oldInput) {
|
||||
if (oldInput == null || oldInput.isEmpty()) return "";
|
||||
return new FancyMessage("").color(oldInput).toJSONString();
|
||||
return LegacyComponentSerializer.INSTANCE.serialize(TextComponent.of(oldInput));
|
||||
}
|
||||
|
||||
@Override
|
||||
public String getLine(int index) throws IndexOutOfBoundsException {
|
||||
CompoundTag nbt = getNbtData();
|
||||
return nbt == null ? null : fromJson(nbt.getString("Text" + (index + 1)));
|
||||
return nbt == null ? "" : fromJson(nbt.getString("Text" + (index + 1)));
|
||||
}
|
||||
|
||||
@Override
|
||||
@ -80,7 +80,7 @@ public class AsyncSign extends AsyncBlockState implements Sign {
|
||||
CompoundTag nbt = getNbtData();
|
||||
if (nbt != null) {
|
||||
String color = nbt.getString("Color").toUpperCase();
|
||||
if (color != null) return DyeColor.valueOf(color);
|
||||
return DyeColor.valueOf(color);
|
||||
}
|
||||
return DyeColor.BLACK;
|
||||
}
|
||||
|
@ -7,27 +7,39 @@ import com.boydti.fawe.config.Settings;
|
||||
import com.boydti.fawe.object.FawePlayer;
|
||||
import com.boydti.fawe.object.brush.visualization.VisualQueue;
|
||||
import com.boydti.fawe.regions.general.plot.PlotSquaredFeature;
|
||||
import com.boydti.fawe.util.*;
|
||||
import com.boydti.fawe.util.chat.ChatManager;
|
||||
import com.boydti.fawe.util.chat.PlainChatManager;
|
||||
import com.boydti.fawe.util.CachedTextureUtil;
|
||||
import com.boydti.fawe.util.CleanTextureUtil;
|
||||
import com.boydti.fawe.util.FaweTimer;
|
||||
import com.boydti.fawe.util.MainUtil;
|
||||
import com.boydti.fawe.util.MemUtil;
|
||||
import com.boydti.fawe.util.RandomTextureUtil;
|
||||
import com.boydti.fawe.util.TaskManager;
|
||||
import com.boydti.fawe.util.TextureUtil;
|
||||
import com.boydti.fawe.util.WEManager;
|
||||
import com.sk89q.worldedit.WorldEdit;
|
||||
import com.sk89q.worldedit.extension.factory.DefaultTransformParser;
|
||||
import com.sk89q.worldedit.extension.platform.Actor;
|
||||
import com.sk89q.worldedit.session.request.Request;
|
||||
|
||||
import javax.annotation.Nullable;
|
||||
import javax.management.InstanceAlreadyExistsException;
|
||||
import javax.management.NotificationEmitter;
|
||||
import java.io.*;
|
||||
import java.io.BufferedReader;
|
||||
import java.io.File;
|
||||
import java.io.FileNotFoundException;
|
||||
import java.io.IOException;
|
||||
import java.io.InputStream;
|
||||
import java.io.InputStreamReader;
|
||||
import java.lang.management.ManagementFactory;
|
||||
import java.lang.management.MemoryMXBean;
|
||||
import java.lang.management.MemoryPoolMXBean;
|
||||
import java.lang.management.MemoryUsage;
|
||||
import java.util.*;
|
||||
import java.util.Collection;
|
||||
import java.util.Date;
|
||||
import java.util.List;
|
||||
import java.util.Objects;
|
||||
import java.util.UUID;
|
||||
import java.util.concurrent.ConcurrentHashMap;
|
||||
import java.util.concurrent.TimeUnit;
|
||||
|
||||
import static com.google.common.base.Preconditions.checkNotNull;
|
||||
import javax.annotation.Nullable;
|
||||
import javax.management.InstanceAlreadyExistsException;
|
||||
import javax.management.NotificationEmitter;
|
||||
|
||||
/**
|
||||
* [ WorldEdit action]
|
||||
@ -80,7 +92,6 @@ public class Fawe {
|
||||
private VisualQueue visualQueue;
|
||||
private TextureUtil textures;
|
||||
private DefaultTransformParser transformParser;
|
||||
private ChatManager chatManager = new PlainChatManager();
|
||||
|
||||
private QueueHandler queueHandler;
|
||||
|
||||
@ -202,15 +213,6 @@ public class Fawe {
|
||||
return queueHandler;
|
||||
}
|
||||
|
||||
public ChatManager getChatManager() {
|
||||
return chatManager;
|
||||
}
|
||||
|
||||
public void setChatManager(ChatManager chatManager) {
|
||||
checkNotNull(chatManager);
|
||||
this.chatManager = chatManager;
|
||||
}
|
||||
|
||||
public DefaultTransformParser getTransformParser() {
|
||||
return transformParser;
|
||||
}
|
||||
|
@ -16,8 +16,10 @@ import java.util.UUID;
|
||||
* Interface for setting blocks
|
||||
*/
|
||||
public interface IChunkSet extends IBlocks, OutputExtent {
|
||||
@Override
|
||||
boolean setBiome(int x, int y, int z, BiomeType biome);
|
||||
|
||||
@Override
|
||||
boolean setBlock(int x, int y, int z, BlockStateHolder holder);
|
||||
|
||||
boolean isEmpty();
|
||||
|
@ -59,11 +59,13 @@ public interface IQueueExtent extends Flushable, Trimable, Extent {
|
||||
*/
|
||||
<T extends Future<T>> T submit(IChunk<T> chunk);
|
||||
|
||||
@Override
|
||||
default boolean setBlock(final int x, final int y, final int z, final BlockStateHolder state) {
|
||||
final IChunk chunk = getCachedChunk(x >> 4, z >> 4);
|
||||
return chunk.setBlock(x & 15, y, z & 15, state);
|
||||
}
|
||||
|
||||
@Override
|
||||
default boolean setBiome(final int x, final int y, final int z, final BiomeType biome) {
|
||||
final IChunk chunk = getCachedChunk(x >> 4, z >> 4);
|
||||
return chunk.setBiome(x & 15, y, z & 15, biome);
|
||||
@ -127,4 +129,4 @@ public interface IQueueExtent extends Flushable, Trimable, Extent {
|
||||
boolean isEmpty();
|
||||
|
||||
void sendChunk(int chunkX, int chunkZ, int bitMask);
|
||||
}
|
||||
}
|
||||
|
@ -47,6 +47,7 @@ import com.sk89q.worldedit.util.Location;
|
||||
import com.sk89q.worldedit.util.formatting.text.TextComponent;
|
||||
import com.sk89q.worldedit.util.formatting.text.TextComponent.Builder;
|
||||
import com.sk89q.worldedit.util.formatting.text.event.ClickEvent;
|
||||
import com.sk89q.worldedit.util.formatting.text.event.HoverEvent;
|
||||
import com.sk89q.worldedit.world.World;
|
||||
import com.sk89q.worldedit.world.biome.BiomeType;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
@ -354,7 +355,7 @@ public class CFICommands {
|
||||
floor(fp, BlockTypes.SNOW.getDefaultState().with(PropertyKey.LAYERS, 7), image, mask, disableWhiteOnly);
|
||||
main(fp, BlockTypes.SNOW_BLOCK, image, mask, disableWhiteOnly);
|
||||
smooth(fp, 1, 8, image, mask, disableWhiteOnly);
|
||||
TextComponent.of("Added snow!").send(fp);
|
||||
fp.toWorldEditPlayer().print(TextComponent.of("Added snow!"));
|
||||
assertSettings(fp).resetComponent();
|
||||
component(fp);
|
||||
}
|
||||
@ -383,17 +384,28 @@ public class CFICommands {
|
||||
@CommandPermissions("worldedit.anvil.cfi")
|
||||
public void paletteblocks(FawePlayer fp, Player player, LocalSession session, @Arg(name = "arg", desc = "String", def = "") String arg) throws EmptyClipboardException, InputParseException, FileNotFoundException {
|
||||
if (arg == null) {
|
||||
TextComponent.of("What blocks do you want to color with?").append(newline())
|
||||
.text("[All]").cmdTip(alias() + " PaletteBlocks *").text(" - All available blocks")
|
||||
.append(newline())
|
||||
.text("[Clipboard]").cmdTip(alias() + " PaletteBlocks #clipboard").text(" - The blocks in your clipboard")
|
||||
.append(newline())
|
||||
.text("[List]").suggestTip(alias() + " PaletteBlocks stone,gravel").text(" - A comma separated list of blocks")
|
||||
.append(newline())
|
||||
.text("[Complexity]").cmdTip(alias() + " Complexity").text(" - Block textures within a complexity range")
|
||||
.append(newline())
|
||||
.text("< [Back]").cmdTip(alias() + " " + Commands.getAlias(CFICommands.class, "coloring"))
|
||||
.send(fp);
|
||||
TextComponent build = TextComponent.builder("What blocks do you want to color with?")
|
||||
.append(newline())
|
||||
.append(TextComponent.of("[All]")
|
||||
.clickEvent(ClickEvent.runCommand("/cfi PaletteBlocks *")))
|
||||
.append(" - All available blocks")
|
||||
.append(newline())
|
||||
.append(TextComponent.of("[Clipboard]")
|
||||
.clickEvent(ClickEvent.runCommand("/cfi PaletteBlocks #clipboard")))
|
||||
.append(" - The blocks in your clipboard")
|
||||
.append(newline())
|
||||
.append(TextComponent.of("[List]")
|
||||
.clickEvent(ClickEvent.runCommand("/cfi PaletteBlocks stone,gravel")))
|
||||
.append(" - A comma separated list of blocks")
|
||||
.append(newline())
|
||||
.append(TextComponent.of("[Complexity]")
|
||||
.clickEvent(ClickEvent.runCommand("/cfi Complexity")))
|
||||
.append(" - Block textures within a complexity range")
|
||||
.append(newline())
|
||||
.append(TextComponent.of("< [Back]").clickEvent(ClickEvent
|
||||
.runCommand("/cfi " + Commands.getAlias(CFICommands.class, "coloring"))))
|
||||
.build();
|
||||
fp.toWorldEditPlayer().print(build);
|
||||
return;
|
||||
}
|
||||
HeightMapMCAGenerator generator = assertSettings(fp).getGenerator();
|
||||
@ -505,7 +517,7 @@ public class CFICommands {
|
||||
} else {
|
||||
gen.addSchems(load(imageMask), mask, multi.getHolders(), rarity, distance, rotate);
|
||||
}
|
||||
TextComponent.of("Added schematics!").send(fp);
|
||||
fp.toWorldEditPlayer().print(TextComponent.of("Added schematics!"));
|
||||
populate(fp);
|
||||
}
|
||||
|
||||
@ -527,7 +539,7 @@ public class CFICommands {
|
||||
} else {
|
||||
gen.setBiome(biome);
|
||||
}
|
||||
TextComponent.of("Set biome!").send(fp);
|
||||
fp.toWorldEditPlayer().print(TextComponent.of("Set biome!"));
|
||||
assertSettings(fp).resetComponent();
|
||||
component(fp);
|
||||
}
|
||||
@ -539,7 +551,7 @@ public class CFICommands {
|
||||
@CommandPermissions("worldedit.anvil.cfi")
|
||||
public void caves(FawePlayer fp) throws WorldEditException {
|
||||
assertSettings(fp).getGenerator().addCaves();
|
||||
TextComponent.of("Added caves!").send(fp);
|
||||
fp.toWorldEditPlayer().print(TextComponent.of("Added caves!"));
|
||||
populate(fp);
|
||||
}
|
||||
|
||||
@ -580,7 +592,6 @@ public class CFICommands {
|
||||
gen.setHeights(Integer.parseInt(arg));
|
||||
}
|
||||
fp.toWorldEditPlayer().print("Set Height!");
|
||||
TextComponent.of("Set height!").send(fp);
|
||||
component(fp);
|
||||
}
|
||||
|
||||
@ -592,7 +603,8 @@ public class CFICommands {
|
||||
public void waterId(FawePlayer fp, BlockStateHolder block) throws WorldEditException {
|
||||
CFISettings settings = assertSettings(fp);
|
||||
settings.getGenerator().setWaterId(block.getBlockType().getInternalId());
|
||||
TextComponent.of("Set water id!").send(fp);
|
||||
|
||||
fp.toWorldEditPlayer().print("Set water id!");
|
||||
settings.resetComponent();
|
||||
component(fp);
|
||||
}
|
||||
@ -606,7 +618,7 @@ public class CFICommands {
|
||||
public void baseId(FawePlayer fp, BlockStateHolder block) throws WorldEditException {
|
||||
CFISettings settings = assertSettings(fp);
|
||||
settings.getGenerator().setBedrockId(block.getBlockType().getInternalId());
|
||||
TextComponent.of("Set base id!").send(fp);
|
||||
fp.toWorldEditPlayer().print(TextComponent.of("Set base id!"));
|
||||
settings.resetComponent();
|
||||
component(fp);
|
||||
}
|
||||
@ -620,7 +632,7 @@ public class CFICommands {
|
||||
@CommandPermissions("worldedit.anvil.cfi")
|
||||
public void worldthickness(FawePlayer fp, int height) throws WorldEditException {
|
||||
assertSettings(fp).getGenerator().setWorldThickness(height);
|
||||
TextComponent.of("Set world thickness!").send(fp);
|
||||
fp.toWorldEditPlayer().print(TextComponent.of("Set world thickness!"));
|
||||
component(fp);
|
||||
}
|
||||
|
||||
@ -633,7 +645,7 @@ public class CFICommands {
|
||||
@CommandPermissions("worldedit.anvil.cfi")
|
||||
public void floorthickness(FawePlayer fp, int height) throws WorldEditException {
|
||||
assertSettings(fp).getGenerator().setFloorThickness(height);
|
||||
TextComponent.of("Set floor thickness!").send(fp);
|
||||
fp.toWorldEditPlayer().print(TextComponent.of("Set floor thickness!"));
|
||||
component(fp);
|
||||
}
|
||||
|
||||
@ -645,7 +657,7 @@ public class CFICommands {
|
||||
@CommandPermissions("worldedit.anvil.cfi")
|
||||
public void update(FawePlayer fp) throws WorldEditException {
|
||||
assertSettings(fp).getGenerator().update();
|
||||
TextComponent.of("Chunks refreshed!").send(fp);
|
||||
fp.toWorldEditPlayer().print(TextComponent.of("Chunks refreshed!"));
|
||||
mainMenu(fp);
|
||||
}
|
||||
|
||||
@ -657,7 +669,7 @@ public class CFICommands {
|
||||
@CommandPermissions("worldedit.anvil.cfi")
|
||||
public void tp(FawePlayer fp) throws WorldEditException {
|
||||
HeightMapMCAGenerator gen = assertSettings(fp).getGenerator();
|
||||
TextComponent.of("Teleporting...").send(fp);
|
||||
fp.toWorldEditPlayer().print(TextComponent.of("Teleporting..."));
|
||||
Vector3 origin = gen.getOrigin();
|
||||
Player player = fp.getPlayer();
|
||||
player.setPosition(origin.subtract(16, 0, 16));
|
||||
@ -675,7 +687,7 @@ public class CFICommands {
|
||||
@CommandPermissions("worldedit.anvil.cfi")
|
||||
public void waterheight(FawePlayer fp, int height) throws WorldEditException {
|
||||
assertSettings(fp).getGenerator().setWaterHeight(height);
|
||||
TextComponent.of("Set water height!").send(fp);
|
||||
fp.toWorldEditPlayer().print(TextComponent.of("Set water height!"));
|
||||
component(fp);
|
||||
}
|
||||
|
||||
@ -689,7 +701,7 @@ public class CFICommands {
|
||||
public void glass(FawePlayer fp, @Arg(def = "", desc = "image url or filename") ProvideBindings.ImageUri image, @Arg(def = "", desc = "image url or filename") ProvideBindings.ImageUri imageMask, @Arg(name = "mask", desc = "Mask", def = "") Mask mask, @Switch(name = 'w', desc = "TODO") boolean disableWhiteOnly) throws WorldEditException {
|
||||
CFISettings settings = assertSettings(fp);
|
||||
settings.getGenerator().setColorWithGlass(load(image));
|
||||
TextComponent.of("Set color with glass!").send(fp);
|
||||
fp.toWorldEditPlayer().print(TextComponent.of("Set color with glass!"));
|
||||
settings.resetColoring();
|
||||
mainMenu(fp);
|
||||
}
|
||||
@ -714,7 +726,7 @@ public class CFICommands {
|
||||
gen.setColor(load(image));
|
||||
}
|
||||
settings.resetColoring();
|
||||
TextComponent.of("Set color with blocks!").send(fp);
|
||||
fp.toWorldEditPlayer().print(TextComponent.of("Set color with blocks!"));
|
||||
mainMenu(fp);
|
||||
}
|
||||
|
||||
@ -730,7 +742,7 @@ public class CFICommands {
|
||||
public void blockbiome(FawePlayer fp, @Arg(def = "", desc = "image url or filename") ProvideBindings.ImageUri image, @Arg(def = "", desc = "image url or filename") ProvideBindings.ImageUri imageMask, @Arg(name = "mask", desc = "Mask", def = "") Mask mask, @Switch(name = 'w', desc = "TODO") boolean disableWhiteOnly) throws WorldEditException {
|
||||
CFISettings settings = assertSettings(fp);
|
||||
settings.getGenerator().setBlockAndBiomeColor(load(image), mask, load(imageMask), !disableWhiteOnly);
|
||||
TextComponent.of("Set color with blocks and biomes!").send(fp);
|
||||
fp.toWorldEditPlayer().print(TextComponent.of("Set color with blocks and biomes!"));
|
||||
settings.resetColoring();
|
||||
mainMenu(fp);
|
||||
}
|
||||
@ -746,7 +758,7 @@ public class CFICommands {
|
||||
public void biomecolor(FawePlayer fp, @Arg(def = "", desc = "image url or filename") ProvideBindings.ImageUri image, @Arg(def = "", desc = "image url or filename") ProvideBindings.ImageUri imageMask, @Arg(name = "mask", desc = "Mask", def = "") Mask mask, @Switch(name = 'w', desc = "TODO") boolean disableWhiteOnly) throws WorldEditException {
|
||||
CFISettings settings = assertSettings(fp);
|
||||
settings.getGenerator().setBiomeColor(load(image));
|
||||
TextComponent.of("Set color with biomes!").send(fp);
|
||||
fp.toWorldEditPlayer().print(TextComponent.of("Set color with biomes!"));
|
||||
settings.resetColoring();
|
||||
mainMenu(fp);
|
||||
}
|
||||
@ -811,13 +823,12 @@ public class CFICommands {
|
||||
.append(newline());
|
||||
|
||||
if (settings.image != null) {
|
||||
StringBuilder colorArgs = new StringBuilder();
|
||||
colorArgs.append(" " + settings.imageArg);
|
||||
StringBuilder colorArgs = new StringBuilder(" " + settings.imageArg);
|
||||
if (settings.imageMask != null) {
|
||||
colorArgs.append(" " + settings.imageMaskArg);
|
||||
colorArgs.append(" ").append(settings.imageMaskArg);
|
||||
}
|
||||
if (settings.mask != null) {
|
||||
colorArgs.append(" " + settings.maskArg);
|
||||
colorArgs.append(" ").append(settings.maskArg);
|
||||
}
|
||||
if (!settings.whiteOnly) {
|
||||
colorArgs.append(" -w");
|
||||
@ -854,14 +865,26 @@ public class CFICommands {
|
||||
settings.maskArg = mask != null ? split[index++] : null;
|
||||
settings.whiteOnly = !disableWhiteOnly;
|
||||
|
||||
StringBuilder cmd = new StringBuilder(alias() + " mask ");
|
||||
StringBuilder cmd = new StringBuilder("/cfi mask ");
|
||||
|
||||
TextComponent.of(">> Current Settings <<").append(newline())
|
||||
.text("Image Mask ").text("[" + settings.imageMaskArg + "]").suggestTip(cmd + "http://")
|
||||
String s = "/cfi mask http://";
|
||||
String s1 = "/cfi mask <mask>";
|
||||
String s2 = alias() + " " + settings.getCategory();
|
||||
TextComponent build = TextComponent.builder(">> Current Settings <<")
|
||||
.append(newline())
|
||||
.text("WorldEdit Mask ").text("[" + settings.maskArg + "]").suggestTip(cmd + "<mask>")
|
||||
.append("Image Mask ").append(
|
||||
TextComponent.of("[" + settings.imageMaskArg + "]")
|
||||
.hoverEvent(HoverEvent.showText(TextComponent.of(s)))
|
||||
.clickEvent(ClickEvent.suggestCommand("/cfi mask http://")))
|
||||
.append(newline())
|
||||
.text("< [Back]").cmdTip(alias() + " " + settings.getCategory()).send(fp);
|
||||
.append("WorldEdit Mask ").append(TextComponent.of("[" + settings.maskArg + "]")
|
||||
.hoverEvent(HoverEvent.showText(TextComponent.of(s1)))
|
||||
.clickEvent(ClickEvent.suggestCommand(s1)))
|
||||
.append(newline())
|
||||
.append(
|
||||
TextComponent.of("< [Back]").hoverEvent(HoverEvent.showText(TextComponent.of(s2)))
|
||||
.clickEvent(ClickEvent.runCommand(s2))).build();
|
||||
fp.toWorldEditPlayer().print(build);
|
||||
}
|
||||
|
||||
@Command(
|
||||
@ -881,10 +904,17 @@ public class CFICommands {
|
||||
if (pattern != null) {
|
||||
settings.getCategory().accept(fp);
|
||||
} else {
|
||||
TextComponent.of(">> Current Settings <<").append(newline())
|
||||
.text("Pattern ").text("[Click Here]").suggestTip(cmd + " stone")
|
||||
.append(newline())
|
||||
.text("< [Back]").cmdTip(alias() + " " + settings.getCategory()).send(fp);
|
||||
String s = cmd + " stone";
|
||||
String s1 = alias() + " " + settings.getCategory();
|
||||
TextComponent build = TextComponent.builder(">> Current Settings <<").append(newline())
|
||||
.append("Pattern ").append(TextComponent.of("[Click Here]")
|
||||
.hoverEvent(HoverEvent.showText(TextComponent.of(s)))
|
||||
.clickEvent(ClickEvent.suggestCommand(s)))
|
||||
.append(newline())
|
||||
.append(TextComponent.of("< [Back]")
|
||||
.hoverEvent(HoverEvent.showText(TextComponent.of(s1)))
|
||||
.clickEvent(ClickEvent.runCommand(s1))).build();
|
||||
fp.toWorldEditPlayer().print(build);
|
||||
}
|
||||
}
|
||||
|
||||
@ -917,13 +947,12 @@ public class CFICommands {
|
||||
settings.image = image;
|
||||
settings.imageArg = image != null ? split[index++] : null;
|
||||
|
||||
StringBuilder cmd = new StringBuilder(alias() + " image ");
|
||||
if (image == null) {
|
||||
TextComponent build = TextComponent.builder("Please provide an image:")
|
||||
.append(newline())
|
||||
.append("From a URL: ").append("[Click Here]")//TODO .suggestTip(cmd + "http://")
|
||||
.append("From a URL: ").append(TextComponent.of("[Click Here]").clickEvent(ClickEvent.suggestCommand("/cfi image http://")))
|
||||
.append(newline())
|
||||
.append("From a file: ").append("[Click Here]")//TODO .suggestTip(cmd + "file://")
|
||||
.append("From a file: ").append(TextComponent.of("[Click Here]").clickEvent(ClickEvent.suggestCommand("/cfi image file://")))
|
||||
.build();
|
||||
fp.toWorldEditPlayer().print(build);
|
||||
} else {
|
||||
@ -994,50 +1023,76 @@ public class CFICommands {
|
||||
String snow = Commands.getAlias(CFICommands.class, "snow");
|
||||
|
||||
//TODO
|
||||
// Message msg = TextComponent.builder(">> Current Settings <<").append(newline())
|
||||
// .append("Mask ").append("[" + mask + "]").cmdTip(alias() + " mask")
|
||||
// .append(newline())
|
||||
// .append("Pattern ").append("[" + pattern + "]").cmdTip(alias() + " pattern")
|
||||
// .append(newline())
|
||||
// .append(newline())
|
||||
// .append(">> Components <<")
|
||||
// .append(newline())
|
||||
// .append("[Height]").suggestTip(alias() + " " + alias("height") + " 120").text(" - Terrain height for whole map")
|
||||
// .append(newline())
|
||||
// .text("[WaterHeight]").suggestTip(alias() + " " + alias("waterheight") + " 60").text(" - Sea level for whole map")
|
||||
// .append(newline())
|
||||
// .text("[FloorThickness]").suggestTip(alias() + " " + alias("floorthickness") + " 60").text(" - Floor thickness of entire map")
|
||||
// .append(newline())
|
||||
// .text("[WorldThickness]").suggestTip(alias() + " " + alias("worldthickness") + " 60").text(" - World thickness of entire map")
|
||||
// .append(newline())
|
||||
// .text("[Snow]").suggestTip(alias() + " " + alias("snow") + maskArgs).text(" - Set snow in the masked areas")
|
||||
// .append(newline());
|
||||
//
|
||||
// if (pattern != null) {
|
||||
// String disabled = "You must specify a pattern";
|
||||
// msg
|
||||
// .text("[&cWaterId]").tooltip(disabled).append(newline())
|
||||
// .text("[&cBedrockId]").tooltip(disabled).append(newline())
|
||||
// .text("[&cFloor]").tooltip(disabled).append(newline())
|
||||
// .text("[&cMain]").tooltip(disabled).append(newline())
|
||||
// .text("[&cColumn]").tooltip(disabled).append(newline())
|
||||
// .text("[&cOverlay]").tooltip(disabled).append(newline());
|
||||
// } else {
|
||||
// StringBuilder compArgs = new StringBuilder();
|
||||
// compArgs.append(" " + settings.patternArg + maskArgs);
|
||||
//
|
||||
// msg
|
||||
// .text("[WaterId]").cmdTip(alias() + " waterId " + pattern).text(" - Water id for whole map").append(newline())
|
||||
// .text("[BedrockId]").cmdTip(alias() + " baseId " + pattern).text(" - Bedrock id for whole map").append(newline())
|
||||
// .text("[Floor]").cmdTip(alias() + " floor" + compArgs).text(" - Set the floor in the masked areas").append(newline())
|
||||
// .text("[Main]").cmdTip(alias() + " main" + compArgs).text(" - Set the main block in the masked areas").append(newline())
|
||||
// .text("[Column]").cmdTip(alias() + " column" + compArgs).text(" - Set the columns in the masked areas").append(newline())
|
||||
// .text("[Overlay]").cmdTip(alias() + " overlay" + compArgs).text(" - Set the overlay in the masked areas").append(newline());
|
||||
// }
|
||||
//
|
||||
// msg.append(newline())
|
||||
// .text("< [Back]").cmdTip(alias())
|
||||
// .send(fp);
|
||||
@NonNull Builder msg = TextComponent.builder(">> Current Settings <<").append(newline())
|
||||
.append("Mask ").append(TextComponent.of("[" + mask + "]")
|
||||
.hoverEvent(HoverEvent.showText(TextComponent.of(alias() + " mask")))
|
||||
.clickEvent(ClickEvent.runCommand(alias() + " mask")))
|
||||
.append(newline())
|
||||
.append("Pattern ").append(TextComponent.of("[" + pattern + "]")
|
||||
.hoverEvent(HoverEvent.showText(TextComponent.of(alias() + " pattern")))
|
||||
.clickEvent(ClickEvent.runCommand(alias() + " pattern")))
|
||||
.append(newline())
|
||||
.append(newline())
|
||||
.append(">> Components <<")
|
||||
.append(newline())
|
||||
.append(TextComponent.of("[Height]")
|
||||
.hoverEvent(HoverEvent.showText(TextComponent.of(alias() + " " + alias("height") + " 120")))
|
||||
.clickEvent(ClickEvent.suggestCommand(alias() + " " + alias("height") + " 120"))).append(" - Terrain height for whole map")
|
||||
.append(newline())
|
||||
.append(TextComponent.of("[WaterHeight]")
|
||||
.hoverEvent(HoverEvent.showText(TextComponent.of(alias() + " " + alias("waterheight") + " 60")))
|
||||
.clickEvent(ClickEvent.suggestCommand(alias() + " " + alias("waterheight") + " 60"))).append(" - Sea level for whole map")
|
||||
.append(newline())
|
||||
.append(TextComponent.of("[FloorThickness]").hoverEvent(HoverEvent.showText(TextComponent.of(alias() + " " + alias("floorthickness") + " 60")))
|
||||
.clickEvent(ClickEvent.suggestCommand(alias() + " " + alias("floorthickness") + " 60"))).append(" - Floor thickness of entire map")
|
||||
.append(newline())
|
||||
.append(TextComponent.of("[WorldThickness]").hoverEvent(HoverEvent.showText(TextComponent.of(alias() + " " + alias("worldthickness") + " 60")))
|
||||
.clickEvent(ClickEvent.suggestCommand(alias() + " " + alias("worldthickness") + " 60"))).append(" - World thickness of entire map")
|
||||
.append(newline())
|
||||
.append(TextComponent.of("[Snow]").hoverEvent(HoverEvent.showText(TextComponent.of(alias() + " " + alias("snow") + maskArgs)))
|
||||
.clickEvent(ClickEvent.suggestCommand(alias() + " " + alias("snow") + maskArgs))).append(" - Set snow in the masked areas")
|
||||
.append(newline());
|
||||
|
||||
if (pattern != null) {
|
||||
String disabled = "You must specify a pattern";
|
||||
msg.append(TextComponent.of("[&cWaterId]").hoverEvent(HoverEvent.showText(TextComponent.of(disabled)))).append(newline())
|
||||
.append(TextComponent.of("[&cBedrockId]").hoverEvent(HoverEvent.showText(TextComponent.of(disabled)))).append(newline()).append(newline())
|
||||
.append(TextComponent.of("[&cFloor]").hoverEvent(HoverEvent.showText(TextComponent.of(disabled)))).append(newline()).append(newline())
|
||||
.append(TextComponent.of("[&cMain]").hoverEvent(HoverEvent.showText(TextComponent.of(disabled)))).append(newline()).append(newline())
|
||||
.append(TextComponent.of("[&cColumn]").hoverEvent(HoverEvent.showText(TextComponent.of(disabled)))).append(newline()).append(newline())
|
||||
.append(TextComponent.of("[&cOverlay]").hoverEvent(HoverEvent.showText(TextComponent.of(disabled)))).append(newline()).append(newline());
|
||||
} else {
|
||||
StringBuilder compArgs = new StringBuilder();
|
||||
compArgs.append(" " + settings.patternArg + maskArgs);
|
||||
|
||||
msg
|
||||
.append(TextComponent.of("[WaterId]")
|
||||
.hoverEvent(HoverEvent.showText(TextComponent.of(alias() + " waterId " + pattern)))
|
||||
.clickEvent(ClickEvent.runCommand(alias() + " waterId " + pattern)))
|
||||
.append(" - Water id for whole map")
|
||||
.append(newline())
|
||||
.append(TextComponent.of("[BedrockId]")
|
||||
.hoverEvent(HoverEvent.showText(TextComponent.of(alias() + " baseId " + pattern)))
|
||||
.clickEvent(ClickEvent.runCommand(alias() + " baseId " + pattern)))
|
||||
.append(TextComponent.of(" - Bedrock id for whole map"))
|
||||
.append(newline())
|
||||
.append(TextComponent.of("[Floor]")
|
||||
.hoverEvent(HoverEvent.showText(TextComponent.of(alias() + " floor " + compArgs)))
|
||||
.clickEvent(ClickEvent.runCommand(alias() + " floor " + compArgs)))
|
||||
.append(TextComponent.of(" - Set the floor in the masked areas")).append(newline())
|
||||
.append(TextComponent.of("[Main]")
|
||||
.hoverEvent(HoverEvent.showText(TextComponent.of(alias() + " main " + compArgs)))
|
||||
.clickEvent(ClickEvent.runCommand(alias() + " main " + compArgs)))
|
||||
.append(TextComponent.of(" - Set the main block in the masked areas")).append(newline())
|
||||
.append(TextComponent.of("[Column]").hoverEvent(HoverEvent.showText(TextComponent.of(alias() + " column" + compArgs)))
|
||||
.clickEvent(ClickEvent.runCommand(alias() + " column" + compArgs))).append(" - Set the columns in the masked areas").append(newline())
|
||||
.append(TextComponent.of("[Overlay]").hoverEvent(HoverEvent.showText(TextComponent.of(alias() + " overlay" + compArgs)))
|
||||
.clickEvent(ClickEvent.runCommand(alias() + " overlay" + compArgs))).append(" - Set the overlay in the masked areas").append(newline());
|
||||
}
|
||||
|
||||
msg.append(newline())
|
||||
.append(TextComponent.of("< [Back]").hoverEvent(HoverEvent.showText(TextComponent.of(alias()))).clickEvent(ClickEvent.runCommand(alias())));
|
||||
fp.toWorldEditPlayer().print(msg.build());
|
||||
}
|
||||
|
||||
private static CFISettings assertSettings(FawePlayer fp) {
|
||||
|
@ -10,7 +10,6 @@ import com.boydti.fawe.object.task.AsyncNotifyQueue;
|
||||
import com.boydti.fawe.util.MainUtil;
|
||||
import com.boydti.fawe.util.TaskManager;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.math.Vector3;
|
||||
import com.sk89q.worldedit.world.World;
|
||||
import java.io.File;
|
||||
import java.io.IOException;
|
||||
@ -50,7 +49,7 @@ public class RollbackDatabase extends AsyncNotifyQueue {
|
||||
this(FaweAPI.getWorld(world));
|
||||
}
|
||||
|
||||
public RollbackDatabase(final World world) throws SQLException, ClassNotFoundException {
|
||||
public RollbackDatabase(World world) throws SQLException, ClassNotFoundException {
|
||||
this.prefix = "";
|
||||
this.worldName = world.getName();
|
||||
this.world = world;
|
||||
@ -96,7 +95,7 @@ public class RollbackDatabase extends AsyncNotifyQueue {
|
||||
}
|
||||
}
|
||||
|
||||
public void delete(final UUID uuid, final int id) {
|
||||
public void delete(UUID uuid, int id) {
|
||||
addTask(new Runnable() {
|
||||
@Override
|
||||
public void run() {
|
||||
@ -127,12 +126,13 @@ public class RollbackDatabase extends AsyncNotifyQueue {
|
||||
});
|
||||
}
|
||||
|
||||
public void getPotentialEdits(final UUID uuid, final long minTime, final BlockVector3 pos1, final BlockVector3 pos2, final RunnableVal<DiskStorageHistory> onEach, final Runnable whenDone, final boolean delete, final boolean ascending) {
|
||||
public void getPotentialEdits(UUID uuid, long minTime, BlockVector3 pos1, BlockVector3 pos2, RunnableVal<DiskStorageHistory> onEach, Runnable whenDone, boolean delete, boolean ascending) {
|
||||
final World world = FaweAPI.getWorld(this.worldName);
|
||||
addTask(new Runnable() {
|
||||
@Override
|
||||
public void run() {
|
||||
String stmtStr = ascending ? (uuid == null ? GET_EDITS_ASC : GET_EDITS_USER_ASC) : (uuid == null ? GET_EDITS : GET_EDITS_USER);
|
||||
String stmtStr = ascending ? uuid == null ? GET_EDITS_ASC : GET_EDITS_USER_ASC :
|
||||
uuid == null ? GET_EDITS : GET_EDITS_USER;
|
||||
try (PreparedStatement stmt = connection.prepareStatement(stmtStr)) {
|
||||
stmt.setInt(1, pos1.getBlockX());
|
||||
stmt.setInt(2, pos2.getBlockX());
|
||||
@ -243,7 +243,7 @@ public class RollbackDatabase extends AsyncNotifyQueue {
|
||||
}
|
||||
commit();
|
||||
return true;
|
||||
} catch (final Exception e) {
|
||||
} catch (Exception e) {
|
||||
e.printStackTrace();
|
||||
}
|
||||
return false;
|
||||
@ -258,7 +258,7 @@ public class RollbackDatabase extends AsyncNotifyQueue {
|
||||
connection.commit();
|
||||
connection.setAutoCommit(true);
|
||||
}
|
||||
} catch (final SQLException e) {
|
||||
} catch (SQLException e) {
|
||||
e.printStackTrace();
|
||||
}
|
||||
}
|
||||
@ -270,11 +270,11 @@ public class RollbackDatabase extends AsyncNotifyQueue {
|
||||
if (!Fawe.imp().getDirectory().exists()) {
|
||||
Fawe.imp().getDirectory().mkdirs();
|
||||
}
|
||||
if (!(dbLocation.exists())) {
|
||||
if (!dbLocation.exists()) {
|
||||
try {
|
||||
dbLocation.getParentFile().mkdirs();
|
||||
dbLocation.createNewFile();
|
||||
} catch (final IOException e) {
|
||||
} catch (IOException e) {
|
||||
e.printStackTrace();
|
||||
Fawe.debug("&cUnable to create database!");
|
||||
}
|
||||
@ -299,9 +299,7 @@ public class RollbackDatabase extends AsyncNotifyQueue {
|
||||
if (connection == null) {
|
||||
try {
|
||||
forceConnection();
|
||||
} catch (final ClassNotFoundException e) {
|
||||
e.printStackTrace();
|
||||
} catch (final SQLException e) {
|
||||
} catch (ClassNotFoundException | SQLException e) {
|
||||
e.printStackTrace();
|
||||
}
|
||||
}
|
||||
@ -312,7 +310,7 @@ public class RollbackDatabase extends AsyncNotifyQueue {
|
||||
* Closes the connection with the database
|
||||
*
|
||||
* @return true if successful
|
||||
* @throws java.sql.SQLException if the connection cannot be closed
|
||||
* @throws SQLException if the connection cannot be closed
|
||||
*/
|
||||
public boolean closeConnection() throws SQLException {
|
||||
if (connection == null) {
|
||||
@ -332,12 +330,12 @@ public class RollbackDatabase extends AsyncNotifyQueue {
|
||||
* Checks if a connection is open with the database
|
||||
*
|
||||
* @return true if the connection is open
|
||||
* @throws java.sql.SQLException if the connection cannot be checked
|
||||
* @throws SQLException if the connection cannot be checked
|
||||
*/
|
||||
public boolean checkConnection() {
|
||||
try {
|
||||
return (connection != null) && !connection.isClosed();
|
||||
} catch (final SQLException e) {
|
||||
return connection != null && !connection.isClosed();
|
||||
} catch (SQLException e) {
|
||||
return false;
|
||||
}
|
||||
}
|
||||
|
@ -108,7 +108,7 @@ public abstract class FawePlayer<T> extends Metadatable {
|
||||
}
|
||||
|
||||
@Deprecated
|
||||
public FawePlayer(final T parent) {
|
||||
public FawePlayer(T parent) {
|
||||
this.parent = parent;
|
||||
Fawe.get().register(this);
|
||||
if (Settings.IMP.CLIPBOARD.USE_DISK) {
|
||||
@ -247,7 +247,7 @@ public abstract class FawePlayer<T> extends Metadatable {
|
||||
* Queue an action to run async
|
||||
* @param run
|
||||
*/
|
||||
public void queueAction(final Runnable run) {
|
||||
public void queueAction(Runnable run) {
|
||||
runAction(run, false, true);
|
||||
}
|
||||
|
||||
@ -288,7 +288,7 @@ public abstract class FawePlayer<T> extends Metadatable {
|
||||
* @param async
|
||||
* @return false if the task was ran or queued
|
||||
*/
|
||||
public boolean runAction(final Runnable ifFree, boolean checkFree, boolean async) {
|
||||
public boolean runAction(Runnable ifFree, boolean checkFree, boolean async) {
|
||||
if (checkFree) {
|
||||
if (runningCount.get() != 0) return false;
|
||||
}
|
||||
@ -363,7 +363,7 @@ public abstract class FawePlayer<T> extends Metadatable {
|
||||
*
|
||||
* @param world
|
||||
*/
|
||||
public void loadSessionsFromDisk(final World world) {
|
||||
public void loadSessionsFromDisk(World world) {
|
||||
if (world == null) {
|
||||
return;
|
||||
}
|
||||
@ -417,14 +417,14 @@ public abstract class FawePlayer<T> extends Metadatable {
|
||||
* @param perm
|
||||
* @return
|
||||
*/
|
||||
public abstract boolean hasPermission(final String perm);
|
||||
public abstract boolean hasPermission(String perm);
|
||||
|
||||
/**
|
||||
* Send a message to the player
|
||||
*
|
||||
* @param message
|
||||
*/
|
||||
public abstract void sendMessage(final String message);
|
||||
public abstract void sendMessage(String message);
|
||||
|
||||
/**
|
||||
* Print a WorldEdit error.
|
||||
@ -438,7 +438,7 @@ public abstract class FawePlayer<T> extends Metadatable {
|
||||
*
|
||||
* @param substring
|
||||
*/
|
||||
public abstract void executeCommand(final String substring);
|
||||
public abstract void executeCommand(String substring);
|
||||
|
||||
/**
|
||||
* Get the player's location
|
||||
@ -473,7 +473,7 @@ public abstract class FawePlayer<T> extends Metadatable {
|
||||
public Region getSelection() {
|
||||
try {
|
||||
return this.getSession().getSelection(this.getPlayer().getWorld());
|
||||
} catch (final IncompleteRegionException e) {
|
||||
} catch (IncompleteRegionException e) {
|
||||
return null;
|
||||
}
|
||||
}
|
||||
@ -509,7 +509,7 @@ public abstract class FawePlayer<T> extends Metadatable {
|
||||
* @param region
|
||||
*/
|
||||
@Deprecated
|
||||
public void setSelection(final RegionWrapper region) {
|
||||
public void setSelection(RegionWrapper region) {
|
||||
final Player player = this.getPlayer();
|
||||
BlockVector3 top = region.getMaximumPoint();
|
||||
top.withY(getWorld().getMaxY());
|
||||
@ -539,7 +539,7 @@ public abstract class FawePlayer<T> extends Metadatable {
|
||||
*
|
||||
* @param selector
|
||||
*/
|
||||
public void setSelection(final RegionSelector selector) {
|
||||
public void setSelection(RegionSelector selector) {
|
||||
this.getSession().setRegionSelector(toWorldEditPlayer().getWorld(), selector);
|
||||
}
|
||||
|
||||
@ -551,7 +551,7 @@ public abstract class FawePlayer<T> extends Metadatable {
|
||||
public Region getLargestRegion() {
|
||||
int area = 0;
|
||||
Region max = null;
|
||||
for (final Region region : this.getCurrentRegions()) {
|
||||
for (Region region : this.getCurrentRegions()) {
|
||||
final int tmp = region.getArea();
|
||||
if (tmp > area) {
|
||||
area = tmp;
|
||||
|
@ -5,7 +5,6 @@ import com.boydti.fawe.object.mask.SurfaceMask;
|
||||
import com.boydti.fawe.object.pattern.BiomePattern;
|
||||
import com.sk89q.worldedit.EditSession;
|
||||
import com.sk89q.worldedit.MaxChangedBlocksException;
|
||||
import com.sk89q.worldedit.function.mask.Mask;
|
||||
import com.sk89q.worldedit.function.mask.SolidBlockMask;
|
||||
import com.sk89q.worldedit.function.operation.Operations;
|
||||
import com.sk89q.worldedit.function.pattern.Pattern;
|
||||
@ -52,7 +51,6 @@ public class SplatterBrush extends ScatterBrush {
|
||||
}
|
||||
return false;
|
||||
}, vector -> editSession.setBlock(vector, finalPattern), recursion);
|
||||
visitor.setMaxBranch(2);
|
||||
visitor.setDirections(Arrays.asList(BreadthFirstSearch.DIAGONAL_DIRECTIONS));
|
||||
visitor.visit(position);
|
||||
Operations.completeBlindly(visitor);
|
||||
|
@ -10,7 +10,6 @@ import com.sk89q.worldedit.LocalSession;
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.command.tool.brush.Brush;
|
||||
import com.sk89q.worldedit.entity.Player;
|
||||
import com.sk89q.worldedit.function.RegionFunction;
|
||||
import com.sk89q.worldedit.function.mask.Mask;
|
||||
import com.sk89q.worldedit.function.mask.MaskIntersection;
|
||||
import com.sk89q.worldedit.function.operation.Operations;
|
||||
@ -21,7 +20,6 @@ import com.sk89q.worldedit.math.Vector3;
|
||||
import com.sk89q.worldedit.math.interpolation.Node;
|
||||
import java.util.ArrayList;
|
||||
import java.util.Collection;
|
||||
import java.util.Collections;
|
||||
import java.util.List;
|
||||
|
||||
public class SplineBrush implements Brush, ResettableTool {
|
||||
@ -50,7 +48,7 @@ public class SplineBrush implements Brush, ResettableTool {
|
||||
}
|
||||
|
||||
@Override
|
||||
public void build(EditSession editSession, final BlockVector3 position, Pattern pattern, double size) throws WorldEditException {
|
||||
public void build(EditSession editSession, BlockVector3 position, Pattern pattern, double size) throws WorldEditException {
|
||||
Mask mask = editSession.getMask();
|
||||
if (mask == null) {
|
||||
mask = new IdMask(editSession);
|
||||
@ -70,12 +68,9 @@ public class SplineBrush implements Brush, ResettableTool {
|
||||
}
|
||||
final ArrayList<BlockVector3> points = new ArrayList<>();
|
||||
if (size > 0) {
|
||||
DFSRecursiveVisitor visitor = new DFSRecursiveVisitor(mask, new RegionFunction() {
|
||||
@Override
|
||||
public boolean apply(BlockVector3 p) {
|
||||
points.add(p);
|
||||
return true;
|
||||
}
|
||||
DFSRecursiveVisitor visitor = new DFSRecursiveVisitor(mask, p -> {
|
||||
points.add(p);
|
||||
return true;
|
||||
}, (int) size, 1);
|
||||
List<BlockVector3> directions = visitor.getDirections();
|
||||
for (int x = -1; x <= 1; x++) {
|
||||
@ -90,7 +85,7 @@ public class SplineBrush implements Brush, ResettableTool {
|
||||
}
|
||||
}
|
||||
}
|
||||
Collections.sort(directions, (o1, o2) -> (int) Math.signum(o1.lengthSq() - o2.lengthSq()));
|
||||
directions.sort((o1, o2) -> (int) Math.signum(o1.lengthSq() - o2.lengthSq()));
|
||||
visitor.visit(position);
|
||||
Operations.completeBlindly(visitor);
|
||||
if (points.size() > numSplines) {
|
||||
@ -121,7 +116,7 @@ public class SplineBrush implements Brush, ResettableTool {
|
||||
|
||||
final List<Node> nodes = new ArrayList<>(centroids.size());
|
||||
|
||||
for (final Vector3 nodevector : centroids) {
|
||||
for (Vector3 nodevector : centroids) {
|
||||
final Node n = new Node(nodevector);
|
||||
n.setTension(tension);
|
||||
n.setBias(bias);
|
||||
@ -133,7 +128,7 @@ public class SplineBrush implements Brush, ResettableTool {
|
||||
List<BlockVector3> currentSpline = new ArrayList<>();
|
||||
for (ArrayList<BlockVector3> points : positionSets) {
|
||||
int listSize = points.size();
|
||||
int index = (int) (i * listSize / (double) (numSplines));
|
||||
int index = (int) (i * listSize / (double) numSplines);
|
||||
currentSpline.add(points.get(index));
|
||||
}
|
||||
editSession.drawSpline(pattern, currentSpline, 0, 0, 0, 10, 0, true);
|
||||
@ -161,12 +156,10 @@ public class SplineBrush implements Brush, ResettableTool {
|
||||
private BlockVector3 normal(Collection<BlockVector3> points, BlockVector3 centroid) {
|
||||
int n = points.size();
|
||||
switch (n) {
|
||||
case 1: {
|
||||
case 1:
|
||||
return null;
|
||||
}
|
||||
case 2: {
|
||||
case 2:
|
||||
return null;
|
||||
}
|
||||
}
|
||||
|
||||
// Calc full 3x3 covariance matrix, excluding symmetries:
|
||||
@ -179,9 +172,9 @@ public class SplineBrush implements Brush, ResettableTool {
|
||||
|
||||
MutableVector3 r = new MutableVector3();
|
||||
for (BlockVector3 p : points) {
|
||||
r.mutX((p.getX() - centroid.getX()));
|
||||
r.mutY((p.getY() - centroid.getY()));
|
||||
r.mutZ((p.getZ() - centroid.getZ()));
|
||||
r.mutX(p.getX() - centroid.getX());
|
||||
r.mutY(p.getY() - centroid.getY());
|
||||
r.mutZ(p.getZ() - centroid.getZ());
|
||||
xx += r.getX() * r.getX();
|
||||
xy += r.getX() * r.getY();
|
||||
xz += r.getX() * r.getZ();
|
||||
@ -214,7 +207,6 @@ public class SplineBrush implements Brush, ResettableTool {
|
||||
double b = (xz * xy - yz * xx) / det_z;
|
||||
dir = BlockVector3.at(a, b, 1.0);
|
||||
}
|
||||
;
|
||||
return dir.normalize();
|
||||
}
|
||||
}
|
||||
|
@ -4,7 +4,6 @@ import com.sk89q.worldedit.EditSession;
|
||||
import com.sk89q.worldedit.MaxChangedBlocksException;
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.blocks.BaseItemStack;
|
||||
import com.sk89q.worldedit.function.operation.Operation;
|
||||
import com.sk89q.worldedit.math.BlockVector2;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.math.Vector3;
|
||||
@ -14,8 +13,6 @@ import com.sk89q.worldedit.world.biome.BiomeType;
|
||||
import com.sk89q.worldedit.world.biome.BiomeTypes;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
import com.sk89q.worldedit.world.weather.WeatherType;
|
||||
import com.sk89q.worldedit.world.weather.WeatherTypes;
|
||||
|
||||
import javax.annotation.Nullable;
|
||||
|
||||
public abstract class ImmutableVirtualWorld implements VirtualWorld {
|
||||
@ -34,12 +31,6 @@ public abstract class ImmutableVirtualWorld implements VirtualWorld {
|
||||
return BiomeTypes.FOREST;
|
||||
}
|
||||
|
||||
@Nullable
|
||||
@Override
|
||||
public Operation commit() {
|
||||
return null;
|
||||
}
|
||||
|
||||
@Override
|
||||
public String getName() {
|
||||
return Integer.toString(hashCode());
|
||||
@ -90,16 +81,6 @@ public abstract class ImmutableVirtualWorld implements VirtualWorld {
|
||||
unsupported();
|
||||
}
|
||||
|
||||
@Override
|
||||
public WeatherType getWeather() {
|
||||
return WeatherTypes.CLEAR;
|
||||
}
|
||||
|
||||
@Override
|
||||
public long getRemainingWeatherDuration() {
|
||||
return 0;
|
||||
}
|
||||
|
||||
@Override
|
||||
public void setWeather(WeatherType weatherType) {
|
||||
unsupported();
|
||||
|
@ -17,11 +17,6 @@ import java.io.IOException;
|
||||
public interface VirtualWorld extends SimpleWorld, Closeable {
|
||||
Vector3 getOrigin();
|
||||
|
||||
@Override
|
||||
default BaseBlock getFullBlock(BlockVector3 position) {
|
||||
return getBlock(position).toBaseBlock();
|
||||
}
|
||||
|
||||
@Override
|
||||
default BaseBlock getFullBlock(int x, int y, int z) {
|
||||
return getBlock(x, y, z).toBaseBlock();
|
||||
|
@ -6,7 +6,6 @@ import com.sk89q.worldedit.LocalSession;
|
||||
import com.sk89q.worldedit.WorldEdit;
|
||||
import com.sk89q.worldedit.command.tool.BrushTool;
|
||||
import com.sk89q.worldedit.command.tool.Tool;
|
||||
import com.sk89q.worldedit.command.tool.brush.Brush;
|
||||
import com.sk89q.worldedit.entity.Player;
|
||||
|
||||
public class VisualQueue extends SingleThreadIntervalQueue<FawePlayer> {
|
||||
@ -17,7 +16,8 @@ public class VisualQueue extends SingleThreadIntervalQueue<FawePlayer> {
|
||||
|
||||
@Override
|
||||
public void operate(FawePlayer fp) {
|
||||
LocalSession session = fp.getSession();
|
||||
LocalSession session = WorldEdit.getInstance().getSessionManager()
|
||||
.get(fp.toWorldEditPlayer());
|
||||
Player player = fp.getPlayer();
|
||||
Tool tool = session.getTool(player);
|
||||
if (tool instanceof BrushTool) {
|
||||
|
@ -1942,11 +1942,6 @@ public class HeightMapMCAGenerator extends MCAWriter implements StreamChange, Dr
|
||||
return false;
|
||||
}
|
||||
|
||||
@Override
|
||||
public boolean generateTree(TreeGenerator.TreeType type, EditSession editSession, BlockVector3 position) throws MaxChangedBlocksException {
|
||||
return false;
|
||||
}
|
||||
|
||||
@Override
|
||||
public void dropItem(Vector3 position, BaseItemStack item) {
|
||||
// TODO Auto-generated method stub
|
||||
@ -1970,4 +1965,4 @@ public class HeightMapMCAGenerator extends MCAWriter implements StreamChange, Dr
|
||||
// TODO Auto-generated method stub
|
||||
return null;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
@ -33,11 +33,6 @@ public class AbstractDelegateChangeSet extends FaweChangeSet {
|
||||
super.addChangeTask(queue);
|
||||
}
|
||||
|
||||
@Override
|
||||
public boolean closeAsync() {
|
||||
return super.closeAsync();
|
||||
}
|
||||
|
||||
@Override
|
||||
public boolean flush() {
|
||||
return parent.flush();
|
||||
|
@ -1,7 +1,6 @@
|
||||
package com.boydti.fawe.object.clipboard;
|
||||
|
||||
import com.boydti.fawe.jnbt.NBTStreamer;
|
||||
|
||||
import com.sk89q.jnbt.CompoundTag;
|
||||
import com.sk89q.worldedit.entity.BaseEntity;
|
||||
import com.sk89q.worldedit.entity.Entity;
|
||||
@ -10,7 +9,6 @@ import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.world.biome.BiomeType;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
|
||||
import java.util.List;
|
||||
|
||||
public class AbstractDelegateFaweClipboard extends FaweClipboard {
|
||||
|
@ -3,7 +3,6 @@ package com.boydti.fawe.object.clipboard;
|
||||
import com.boydti.fawe.jnbt.NBTStreamer;
|
||||
import com.boydti.fawe.object.IntegerTrio;
|
||||
import com.boydti.fawe.util.ReflectionUtils;
|
||||
|
||||
import com.sk89q.jnbt.CompoundTag;
|
||||
import com.sk89q.jnbt.IntTag;
|
||||
import com.sk89q.jnbt.Tag;
|
||||
@ -16,7 +15,6 @@ import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
import com.sk89q.worldedit.world.block.BlockType;
|
||||
import com.sk89q.worldedit.world.block.BlockTypes;
|
||||
|
||||
import java.util.ArrayList;
|
||||
import java.util.HashMap;
|
||||
import java.util.HashSet;
|
||||
@ -127,13 +125,14 @@ public class CPUOptimizedClipboard extends FaweClipboard {
|
||||
return BlockVector3.at(width, height, length);
|
||||
}
|
||||
|
||||
private int ylast;
|
||||
private int ylasti;
|
||||
private int zlast;
|
||||
private int zlasti;
|
||||
private int yLast;
|
||||
private int yLastI;
|
||||
private int zLast;
|
||||
private int zLastI;
|
||||
|
||||
public int getIndex(int x, int y, int z) {
|
||||
return x + ((ylast == y) ? ylasti : (ylasti = (ylast = y) * area)) + ((zlast == z) ? zlasti : (zlasti = (zlast = z) * width));
|
||||
return x + ((yLast == y) ? yLastI : (yLastI = (yLast = y) * area)) + ((zLast == z) ? zLastI
|
||||
: (zLastI = (zLast = z) * width));
|
||||
}
|
||||
|
||||
@Override
|
||||
|
@ -9,9 +9,6 @@ import com.boydti.fawe.util.ReflectionUtils;
|
||||
import com.sk89q.jnbt.CompoundTag;
|
||||
import com.sk89q.jnbt.IntTag;
|
||||
import com.sk89q.jnbt.Tag;
|
||||
import com.sk89q.worldedit.world.biome.BiomeTypes;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockState;
|
||||
import com.sk89q.worldedit.entity.BaseEntity;
|
||||
import com.sk89q.worldedit.entity.Entity;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
@ -19,10 +16,12 @@ import com.sk89q.worldedit.extent.clipboard.BlockArrayClipboard;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.regions.CuboidRegion;
|
||||
import com.sk89q.worldedit.world.biome.BiomeType;
|
||||
import com.sk89q.worldedit.world.biome.BiomeTypes;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockState;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
import com.sk89q.worldedit.world.block.BlockType;
|
||||
import com.sk89q.worldedit.world.block.BlockTypes;
|
||||
|
||||
import java.io.Closeable;
|
||||
import java.io.File;
|
||||
import java.io.IOException;
|
||||
@ -82,7 +81,7 @@ public class DiskOptimizedClipboard extends FaweClipboard implements Closeable {
|
||||
area = width * length;
|
||||
this.volume = length * width * height;
|
||||
|
||||
if ((braf.length() - HEADER_SIZE) == (volume << 2) + area) {
|
||||
if (braf.length() - HEADER_SIZE == (volume << 2) + area) {
|
||||
hasBiomes = true;
|
||||
}
|
||||
autoCloseTask();
|
||||
@ -357,7 +356,7 @@ public class DiskOptimizedClipboard extends FaweClipboard implements Closeable {
|
||||
}
|
||||
|
||||
@Override
|
||||
public void forEach(final BlockReader task, boolean air) {
|
||||
public void forEach(BlockReader task, boolean air) {
|
||||
byteBuffer.force();
|
||||
int pos = HEADER_SIZE;
|
||||
IntegerTrio trio = new IntegerTrio();
|
||||
@ -418,7 +417,8 @@ public class DiskOptimizedClipboard extends FaweClipboard implements Closeable {
|
||||
}
|
||||
|
||||
public int getIndex(int x, int y, int z) {
|
||||
return x + ((ylast == y) ? ylasti : (ylasti = (ylast = y) * area)) + ((zlast == z) ? zlasti : (zlasti = (zlast = z) * width));
|
||||
return x + (ylast == y ? ylasti : (ylasti = (ylast = y) * area)) + (zlast == z
|
||||
? zlasti : (zlasti = (zlast = z) * width));
|
||||
}
|
||||
|
||||
@Override
|
||||
@ -445,7 +445,7 @@ public class DiskOptimizedClipboard extends FaweClipboard implements Closeable {
|
||||
@Override
|
||||
public BaseBlock getBlock(int i) {
|
||||
try {
|
||||
int diskIndex = (HEADER_SIZE) + (i << 2);
|
||||
int diskIndex = HEADER_SIZE + (i << 2);
|
||||
int combinedId = byteBuffer.getInt(diskIndex);
|
||||
BlockType type = BlockTypes.getFromStateId(combinedId);
|
||||
BaseBlock base = type.withStateId(combinedId).toBaseBlock();
|
||||
@ -464,7 +464,7 @@ public class DiskOptimizedClipboard extends FaweClipboard implements Closeable {
|
||||
} else {
|
||||
// x + z * width + y * area;
|
||||
int y = i / area;
|
||||
int newI = (i - (y * area));
|
||||
int newI = i - y * area;
|
||||
int z = newI / width;
|
||||
int x = newI - z * width;
|
||||
nbt = nbtMap.get(new IntegerTrio(x, y, z));
|
||||
@ -494,7 +494,7 @@ public class DiskOptimizedClipboard extends FaweClipboard implements Closeable {
|
||||
@Override
|
||||
public <B extends BlockStateHolder<B>> boolean setBlock(int x, int y, int z, B block) {
|
||||
try {
|
||||
int index = (HEADER_SIZE) + ((getIndex(x, y, z) << 2));
|
||||
int index = HEADER_SIZE + (getIndex(x, y, z) << 2);
|
||||
int combined = block.getInternalId();
|
||||
byteBuffer.putInt(index, combined);
|
||||
boolean hasNbt = block instanceof BaseBlock && block.hasNbtData();
|
||||
@ -512,12 +512,12 @@ public class DiskOptimizedClipboard extends FaweClipboard implements Closeable {
|
||||
public <B extends BlockStateHolder<B>> boolean setBlock(int i, B block) {
|
||||
try {
|
||||
int combined = block.getInternalId();
|
||||
int index = (HEADER_SIZE) + (i << 2);
|
||||
int index = HEADER_SIZE + (i << 2);
|
||||
byteBuffer.putInt(index, combined);
|
||||
boolean hasNbt = block instanceof BaseBlock && block.hasNbtData();
|
||||
if (hasNbt) {
|
||||
int y = i / area;
|
||||
int newI = (i - (y * area));
|
||||
int newI = i - y * area;
|
||||
int z = newI / width;
|
||||
int x = newI - z * width;
|
||||
setTile(x, y, z, block.getNbtData());
|
||||
|
@ -1,25 +1,17 @@
|
||||
package com.boydti.fawe.object.clipboard;
|
||||
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.entity.BaseEntity;
|
||||
import com.sk89q.worldedit.entity.Entity;
|
||||
import com.sk89q.worldedit.extent.clipboard.Clipboard;
|
||||
import com.sk89q.worldedit.function.operation.Operation;
|
||||
import com.sk89q.worldedit.math.BlockVector2;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.regions.CuboidRegion;
|
||||
import com.sk89q.worldedit.regions.Region;
|
||||
import com.sk89q.worldedit.util.Location;
|
||||
import com.sk89q.worldedit.world.biome.BiomeType;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockState;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
import com.sk89q.worldedit.world.block.BlockTypes;
|
||||
|
||||
import javax.annotation.Nullable;
|
||||
import java.util.Collections;
|
||||
import java.util.List;
|
||||
|
||||
public class EmptyClipboard implements Clipboard {
|
||||
|
||||
public static final EmptyClipboard INSTANCE = new EmptyClipboard();
|
||||
@ -56,22 +48,6 @@ public class EmptyClipboard implements Clipboard {
|
||||
return BlockVector3.ZERO;
|
||||
}
|
||||
|
||||
@Override
|
||||
public List<? extends Entity> getEntities(Region region) {
|
||||
return Collections.emptyList();
|
||||
}
|
||||
|
||||
@Override
|
||||
public List<? extends Entity> getEntities() {
|
||||
return Collections.emptyList();
|
||||
}
|
||||
|
||||
@Nullable
|
||||
@Override
|
||||
public Entity createEntity(Location location, BaseEntity entity) {
|
||||
return null;
|
||||
}
|
||||
|
||||
@Override
|
||||
public BaseBlock getFullBlock(BlockVector3 position) {
|
||||
return BlockTypes.AIR.getDefaultState().toBaseBlock();
|
||||
@ -97,9 +73,4 @@ public class EmptyClipboard implements Clipboard {
|
||||
return false;
|
||||
}
|
||||
|
||||
@Nullable
|
||||
@Override
|
||||
public Operation commit() {
|
||||
return null;
|
||||
}
|
||||
}
|
||||
|
@ -66,11 +66,11 @@ public abstract class FaweClipboard {
|
||||
<B extends BlockStateHolder<B>> void run(int x, int y, int z, B block);
|
||||
}
|
||||
|
||||
public abstract void streamBiomes(final NBTStreamer.ByteReader task);
|
||||
public abstract void streamBiomes(NBTStreamer.ByteReader task);
|
||||
|
||||
public void streamCombinedIds(final NBTStreamer.ByteReader task) {
|
||||
public void streamCombinedIds(NBTStreamer.ByteReader task) {
|
||||
forEach(new BlockReader() {
|
||||
private int index = 0;
|
||||
private int index;
|
||||
|
||||
@Override
|
||||
public <B extends BlockStateHolder<B>> void run(int x, int y, int z, B block) {
|
||||
|
@ -5,7 +5,6 @@ import com.sk89q.worldedit.extent.clipboard.BlockArrayClipboard;
|
||||
import com.sk89q.worldedit.extent.clipboard.Clipboard;
|
||||
import com.sk89q.worldedit.extent.clipboard.io.ClipboardFormat;
|
||||
import com.sk89q.worldedit.extent.clipboard.io.ClipboardReader;
|
||||
|
||||
import java.io.InputStream;
|
||||
import java.net.URI;
|
||||
import java.util.UUID;
|
||||
|
@ -5,27 +5,25 @@ import com.boydti.fawe.jnbt.NBTStreamer;
|
||||
import com.boydti.fawe.object.IntegerTrio;
|
||||
import com.boydti.fawe.util.MainUtil;
|
||||
import com.boydti.fawe.util.ReflectionUtils;
|
||||
|
||||
import com.sk89q.jnbt.CompoundTag;
|
||||
import com.sk89q.jnbt.IntTag;
|
||||
import com.sk89q.jnbt.Tag;
|
||||
import com.sk89q.worldedit.world.biome.BiomeTypes;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.entity.BaseEntity;
|
||||
import com.sk89q.worldedit.entity.Entity;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.world.biome.BiomeType;
|
||||
import com.sk89q.worldedit.world.biome.BiomeTypes;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
import com.sk89q.worldedit.world.block.BlockType;
|
||||
import com.sk89q.worldedit.world.block.BlockTypes;
|
||||
import net.jpountz.util.SafeUtils;
|
||||
|
||||
import java.util.ArrayList;
|
||||
import java.util.HashMap;
|
||||
import java.util.HashSet;
|
||||
import java.util.List;
|
||||
import java.util.Map;
|
||||
import net.jpountz.util.SafeUtils;
|
||||
|
||||
public class MemoryOptimizedClipboard extends FaweClipboard {
|
||||
|
||||
|
@ -1,15 +1,18 @@
|
||||
package com.boydti.fawe.object.clipboard;
|
||||
|
||||
import static com.google.common.base.Preconditions.checkNotNull;
|
||||
|
||||
import com.sk89q.worldedit.extent.clipboard.BlockArrayClipboard;
|
||||
import com.sk89q.worldedit.extent.clipboard.Clipboard;
|
||||
import com.sk89q.worldedit.session.ClipboardHolder;
|
||||
import java.net.URI;
|
||||
import java.util.*;
|
||||
import java.util.ArrayList;
|
||||
import java.util.HashSet;
|
||||
import java.util.List;
|
||||
import java.util.Set;
|
||||
import java.util.UUID;
|
||||
import java.util.concurrent.ThreadLocalRandom;
|
||||
|
||||
|
||||
import static com.google.common.base.Preconditions.checkNotNull;
|
||||
|
||||
public class MultiClipboardHolder extends URIClipboardHolder {
|
||||
private final List<URIClipboardHolder> holders;
|
||||
private Clipboard[] cached;
|
||||
|
@ -1,7 +1,6 @@
|
||||
package com.boydti.fawe.object.clipboard;
|
||||
|
||||
import com.boydti.fawe.jnbt.NBTStreamer;
|
||||
|
||||
import com.sk89q.jnbt.CompoundTag;
|
||||
import com.sk89q.worldedit.entity.BaseEntity;
|
||||
import com.sk89q.worldedit.entity.Entity;
|
||||
@ -11,7 +10,6 @@ import com.sk89q.worldedit.regions.Region;
|
||||
import com.sk89q.worldedit.world.biome.BiomeType;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
|
||||
import java.util.List;
|
||||
|
||||
public abstract class ReadOnlyClipboard extends FaweClipboard {
|
||||
|
@ -4,15 +4,14 @@ import com.boydti.fawe.object.change.MutableBlockChange;
|
||||
import com.boydti.fawe.object.change.MutableTileChange;
|
||||
import com.boydti.fawe.object.changeset.MemoryOptimizedHistory;
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.world.block.BlockState;
|
||||
import com.sk89q.worldedit.extent.clipboard.BlockArrayClipboard;
|
||||
import com.sk89q.worldedit.extent.clipboard.Clipboard;
|
||||
import com.sk89q.worldedit.history.change.Change;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.regions.CuboidRegion;
|
||||
import com.sk89q.worldedit.world.World;
|
||||
import com.sk89q.worldedit.world.block.BlockState;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
|
||||
import java.util.Iterator;
|
||||
|
||||
public class ResizableClipboardBuilder extends MemoryOptimizedHistory {
|
||||
|
@ -1,14 +1,13 @@
|
||||
package com.boydti.fawe.object.clipboard;
|
||||
|
||||
import static com.google.common.base.Preconditions.checkNotNull;
|
||||
|
||||
import com.sk89q.worldedit.extent.clipboard.Clipboard;
|
||||
import com.sk89q.worldedit.session.ClipboardHolder;
|
||||
import java.net.URI;
|
||||
import java.util.Collections;
|
||||
import java.util.Set;
|
||||
|
||||
|
||||
import static com.google.common.base.Preconditions.checkNotNull;
|
||||
|
||||
public class URIClipboardHolder extends ClipboardHolder {
|
||||
private final URI uri;
|
||||
|
||||
|
@ -2,8 +2,8 @@ package com.boydti.fawe.object.clipboard;
|
||||
|
||||
import com.sk89q.worldedit.EditSession;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.regions.Region;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockTypes;
|
||||
|
||||
public class WorldCutClipboard extends WorldCopyClipboard {
|
||||
|
@ -5,9 +5,9 @@ import com.google.gson.JsonObject;
|
||||
import com.google.gson.JsonParser;
|
||||
import com.sk89q.jnbt.CompoundTag;
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.blocks.BaseItem;
|
||||
import com.sk89q.worldedit.extent.clipboard.Clipboard;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
import com.sk89q.worldedit.world.item.ItemTypes;
|
||||
import java.io.File;
|
||||
|
@ -2,12 +2,10 @@ package com.boydti.fawe.object.clipboard.remap;
|
||||
|
||||
|
||||
import com.boydti.fawe.util.MainUtil;
|
||||
|
||||
import com.google.common.io.Resources;
|
||||
import com.google.common.reflect.TypeToken;
|
||||
import com.google.gson.Gson;
|
||||
import com.google.gson.JsonSyntaxException;
|
||||
|
||||
import java.io.File;
|
||||
import java.io.IOException;
|
||||
import java.nio.charset.Charset;
|
||||
|
@ -2,9 +2,6 @@ package com.boydti.fawe.object.collection;
|
||||
|
||||
import com.google.common.base.Function;
|
||||
import com.google.common.collect.Collections2;
|
||||
import org.jetbrains.annotations.NotNull;
|
||||
|
||||
import javax.annotation.Nullable;
|
||||
import java.util.Collection;
|
||||
import java.util.Iterator;
|
||||
import java.util.Set;
|
||||
@ -12,6 +9,7 @@ import java.util.Spliterator;
|
||||
import java.util.function.Consumer;
|
||||
import java.util.function.Predicate;
|
||||
import java.util.stream.Stream;
|
||||
import org.jetbrains.annotations.NotNull;
|
||||
|
||||
/**
|
||||
* Adapt a collection to a set
|
||||
@ -67,6 +65,7 @@ public class AdaptedSetCollection<T, V> implements Set<V> {
|
||||
return adapted.toArray(a);
|
||||
}
|
||||
|
||||
@Override
|
||||
public boolean add(V v) {
|
||||
return adapted.add(v);
|
||||
}
|
||||
@ -81,6 +80,7 @@ public class AdaptedSetCollection<T, V> implements Set<V> {
|
||||
return adapted.containsAll(c);
|
||||
}
|
||||
|
||||
@Override
|
||||
public boolean addAll(@NotNull Collection<? extends V> c) {
|
||||
return adapted.addAll(c);
|
||||
}
|
||||
@ -90,6 +90,7 @@ public class AdaptedSetCollection<T, V> implements Set<V> {
|
||||
return adapted.removeAll(c);
|
||||
}
|
||||
|
||||
@Override
|
||||
public boolean removeIf(Predicate<? super V> filter) {
|
||||
return adapted.removeIf(filter);
|
||||
}
|
||||
@ -129,6 +130,7 @@ public class AdaptedSetCollection<T, V> implements Set<V> {
|
||||
return adapted.parallelStream();
|
||||
}
|
||||
|
||||
@Override
|
||||
public void forEach(Consumer<? super V> action) {
|
||||
adapted.forEach(action);
|
||||
}
|
||||
|
@ -4,9 +4,6 @@ import com.sk89q.worldedit.math.BlockVector2;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.regions.AbstractRegion;
|
||||
import com.sk89q.worldedit.regions.RegionOperationException;
|
||||
import com.sk89q.worldedit.world.World;
|
||||
|
||||
import java.util.AbstractSet;
|
||||
import java.util.Iterator;
|
||||
import java.util.Set;
|
||||
|
||||
@ -34,6 +31,7 @@ public abstract class BlockSet extends AbstractRegion {
|
||||
}
|
||||
}
|
||||
|
||||
@Override
|
||||
public boolean contains(BlockVector3 obj) {
|
||||
return contains(obj.getX(), obj.getY(), obj.getZ());
|
||||
}
|
||||
@ -94,10 +92,15 @@ public abstract class BlockSet extends AbstractRegion {
|
||||
public abstract void set(int x, int y, int z);
|
||||
public abstract void clear(int x, int y, int z);
|
||||
public abstract boolean remove(int x, int y, int z);
|
||||
@Override
|
||||
public abstract Iterator<BlockVector3> iterator();
|
||||
@Override
|
||||
public abstract Set<BlockVector2> getChunks();
|
||||
@Override
|
||||
public abstract Set<BlockVector3> getChunkCubes();
|
||||
@Override
|
||||
public abstract BlockVector3 getMaximumPoint();
|
||||
@Override
|
||||
public abstract BlockVector3 getMinimumPoint();
|
||||
|
||||
@Override
|
||||
|
@ -19,7 +19,6 @@ import java.util.*;
|
||||
*/
|
||||
public class BlockVectorSet extends AbstractCollection<BlockVector3> implements Set<BlockVector3> {
|
||||
private Int2ObjectMap<LocalBlockVectorSet> localSets = new Int2ObjectOpenHashMap<>();
|
||||
private MutableBlockVector3 mutable = new MutableBlockVector3();
|
||||
|
||||
@Override
|
||||
public int size() {
|
||||
|
@ -4,10 +4,9 @@ import com.boydti.fawe.config.BBC;
|
||||
import com.boydti.fawe.object.FawePlayer;
|
||||
import com.boydti.fawe.object.exception.FaweException;
|
||||
import com.boydti.fawe.util.MemUtil;
|
||||
import com.boydti.fawe.util.Perm;
|
||||
import com.boydti.fawe.util.Permission;
|
||||
import com.boydti.fawe.util.WEManager;
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.world.block.BlockState;
|
||||
import com.sk89q.worldedit.extent.AbstractDelegateExtent;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
@ -27,7 +26,7 @@ public class MemoryCheckingExtent extends AbstractDelegateExtent {
|
||||
if (MemUtil.isMemoryLimited()) {
|
||||
if (this.player != null) {
|
||||
player.sendMessage(BBC.WORLDEDIT_CANCEL_REASON.format(BBC.WORLDEDIT_CANCEL_REASON_LOW_MEMORY.s()));
|
||||
if (Perm.hasPermission(this.player, "worldedit.fast")) {
|
||||
if (Permission.hasPermission(this.player.toWorldEditPlayer(), "worldedit.fast")) {
|
||||
BBC.WORLDEDIT_OOM_ADMIN.send(this.player);
|
||||
}
|
||||
}
|
||||
|
@ -1,10 +1,8 @@
|
||||
package com.boydti.fawe.object.extent;
|
||||
|
||||
import com.boydti.fawe.config.BBC;
|
||||
import com.boydti.fawe.object.FaweLimit;
|
||||
import com.boydti.fawe.object.exception.FaweException;
|
||||
import com.boydti.fawe.util.WEManager;
|
||||
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.entity.BaseEntity;
|
||||
import com.sk89q.worldedit.entity.Entity;
|
||||
@ -12,7 +10,6 @@ import com.sk89q.worldedit.extent.AbstractDelegateExtent;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.math.BlockVector2;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.regions.Region;
|
||||
import com.sk89q.worldedit.util.Location;
|
||||
import com.sk89q.worldedit.world.biome.BiomeType;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
@ -20,8 +17,6 @@ import com.sk89q.worldedit.world.block.BlockState;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
import com.sk89q.worldedit.world.block.BlockTypes;
|
||||
|
||||
import java.util.List;
|
||||
|
||||
public class ProcessedWEExtent extends AbstractDelegateExtent {
|
||||
private final FaweLimit limit;
|
||||
private final AbstractDelegateExtent extent;
|
||||
@ -48,21 +43,6 @@ public class ProcessedWEExtent extends AbstractDelegateExtent {
|
||||
return super.createEntity(location, entity);
|
||||
}
|
||||
|
||||
@Override
|
||||
public BiomeType getBiome(final BlockVector2 position) {
|
||||
return super.getBiome(position);
|
||||
}
|
||||
|
||||
@Override
|
||||
public List<? extends Entity> getEntities() {
|
||||
return super.getEntities();
|
||||
}
|
||||
|
||||
@Override
|
||||
public List<? extends Entity> getEntities(final Region region) {
|
||||
return super.getEntities(region);
|
||||
}
|
||||
|
||||
@Override
|
||||
public BlockState getBlock(int x, int y, int z) {
|
||||
if (!limit.MAX_CHECKS()) {
|
||||
|
@ -36,7 +36,7 @@ public final class AsyncBufferedOutputStream extends FilterOutputStream {
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates an asynchronous buffered output stream with defined buffersize and
|
||||
* Creates an asynchronous buffered output stream with defined bufferSize and
|
||||
* 5 maximal buffers.
|
||||
*/
|
||||
public AsyncBufferedOutputStream(OutputStream out, int bufSize) {
|
||||
@ -46,7 +46,7 @@ public final class AsyncBufferedOutputStream extends FilterOutputStream {
|
||||
/**
|
||||
* Creates an asynchronous buffered output stream.
|
||||
*
|
||||
* @param out the outputstream to layer on.
|
||||
* @param out the outputStream to layer on.
|
||||
* @param bufSize the buffer size.
|
||||
* @param maxBuffers the number of buffers to keep in parallel.
|
||||
*/
|
||||
@ -179,4 +179,4 @@ public final class AsyncBufferedOutputStream extends FilterOutputStream {
|
||||
}
|
||||
}
|
||||
|
||||
}
|
||||
}
|
||||
|
@ -1,12 +1,9 @@
|
||||
package com.github.luben.zstd;
|
||||
|
||||
import java.io.InputStream;
|
||||
import com.github.luben.zstd.util.Native;
|
||||
import java.io.FilterInputStream;
|
||||
import java.io.IOException;
|
||||
import java.lang.IndexOutOfBoundsException;
|
||||
|
||||
import com.github.luben.zstd.util.Native;
|
||||
import com.github.luben.zstd.Zstd;
|
||||
import java.io.InputStream;
|
||||
|
||||
/**
|
||||
* InputStream filter that decompresses the data provided
|
||||
@ -42,16 +39,13 @@ public class ZstdInputStream extends FilterInputStream {
|
||||
private native int initDStream(long stream);
|
||||
private native int decompressStream(long stream, byte[] dst, int dst_size, byte[] src, int src_size);
|
||||
|
||||
// The main constuctor / legacy version dispatcher
|
||||
// The main constructor / legacy version dispatcher
|
||||
public ZstdInputStream(InputStream inStream) throws IOException {
|
||||
// FilterInputStream constructor
|
||||
super(inStream);
|
||||
|
||||
// allocate input buffer with max frame header size
|
||||
src = new byte[srcBuffSize];
|
||||
if (src == null) {
|
||||
throw new IOException("Error allocating the input buffer of size " + srcBuffSize);
|
||||
}
|
||||
stream = createDStream();
|
||||
int size = initDStream(stream);
|
||||
if (Zstd.isError(size)) {
|
||||
@ -80,9 +74,9 @@ public class ZstdInputStream extends FilterInputStream {
|
||||
throw new IOException("Stream closed");
|
||||
}
|
||||
|
||||
// guard agains buffer overflows
|
||||
// guard against buffer overflows
|
||||
if (offset < 0 || len > dst.length - offset) {
|
||||
throw new IndexOutOfBoundsException("Requested lenght " + len
|
||||
throw new IndexOutOfBoundsException("Requested length " + len
|
||||
+ " from offset " + offset + " in buffer of size " + dst.length);
|
||||
}
|
||||
int dstSize = offset + len;
|
||||
|
@ -4,7 +4,6 @@ import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.function.mask.SolidBlockMask;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.math.MutableBlockVector3;
|
||||
|
||||
import java.util.Arrays;
|
||||
|
||||
public class AngleMask extends SolidBlockMask implements ResettableMask {
|
||||
|
@ -3,11 +3,8 @@ package com.boydti.fawe.object.mask;
|
||||
import com.boydti.fawe.object.extent.LightingExtent;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.function.mask.AbstractExtentMask;
|
||||
import com.sk89q.worldedit.function.mask.Mask2D;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
|
||||
import javax.annotation.Nullable;
|
||||
|
||||
public class BlockLightMask extends AbstractExtentMask {
|
||||
|
||||
private final int min, max;
|
||||
|
@ -1,7 +1,6 @@
|
||||
package com.boydti.fawe.object.mask;
|
||||
|
||||
import com.boydti.fawe.object.extent.LightingExtent;
|
||||
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.function.mask.AbstractExtentMask;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
|
@ -1,7 +1,6 @@
|
||||
package com.boydti.fawe.object.mask;
|
||||
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
|
||||
import java.util.Set;
|
||||
|
||||
// TODO FIXME
|
||||
|
@ -2,11 +2,8 @@ package com.boydti.fawe.object.mask;
|
||||
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.function.mask.AbstractExtentMask;
|
||||
import com.sk89q.worldedit.function.mask.Mask2D;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
|
||||
import javax.annotation.Nullable;
|
||||
|
||||
public class IdMask extends AbstractExtentMask implements ResettableMask {
|
||||
|
||||
private transient int id = -1;
|
||||
|
@ -3,11 +3,8 @@ package com.boydti.fawe.object.mask;
|
||||
import com.boydti.fawe.object.extent.LightingExtent;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.function.mask.AbstractExtentMask;
|
||||
import com.sk89q.worldedit.function.mask.Mask2D;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
|
||||
import javax.annotation.Nullable;
|
||||
|
||||
public class LightMask extends AbstractExtentMask {
|
||||
|
||||
private final int min, max;
|
||||
|
@ -33,6 +33,6 @@ public class MaskedTargetBlock extends TargetBlock {
|
||||
}
|
||||
}
|
||||
Location currentBlock = getCurrentBlock();
|
||||
return (currentBlock != null || !useLastBlock ? currentBlock : lastBlock);
|
||||
return currentBlock != null || !useLastBlock ? currentBlock : lastBlock;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
@ -3,11 +3,8 @@ package com.boydti.fawe.object.mask;
|
||||
import com.boydti.fawe.object.extent.LightingExtent;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.function.mask.AbstractExtentMask;
|
||||
import com.sk89q.worldedit.function.mask.Mask2D;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
|
||||
import javax.annotation.Nullable;
|
||||
|
||||
public class OpacityMask extends AbstractExtentMask {
|
||||
|
||||
private final int min, max;
|
||||
|
@ -1,11 +1,8 @@
|
||||
package com.boydti.fawe.object.mask;
|
||||
|
||||
import com.sk89q.worldedit.function.mask.AbstractMask;
|
||||
import com.sk89q.worldedit.function.mask.Mask2D;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
|
||||
import javax.annotation.Nullable;
|
||||
|
||||
/**
|
||||
* Restricts the
|
||||
*/
|
||||
|
@ -10,22 +10,25 @@ public class ROCAngleMask extends AngleMask {
|
||||
|
||||
@Override
|
||||
protected boolean testSlope(int x, int y, int z) {
|
||||
double slope, tmp;
|
||||
boolean aboveMin;
|
||||
double tmp;
|
||||
lastY = y;
|
||||
|
||||
int base = getHeight(x, y, z);
|
||||
slope = ((getHeight(x + distance, y, z) - base) - (base - getHeight(x - distance, y, z))) * ADJACENT_MOD;
|
||||
double slope =
|
||||
(getHeight(x + distance, y, z) - base - (base - getHeight(x - distance, y, z)))
|
||||
* ADJACENT_MOD;
|
||||
|
||||
tmp = ((getHeight(x, y, z + distance) - base) - (base - getHeight(x, y, z - distance))) * ADJACENT_MOD;
|
||||
tmp = (getHeight(x, y, z + distance) - base - (base - getHeight(x, y, z - distance))) * ADJACENT_MOD;
|
||||
if (Math.abs(tmp) > Math.abs(slope)) slope = tmp;
|
||||
|
||||
tmp = ((getHeight(x + distance, y, z + distance) - base) - (base - getHeight(x - distance, y, z - distance))) * DIAGONAL_MOD;
|
||||
tmp = (getHeight(x + distance, y, z + distance) - base - (base - getHeight(x - distance, y,
|
||||
z - distance))) * DIAGONAL_MOD;
|
||||
if (Math.abs(tmp) > Math.abs(slope)) slope = tmp;
|
||||
|
||||
tmp = ((getHeight(x - distance, y, z + distance) - base) - (base - getHeight(x + distance, y, z - distance))) * DIAGONAL_MOD;
|
||||
tmp = (getHeight(x - distance, y, z + distance) - base - (base - getHeight(x + distance, y,
|
||||
z - distance))) * DIAGONAL_MOD;
|
||||
if (Math.abs(tmp) > Math.abs(slope)) slope = tmp;
|
||||
|
||||
return lastValue = (slope >= min && slope <= max);
|
||||
return lastValue = slope >= min && slope <= max;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
@ -1,11 +1,8 @@
|
||||
package com.boydti.fawe.object.mask;
|
||||
|
||||
import com.sk89q.worldedit.function.mask.AbstractMask;
|
||||
import com.sk89q.worldedit.function.mask.Mask2D;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
|
||||
import javax.annotation.Nullable;
|
||||
|
||||
public class RadiusMask extends AbstractMask implements ResettableMask {
|
||||
|
||||
private transient BlockVector3 pos;
|
||||
|
@ -2,7 +2,6 @@ package com.boydti.fawe.object.mask;
|
||||
|
||||
import com.sk89q.worldedit.function.mask.AbstractMask;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
|
||||
import java.util.SplittableRandom;
|
||||
|
||||
public class RandomMask extends AbstractMask implements ResettableMask {
|
||||
@ -23,4 +22,4 @@ public class RandomMask extends AbstractMask implements ResettableMask {
|
||||
public void reset() {
|
||||
random = new SplittableRandom();
|
||||
}
|
||||
}
|
||||
}
|
||||
|
@ -3,11 +3,8 @@ package com.boydti.fawe.object.mask;
|
||||
import com.boydti.fawe.object.extent.LightingExtent;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.function.mask.AbstractExtentMask;
|
||||
import com.sk89q.worldedit.function.mask.Mask2D;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
|
||||
import javax.annotation.Nullable;
|
||||
|
||||
public class SkyLightMask extends AbstractExtentMask {
|
||||
|
||||
private final int min, max;
|
||||
|
@ -1,13 +1,10 @@
|
||||
package com.boydti.fawe.object.mask;
|
||||
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.function.mask.Mask2D;
|
||||
import com.sk89q.worldedit.function.mask.SolidBlockMask;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.math.MutableBlockVector3;
|
||||
|
||||
import javax.annotation.Nullable;
|
||||
|
||||
/**
|
||||
* Restricts the
|
||||
*/
|
||||
|
@ -1,11 +1,8 @@
|
||||
package com.boydti.fawe.object.mask;
|
||||
|
||||
import com.sk89q.worldedit.function.mask.AbstractMask;
|
||||
import com.sk89q.worldedit.function.mask.Mask2D;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
|
||||
import javax.annotation.Nullable;
|
||||
|
||||
/**
|
||||
* Restricts the
|
||||
*/
|
||||
|
@ -1,11 +1,8 @@
|
||||
package com.boydti.fawe.object.mask;
|
||||
|
||||
import com.sk89q.worldedit.function.mask.AbstractMask;
|
||||
import com.sk89q.worldedit.function.mask.Mask2D;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
|
||||
import javax.annotation.Nullable;
|
||||
|
||||
/**
|
||||
* Restricts the
|
||||
*/
|
||||
|
@ -1,11 +1,10 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import static com.google.common.base.Preconditions.checkNotNull;
|
||||
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.function.pattern.AbstractPattern;
|
||||
|
||||
|
||||
import static com.google.common.base.Preconditions.checkNotNull;
|
||||
|
||||
public abstract class AbstractExtentPattern extends AbstractPattern {
|
||||
private transient final Extent extent;
|
||||
|
||||
|
@ -1,13 +1,11 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import com.boydti.fawe.beta.FilterBlock;
|
||||
import com.boydti.fawe.object.DataAnglePattern;
|
||||
import com.boydti.fawe.util.TextureHolder;
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockState;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
import com.sk89q.worldedit.world.block.BlockType;
|
||||
|
||||
@ -69,4 +67,4 @@ public class AngleColorPattern extends DataAnglePattern {
|
||||
if (newBlock == null) return false;
|
||||
return set.setBlock(extent, newBlock.getDefaultState());
|
||||
}
|
||||
}
|
||||
}
|
||||
|
@ -1,6 +1,5 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import com.boydti.fawe.Fawe;
|
||||
import com.boydti.fawe.util.TextureHolder;
|
||||
import com.boydti.fawe.util.TextureUtil;
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
@ -9,8 +8,6 @@ import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockType;
|
||||
import java.awt.Color;
|
||||
import java.io.IOException;
|
||||
import java.io.ObjectInputStream;
|
||||
|
||||
public class AverageColorPattern extends AbstractExtentPattern {
|
||||
private transient TextureHolder holder;
|
||||
|
@ -1,14 +1,10 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import com.boydti.fawe.beta.FilterBlock;
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockState;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.math.MutableBlockVector2;
|
||||
import com.sk89q.worldedit.world.biome.BiomeType;
|
||||
import java.io.IOException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
|
||||
public class BiomePattern extends ExistingPattern {
|
||||
private final BiomeType biome;
|
||||
|
@ -1,20 +1,15 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import com.boydti.fawe.Fawe;
|
||||
import com.boydti.fawe.beta.FilterBlock;
|
||||
import com.boydti.fawe.object.FawePlayer;
|
||||
import com.boydti.fawe.object.collection.LocalBlockVectorSet;
|
||||
import com.boydti.fawe.util.FaweTimer;
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockState;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.function.pattern.AbstractPattern;
|
||||
import com.sk89q.worldedit.function.pattern.Pattern;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
|
||||
import java.io.IOException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import java.util.UUID;
|
||||
|
||||
public class BufferedPattern extends AbstractPattern implements ResettablePattern {
|
||||
|
@ -1,16 +1,13 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import com.boydti.fawe.beta.DelegateFilterBlock;
|
||||
import com.boydti.fawe.beta.FilterBlock;
|
||||
import static com.google.common.base.Preconditions.checkNotNull;
|
||||
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.function.pattern.Pattern;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockState;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
|
||||
import static com.google.common.base.Preconditions.checkNotNull;
|
||||
|
||||
public class DataPattern extends AbstractExtentPattern {
|
||||
private final Pattern pattern;
|
||||
|
@ -1,6 +1,5 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import com.boydti.fawe.Fawe;
|
||||
import com.boydti.fawe.util.TextureHolder;
|
||||
import com.boydti.fawe.util.TextureUtil;
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
@ -9,8 +8,6 @@ import com.sk89q.worldedit.function.pattern.AbstractPattern;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockType;
|
||||
import java.io.IOException;
|
||||
import java.io.ObjectInputStream;
|
||||
|
||||
public class DesaturatePattern extends AbstractPattern {
|
||||
private final TextureHolder holder;
|
||||
@ -40,8 +37,7 @@ public class DesaturatePattern extends AbstractPattern {
|
||||
int red = (int) (r + value * (l - r));
|
||||
int green = (int) (g + value * (l - g));
|
||||
int blue = (int) (b + value * (l - b));
|
||||
int newColor = (alpha << 24) + (red << 16) + (green << 8) + (blue << 0);
|
||||
return newColor;
|
||||
return (alpha << 24) + (red << 16) + (green << 8) + (blue << 0);
|
||||
}
|
||||
|
||||
@Override
|
||||
|
@ -1,10 +1,9 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import com.boydti.fawe.beta.FilterBlock;
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
|
||||
public class ExistingPattern extends AbstractExtentPattern {
|
||||
public ExistingPattern(Extent extent) {
|
||||
|
@ -1,20 +1,17 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockState;
|
||||
import static com.google.common.base.Preconditions.checkNotNull;
|
||||
|
||||
import com.sk89q.worldedit.function.pattern.AbstractPattern;
|
||||
import com.sk89q.worldedit.internal.expression.Expression;
|
||||
import com.sk89q.worldedit.internal.expression.ExpressionException;
|
||||
import com.sk89q.worldedit.internal.expression.runtime.EvaluationException;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.regions.shape.WorldEditExpressionEnvironment;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockState;
|
||||
import com.sk89q.worldedit.world.block.BlockTypes;
|
||||
|
||||
import java.io.IOException;
|
||||
|
||||
|
||||
import static com.google.common.base.Preconditions.checkNotNull;
|
||||
|
||||
/**
|
||||
* A mask that evaluates an expression.
|
||||
* <p>
|
||||
|
@ -1,8 +1,8 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import static com.google.common.base.Preconditions.checkNotNull;
|
||||
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockState;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.extent.clipboard.Clipboard;
|
||||
import com.sk89q.worldedit.function.mask.ExistingBlockMask;
|
||||
@ -10,13 +10,10 @@ import com.sk89q.worldedit.function.operation.ForwardExtentCopy;
|
||||
import com.sk89q.worldedit.function.operation.Operations;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.math.MutableBlockVector3;
|
||||
import com.sk89q.worldedit.regions.Region;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import java.io.IOException;
|
||||
import java.io.NotSerializableException;
|
||||
|
||||
|
||||
import static com.google.common.base.Preconditions.checkNotNull;
|
||||
|
||||
/**
|
||||
* A pattern that reads from {@link Clipboard}.
|
||||
*/
|
||||
@ -51,4 +48,4 @@ public class FullClipboardPattern extends AbstractExtentPattern {
|
||||
private void writeObject(java.io.ObjectOutputStream stream) throws IOException {
|
||||
throw new NotSerializableException("Clipboard cannot be serialized!");
|
||||
}
|
||||
}
|
||||
}
|
||||
|
@ -1,13 +1,9 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import com.boydti.fawe.FaweCache;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockState;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.function.pattern.Pattern;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
import com.sk89q.worldedit.world.block.BlockTypes;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
|
||||
public class IdDataMaskPattern extends AbstractExtentPattern {
|
||||
private final Pattern pattern;
|
||||
@ -27,4 +23,4 @@ public class IdDataMaskPattern extends AbstractExtentPattern {
|
||||
int newData = newBlock.getInternalPropertiesId() + oldData - (oldData & bitMask);
|
||||
return newBlock.withPropertyId(newData).toBaseBlock();
|
||||
}
|
||||
}
|
||||
}
|
||||
|
@ -1,14 +1,11 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import com.boydti.fawe.beta.FilterBlock;
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockState;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.function.pattern.AbstractPattern;
|
||||
import com.sk89q.worldedit.function.pattern.Pattern;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
|
||||
public class Linear2DBlockPattern extends AbstractPattern {
|
||||
|
||||
@ -35,4 +32,4 @@ public class Linear2DBlockPattern extends AbstractPattern {
|
||||
}
|
||||
return patternsArray[index].apply(extent, get, set);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
@ -1,14 +1,11 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import com.boydti.fawe.beta.FilterBlock;
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockState;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.function.pattern.AbstractPattern;
|
||||
import com.sk89q.worldedit.function.pattern.Pattern;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
|
||||
public class Linear3DBlockPattern extends AbstractPattern {
|
||||
|
||||
|
@ -1,13 +1,11 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockState;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.function.pattern.AbstractPattern;
|
||||
import com.sk89q.worldedit.function.pattern.Pattern;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
|
||||
public class LinearBlockPattern extends AbstractPattern implements ResettablePattern {
|
||||
|
||||
|
@ -1,16 +1,12 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import com.boydti.fawe.beta.FilterBlock;
|
||||
import com.boydti.fawe.beta.SingleFilterBlock;
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockState;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.function.mask.Mask;
|
||||
import com.sk89q.worldedit.function.pattern.AbstractPattern;
|
||||
import com.sk89q.worldedit.function.pattern.Pattern;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
|
||||
public class MaskedPattern extends AbstractPattern {
|
||||
|
||||
|
@ -1,18 +1,12 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import com.boydti.fawe.beta.DelegateFilterBlock;
|
||||
import com.boydti.fawe.beta.FilterBlock;
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockState;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.function.pattern.AbstractPattern;
|
||||
import com.sk89q.worldedit.function.pattern.Pattern;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.math.MutableBlockVector3;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
|
||||
import java.io.IOException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
|
||||
public class NoXPattern extends AbstractPattern {
|
||||
|
||||
@ -25,15 +19,15 @@ public class NoXPattern extends AbstractPattern {
|
||||
|
||||
@Override
|
||||
public BaseBlock apply(BlockVector3 pos) {
|
||||
mutable.mutY((pos.getY()));
|
||||
mutable.mutZ((pos.getZ()));
|
||||
mutable.mutY(pos.getY());
|
||||
mutable.mutZ(pos.getZ());
|
||||
return pattern.apply(mutable);
|
||||
}
|
||||
|
||||
@Override
|
||||
public boolean apply(Extent extent, BlockVector3 get, BlockVector3 set) throws WorldEditException {
|
||||
mutable.mutY((get.getY()));
|
||||
mutable.mutZ((get.getZ()));
|
||||
mutable.mutY(get.getY());
|
||||
mutable.mutZ(get.getZ());
|
||||
return pattern.apply(extent, mutable, set);
|
||||
}
|
||||
}
|
||||
|
@ -19,15 +19,15 @@ public class NoYPattern extends AbstractPattern {
|
||||
|
||||
@Override
|
||||
public BaseBlock apply(BlockVector3 pos) {
|
||||
mutable.mutX((pos.getX()));
|
||||
mutable.mutZ((pos.getZ()));
|
||||
mutable.mutX(pos.getX());
|
||||
mutable.mutZ(pos.getZ());
|
||||
return pattern.apply(mutable);
|
||||
}
|
||||
|
||||
@Override
|
||||
public boolean apply(Extent extent, BlockVector3 get, BlockVector3 set) throws WorldEditException {
|
||||
mutable.mutX((get.getX()));
|
||||
mutable.mutZ((get.getZ()));
|
||||
mutable.mutX(get.getX());
|
||||
mutable.mutZ(get.getZ());
|
||||
return pattern.apply(extent, mutable, set);
|
||||
}
|
||||
}
|
||||
|
@ -1,18 +1,12 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import com.boydti.fawe.beta.DelegateFilterBlock;
|
||||
import com.boydti.fawe.beta.FilterBlock;
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockState;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.function.pattern.AbstractPattern;
|
||||
import com.sk89q.worldedit.function.pattern.Pattern;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.math.MutableBlockVector3;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
|
||||
import java.io.IOException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
|
||||
public class NoZPattern extends AbstractPattern {
|
||||
|
||||
@ -26,15 +20,15 @@ public class NoZPattern extends AbstractPattern {
|
||||
|
||||
@Override
|
||||
public BaseBlock apply(BlockVector3 pos) {
|
||||
mutable.mutX((pos.getX()));
|
||||
mutable.mutY((pos.getY()));
|
||||
mutable.mutX(pos.getX());
|
||||
mutable.mutY(pos.getY());
|
||||
return pattern.apply(mutable);
|
||||
}
|
||||
|
||||
@Override
|
||||
public boolean apply(Extent extent, BlockVector3 get, BlockVector3 set) throws WorldEditException {
|
||||
mutable.mutX((get.getX()));
|
||||
mutable.mutY((get.getY()));
|
||||
mutable.mutX(get.getX());
|
||||
mutable.mutY(get.getY());
|
||||
return pattern.apply(extent, mutable, set);
|
||||
}
|
||||
}
|
||||
|
@ -1,17 +1,12 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import com.boydti.fawe.beta.FilterBlock;
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockState;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.function.pattern.AbstractPattern;
|
||||
import com.sk89q.worldedit.function.pattern.Pattern;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.math.MutableBlockVector3;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
|
||||
import java.io.IOException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
|
||||
public class OffsetPattern extends AbstractPattern {
|
||||
|
||||
@ -28,17 +23,17 @@ public class OffsetPattern extends AbstractPattern {
|
||||
|
||||
@Override
|
||||
public BaseBlock apply(BlockVector3 position) {
|
||||
mutable.mutX((position.getX() + dx));
|
||||
mutable.mutY((position.getY() + dy));
|
||||
mutable.mutZ((position.getZ() + dz));
|
||||
mutable.mutX(position.getX() + dx);
|
||||
mutable.mutY(position.getY() + dy);
|
||||
mutable.mutZ(position.getZ() + dz);
|
||||
return pattern.apply(mutable);
|
||||
}
|
||||
|
||||
@Override
|
||||
public boolean apply(Extent extent, BlockVector3 get, BlockVector3 set) throws WorldEditException {
|
||||
mutable.mutX((get.getX() + dx));
|
||||
mutable.mutY((get.getY() + dy));
|
||||
mutable.mutZ((get.getZ() + dz));
|
||||
mutable.mutX(get.getX() + dx);
|
||||
mutable.mutY(get.getY() + dy);
|
||||
mutable.mutZ(get.getZ() + dz);
|
||||
return pattern.apply(extent, get, mutable);
|
||||
}
|
||||
}
|
||||
|
@ -1,12 +1,10 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import com.boydti.fawe.beta.FilterBlock;
|
||||
import com.boydti.fawe.object.string.MutableCharSequence;
|
||||
import com.boydti.fawe.util.MathMan;
|
||||
import com.boydti.fawe.util.StringMan;
|
||||
import com.sk89q.jnbt.CompoundTag;
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.registry.state.AbstractProperty;
|
||||
@ -17,7 +15,6 @@ import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockState;
|
||||
import com.sk89q.worldedit.world.block.BlockType;
|
||||
import com.sk89q.worldedit.world.block.BlockTypes;
|
||||
|
||||
import java.util.ArrayList;
|
||||
import java.util.List;
|
||||
|
||||
@ -173,7 +170,7 @@ public class PropertyPattern extends AbstractExtentPattern {
|
||||
last = i + 1;
|
||||
break;
|
||||
}
|
||||
default: {
|
||||
default:
|
||||
Operator tmp = getOp(c);
|
||||
if (tmp != null) {
|
||||
operator = tmp;
|
||||
@ -186,7 +183,6 @@ public class PropertyPattern extends AbstractExtentPattern {
|
||||
last = i + 1;
|
||||
}
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
@ -1,8 +1,9 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import static com.google.common.base.Preconditions.checkNotNull;
|
||||
|
||||
import com.boydti.fawe.object.schematic.Schematic;
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.extent.clipboard.Clipboard;
|
||||
import com.sk89q.worldedit.function.pattern.AbstractPattern;
|
||||
@ -12,12 +13,10 @@ import com.sk89q.worldedit.math.Vector3;
|
||||
import com.sk89q.worldedit.math.transform.AffineTransform;
|
||||
import com.sk89q.worldedit.math.transform.Transform;
|
||||
import com.sk89q.worldedit.session.ClipboardHolder;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import java.util.List;
|
||||
import java.util.concurrent.ThreadLocalRandom;
|
||||
|
||||
|
||||
import static com.google.common.base.Preconditions.checkNotNull;
|
||||
|
||||
public class RandomFullClipboardPattern extends AbstractPattern {
|
||||
private final Extent extent;
|
||||
private final MutableBlockVector3 mutable = new MutableBlockVector3();
|
||||
|
@ -1,15 +1,12 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import com.boydti.fawe.beta.FilterBlock;
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.function.pattern.AbstractPattern;
|
||||
import com.sk89q.worldedit.function.pattern.Pattern;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.math.MutableBlockVector3;
|
||||
|
||||
import java.io.IOException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import java.util.SplittableRandom;
|
||||
|
||||
public class RandomOffsetPattern extends AbstractPattern {
|
||||
@ -47,4 +44,4 @@ public class RandomOffsetPattern extends AbstractPattern {
|
||||
mutable.mutZ((set.getZ() + r.nextInt(dz2) - dz));
|
||||
return pattern.apply(extent, get, mutable);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
@ -1,15 +1,12 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import com.boydti.fawe.beta.FilterBlock;
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.function.pattern.AbstractPattern;
|
||||
import com.sk89q.worldedit.function.pattern.Pattern;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.math.MutableBlockVector3;
|
||||
|
||||
import java.io.IOException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
|
||||
public class RelativePattern extends AbstractPattern implements ResettablePattern {
|
||||
|
||||
|
@ -1,7 +1,5 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import com.boydti.fawe.Fawe;
|
||||
import com.boydti.fawe.beta.FilterBlock;
|
||||
import com.boydti.fawe.util.TextureHolder;
|
||||
import com.boydti.fawe.util.TextureUtil;
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
@ -11,8 +9,6 @@ import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockType;
|
||||
import java.awt.Color;
|
||||
import java.io.IOException;
|
||||
import java.io.ObjectInputStream;
|
||||
|
||||
public class SaturatePattern extends AbstractPattern {
|
||||
private final TextureHolder holder;
|
||||
|
@ -1,19 +1,15 @@
|
||||
package com.boydti.fawe.object.pattern;
|
||||
|
||||
import com.boydti.fawe.beta.FilterBlock;
|
||||
import com.sk89q.worldedit.WorldEditException;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.extent.Extent;
|
||||
import com.sk89q.worldedit.function.mask.SolidBlockMask;
|
||||
import com.sk89q.worldedit.function.pattern.AbstractPattern;
|
||||
import com.sk89q.worldedit.function.pattern.Pattern;
|
||||
import com.sk89q.worldedit.math.BlockVector3;
|
||||
import com.sk89q.worldedit.math.MutableBlockVector3;
|
||||
import com.sk89q.worldedit.world.block.BaseBlock;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
import com.sk89q.worldedit.world.block.BlockType;
|
||||
import com.sk89q.worldedit.world.block.BlockTypes;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.util.SplittableRandom;
|
||||
|
||||
public class SolidRandomOffsetPattern extends AbstractPattern {
|
||||
@ -47,27 +43,25 @@ public class SolidRandomOffsetPattern extends AbstractPattern {
|
||||
|
||||
@Override
|
||||
public BaseBlock apply(BlockVector3 position) {
|
||||
mutable.mutX((position.getX() + r.nextInt(dx2) - dx));
|
||||
mutable.mutY((position.getY() + r.nextInt(dy2) - dy));
|
||||
mutable.mutZ((position.getZ() + r.nextInt(dz2) - dz));
|
||||
mutable.mutX(position.getX() + r.nextInt(dx2) - dx);
|
||||
mutable.mutY(position.getY() + r.nextInt(dy2) - dy);
|
||||
mutable.mutZ(position.getZ() + r.nextInt(dz2) - dz);
|
||||
BaseBlock block = pattern.apply(mutable);
|
||||
if (block.getMaterial().isSolid()) {
|
||||
return block;
|
||||
} else {
|
||||
return pattern.apply(position);
|
||||
}
|
||||
return pattern.apply(position);
|
||||
}
|
||||
|
||||
@Override
|
||||
public boolean apply(Extent extent, BlockVector3 get, BlockVector3 set) throws WorldEditException {
|
||||
mutable.mutX((set.getX() + r.nextInt(dx2) - dx));
|
||||
mutable.mutY((set.getY() + r.nextInt(dy2) - dy));
|
||||
mutable.mutZ((set.getZ() + r.nextInt(dz2) - dz));
|
||||
mutable.mutX(set.getX() + r.nextInt(dx2) - dx);
|
||||
mutable.mutY(set.getY() + r.nextInt(dy2) - dy);
|
||||
mutable.mutZ(set.getZ() + r.nextInt(dz2) - dz);
|
||||
BlockStateHolder block = pattern.apply(mutable);
|
||||
if (block.getMaterial().isSolid()) {
|
||||
return pattern.apply(extent, get, mutable);
|
||||
} else {
|
||||
return pattern.apply(extent, get, set);
|
||||
}
|
||||
return pattern.apply(extent, get, set);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
@ -16,7 +16,6 @@ public class SurfaceRandomOffsetPattern extends AbstractPattern {
|
||||
private final MutableBlockVector3 cur;
|
||||
private final MutableBlockVector3[] buffer;
|
||||
private final MutableBlockVector3[] allowed;
|
||||
private MutableBlockVector3 next;
|
||||
|
||||
public SurfaceRandomOffsetPattern(Pattern pattern, int distance) {
|
||||
this.pattern = pattern;
|
||||
|
@ -155,7 +155,7 @@ public class FuzzyRegionSelector extends AbstractDelegateExtent implements Regio
|
||||
}
|
||||
|
||||
@Override
|
||||
public List<BlockVector3> getVerticies() {
|
||||
public List<BlockVector3> getVertices() {
|
||||
return positions;
|
||||
}
|
||||
|
||||
|
@ -230,7 +230,7 @@ public class PolyhedralRegionSelector implements RegionSelector, CUIRegion {
|
||||
}
|
||||
|
||||
@Override
|
||||
public List<BlockVector3> getVerticies() {
|
||||
public List<BlockVector3> getVertices() {
|
||||
return new ArrayList<>(region.getVertices());
|
||||
}
|
||||
}
|
||||
|
@ -3,8 +3,14 @@ package com.boydti.fawe.object.schematic;
|
||||
import com.boydti.fawe.Fawe;
|
||||
import com.boydti.fawe.FaweCache;
|
||||
import com.boydti.fawe.util.ReflectionUtils;
|
||||
|
||||
import com.sk89q.jnbt.*;
|
||||
import com.sk89q.jnbt.CompoundTag;
|
||||
import com.sk89q.jnbt.IntTag;
|
||||
import com.sk89q.jnbt.ListTag;
|
||||
import com.sk89q.jnbt.NBTInputStream;
|
||||
import com.sk89q.jnbt.NBTOutputStream;
|
||||
import com.sk89q.jnbt.NamedTag;
|
||||
import com.sk89q.jnbt.StringTag;
|
||||
import com.sk89q.jnbt.Tag;
|
||||
import com.sk89q.worldedit.entity.BaseEntity;
|
||||
import com.sk89q.worldedit.entity.Entity;
|
||||
import com.sk89q.worldedit.extent.clipboard.BlockArrayClipboard;
|
||||
@ -26,8 +32,6 @@ import com.sk89q.worldedit.world.block.BlockTypes;
|
||||
import com.sk89q.worldedit.world.entity.EntityTypes;
|
||||
import com.sk89q.worldedit.world.storage.NBTConversions;
|
||||
import it.unimi.dsi.fastutil.ints.Int2ObjectArrayMap;
|
||||
import org.jetbrains.annotations.NotNull;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.util.ArrayList;
|
||||
import java.util.Arrays;
|
||||
@ -35,6 +39,7 @@ import java.util.HashMap;
|
||||
import java.util.List;
|
||||
import java.util.Map;
|
||||
import java.util.UUID;
|
||||
import org.jetbrains.annotations.NotNull;
|
||||
|
||||
public class MinecraftStructure implements ClipboardReader, ClipboardWriter {
|
||||
private static final int WARN_SIZE = 32;
|
||||
@ -73,7 +78,7 @@ public class MinecraftStructure implements ClipboardReader, ClipboardWriter {
|
||||
// Init clipboard
|
||||
BlockVector3 origin = BlockVector3.at(0, 0, 0);
|
||||
CuboidRegion region = new CuboidRegion(origin, origin.add(width, height, length).subtract(BlockVector3.ONE));
|
||||
BlockArrayClipboard clipboard = new BlockArrayClipboard(region, clipboardId);
|
||||
Clipboard clipboard = new BlockArrayClipboard(region, clipboardId);
|
||||
// Blocks
|
||||
ListTag blocks = (ListTag) tags.get("blocks");
|
||||
if (blocks != null) {
|
||||
@ -86,10 +91,6 @@ public class MinecraftStructure implements ClipboardReader, ClipboardWriter {
|
||||
String name = ((StringTag) map.get("Name")).getValue();
|
||||
BlockType type = BlockTypes.get(name);
|
||||
BlockState state = type.getDefaultState();
|
||||
if (type == null) {
|
||||
Fawe.debug("Unknown block: " + name);
|
||||
continue;
|
||||
}
|
||||
CompoundTag properties = (CompoundTag) map.get("Properties");
|
||||
if (properties != null) {
|
||||
for (Map.Entry<String, Tag> entry : properties.getValue().entrySet()) {
|
||||
@ -167,85 +168,79 @@ public class MinecraftStructure implements ClipboardReader, ClipboardWriter {
|
||||
// Size
|
||||
structure.put("size", Arrays.asList(width, height, length));
|
||||
// Palette
|
||||
{
|
||||
ArrayList<HashMap<String, Object>> palette = new ArrayList<>();
|
||||
for (BlockVector3 point : region) {
|
||||
BlockStateHolder block = clipboard.getBlock(point);
|
||||
int combined = block.getInternalId();
|
||||
BlockType type = block.getBlockType();
|
||||
ArrayList<HashMap<String, Object>> palette = new ArrayList<>();
|
||||
for (BlockVector3 point : region) {
|
||||
BlockStateHolder block = clipboard.getBlock(point);
|
||||
int combined = block.getInternalId();
|
||||
BlockType type = block.getBlockType();
|
||||
|
||||
if (type == BlockTypes.STRUCTURE_VOID || indexes.containsKey(combined)) {
|
||||
continue;
|
||||
}
|
||||
if (type == BlockTypes.STRUCTURE_VOID || indexes.containsKey(combined)) {
|
||||
continue;
|
||||
}
|
||||
|
||||
indexes.put(combined, (Integer) palette.size());
|
||||
HashMap<String, Object> paletteEntry = new HashMap<>();
|
||||
paletteEntry.put("Name", type.getId());
|
||||
if (block.getInternalId() != type.getInternalId()) {
|
||||
Map<String, Object> properties = null;
|
||||
for (AbstractProperty property : (List<AbstractProperty<?>>) type.getProperties()) {
|
||||
int propIndex = property.getIndex(block.getInternalId());
|
||||
if (propIndex != 0) {
|
||||
if (properties == null) properties = new HashMap<>();
|
||||
Object value = property.getValues().get(propIndex);
|
||||
properties.put(property.getName(), value.toString());
|
||||
}
|
||||
}
|
||||
if (properties != null) {
|
||||
paletteEntry.put("Properties", properties);
|
||||
indexes.put(combined, (Integer) palette.size());
|
||||
HashMap<String, Object> paletteEntry = new HashMap<>();
|
||||
paletteEntry.put("Name", type.getId());
|
||||
if (block.getInternalId() != type.getInternalId()) {
|
||||
Map<String, Object> properties = null;
|
||||
for (AbstractProperty property : (List<AbstractProperty<?>>) type.getProperties()) {
|
||||
int propIndex = property.getIndex(block.getInternalId());
|
||||
if (propIndex != 0) {
|
||||
if (properties == null) properties = new HashMap<>();
|
||||
Object value = property.getValues().get(propIndex);
|
||||
properties.put(property.getName(), value.toString());
|
||||
}
|
||||
}
|
||||
palette.add(paletteEntry);
|
||||
}
|
||||
if (!palette.isEmpty()) {
|
||||
structure.put("palette", palette);
|
||||
if (properties != null) {
|
||||
paletteEntry.put("Properties", properties);
|
||||
}
|
||||
}
|
||||
palette.add(paletteEntry);
|
||||
}
|
||||
if (!palette.isEmpty()) {
|
||||
structure.put("palette", palette);
|
||||
}
|
||||
// Blocks
|
||||
{
|
||||
ArrayList<Map<String, Object>> blocks = new ArrayList<>();
|
||||
BlockVector3 min = region.getMinimumPoint();
|
||||
for (BlockVector3 point : region) {
|
||||
BaseBlock block = clipboard.getFullBlock(point);
|
||||
if (block.getBlockType() != BlockTypes.STRUCTURE_VOID) {
|
||||
int combined = block.getInternalId();
|
||||
int index = indexes.get(combined);
|
||||
List<Integer> pos = Arrays.asList(point.getX() - min.getX(),
|
||||
point.getY() - min.getY(), point.getZ() - min.getZ());
|
||||
if (!block.hasNbtData()) {
|
||||
blocks.add(FaweCache.asMap("state", index, "pos", pos));
|
||||
} else {
|
||||
blocks.add(
|
||||
FaweCache.asMap("state", index, "pos", pos, "nbt", block.getNbtData()));
|
||||
}
|
||||
ArrayList<Map<String, Object>> blocks = new ArrayList<>();
|
||||
BlockVector3 min = region.getMinimumPoint();
|
||||
for (BlockVector3 point : region) {
|
||||
BaseBlock block = clipboard.getFullBlock(point);
|
||||
if (block.getBlockType() != BlockTypes.STRUCTURE_VOID) {
|
||||
int combined = block.getInternalId();
|
||||
int index = indexes.get(combined);
|
||||
List<Integer> pos = Arrays.asList(point.getX() - min.getX(),
|
||||
point.getY() - min.getY(), point.getZ() - min.getZ());
|
||||
if (!block.hasNbtData()) {
|
||||
blocks.add(FaweCache.asMap("state", index, "pos", pos));
|
||||
} else {
|
||||
blocks.add(
|
||||
FaweCache.asMap("state", index, "pos", pos, "nbt", block.getNbtData()));
|
||||
}
|
||||
}
|
||||
if (!blocks.isEmpty()) {
|
||||
structure.put("blocks", blocks);
|
||||
}
|
||||
}
|
||||
if (!blocks.isEmpty()) {
|
||||
structure.put("blocks", blocks);
|
||||
}
|
||||
// Entities
|
||||
{
|
||||
ArrayList<Map<String, Object>> entities = new ArrayList<>();
|
||||
for (Entity entity : clipboard.getEntities()) {
|
||||
Location loc = entity.getLocation();
|
||||
List<Double> pos = Arrays.asList(loc.getX(), loc.getY(), loc.getZ());
|
||||
List<Integer> blockPos = Arrays.asList(loc.getBlockX(), loc.getBlockY(), loc.getBlockZ());
|
||||
BaseEntity state = entity.getState();
|
||||
if (state != null) {
|
||||
CompoundTag nbt = state.getNbtData();
|
||||
Map<String, Tag> nbtMap = ReflectionUtils.getMap(nbt.getValue());
|
||||
// Replace rotation data
|
||||
nbtMap.put("Rotation", writeRotation(entity.getLocation(), "Rotation"));
|
||||
nbtMap.put("id", new StringTag(state.getType().getId()));
|
||||
Map<String, Object> entityMap = FaweCache.asMap("pos", pos, "blockPos", blockPos, "nbt", nbt);
|
||||
entities.add(entityMap);
|
||||
}
|
||||
}
|
||||
if (!entities.isEmpty()) {
|
||||
structure.put("entities", entities);
|
||||
ArrayList<Map<String, Object>> entities = new ArrayList<>();
|
||||
for (Entity entity : clipboard.getEntities()) {
|
||||
Location loc = entity.getLocation();
|
||||
List<Double> pos = Arrays.asList(loc.getX(), loc.getY(), loc.getZ());
|
||||
List<Integer> blockPos = Arrays.asList(loc.getBlockX(), loc.getBlockY(), loc.getBlockZ());
|
||||
BaseEntity state = entity.getState();
|
||||
if (state != null) {
|
||||
CompoundTag nbt = state.getNbtData();
|
||||
Map<String, Tag> nbtMap = ReflectionUtils.getMap(nbt.getValue());
|
||||
// Replace rotation data
|
||||
nbtMap.put("Rotation", writeRotation(entity.getLocation()));
|
||||
nbtMap.put("id", new StringTag(state.getType().getId()));
|
||||
Map<String, Object> entityMap = FaweCache.asMap("pos", pos, "blockPos", blockPos, "nbt", nbt);
|
||||
entities.add(entityMap);
|
||||
}
|
||||
}
|
||||
if (!entities.isEmpty()) {
|
||||
structure.put("entities", entities);
|
||||
}
|
||||
out.writeNamedTag("", FaweCache.asTag(structure));
|
||||
close();
|
||||
}
|
||||
@ -260,18 +255,4 @@ public class MinecraftStructure implements ClipboardReader, ClipboardWriter {
|
||||
}
|
||||
}
|
||||
|
||||
private Tag writeVector(BlockVector3 vector, String name) {
|
||||
List<DoubleTag> list = new ArrayList<>();
|
||||
list.add(new DoubleTag(vector.getX()));
|
||||
list.add(new DoubleTag(vector.getY()));
|
||||
list.add(new DoubleTag(vector.getZ()));
|
||||
return new ListTag(DoubleTag.class, list);
|
||||
}
|
||||
|
||||
private Tag writeRotation(Location location, String name) {
|
||||
List<FloatTag> list = new ArrayList<>();
|
||||
list.add(new FloatTag(location.getYaw()));
|
||||
list.add(new FloatTag(location.getPitch()));
|
||||
return new ListTag(FloatTag.class, list);
|
||||
}
|
||||
}
|
||||
|
@ -51,9 +51,6 @@ public class PNGWriter implements ClipboardWriter {
|
||||
double[] dpxi = new double[Math.max(256, width)];
|
||||
double[] dpyj = new double[length];
|
||||
double[] dpyi = new double[Math.max(256, width)];
|
||||
double[] hd = new double[256];
|
||||
for (int i = 0; i < hd.length; i++) {
|
||||
}
|
||||
for (int j = 0; j < dpxj.length; j++) {
|
||||
dpxj[j] = cx + j * d;
|
||||
dpyj[j] = imageSize / 2 + d + j * d_2;
|
||||
@ -165,4 +162,4 @@ public class PNGWriter implements ClipboardWriter {
|
||||
public void close() throws IOException {
|
||||
out.close();
|
||||
}
|
||||
}
|
||||
}
|
||||
|
@ -1,5 +1,7 @@
|
||||
package com.boydti.fawe.object.schematic;
|
||||
|
||||
import static com.google.common.base.Preconditions.checkNotNull;
|
||||
|
||||
import com.boydti.fawe.object.clipboard.FaweClipboard;
|
||||
import com.boydti.fawe.object.clipboard.ReadOnlyClipboard;
|
||||
import com.boydti.fawe.util.EditSessionBuilder;
|
||||
@ -18,6 +20,7 @@ import com.sk89q.worldedit.function.RegionFunction;
|
||||
import com.sk89q.worldedit.function.mask.ExistingBlockMask;
|
||||
import com.sk89q.worldedit.function.mask.Mask;
|
||||
import com.sk89q.worldedit.function.operation.ForwardExtentCopy;
|
||||
import com.sk89q.worldedit.function.operation.Operation;
|
||||
import com.sk89q.worldedit.function.operation.Operations;
|
||||
import com.sk89q.worldedit.function.visitor.RegionVisitor;
|
||||
import com.sk89q.worldedit.math.BlockVector2;
|
||||
@ -29,17 +32,14 @@ import com.sk89q.worldedit.regions.Region;
|
||||
import com.sk89q.worldedit.util.Location;
|
||||
import com.sk89q.worldedit.world.World;
|
||||
import com.sk89q.worldedit.world.block.BlockStateHolder;
|
||||
|
||||
import java.io.File;
|
||||
import java.io.FileOutputStream;
|
||||
import java.io.IOException;
|
||||
import java.io.OutputStream;
|
||||
import javax.annotation.Nullable;
|
||||
|
||||
|
||||
import static com.google.common.base.Preconditions.checkNotNull;
|
||||
|
||||
public class Schematic {
|
||||
|
||||
private final Clipboard clipboard;
|
||||
|
||||
public Schematic(Clipboard clipboard) {
|
||||
@ -54,14 +54,15 @@ public class Schematic {
|
||||
*/
|
||||
public Schematic(Region region) {
|
||||
checkNotNull(region);
|
||||
checkNotNull(region.getWorld(), "World cannot be null (use the other constructor for the region)");
|
||||
EditSession session = new EditSessionBuilder(region.getWorld()).allowedRegionsEverywhere().autoQueue(false).build();
|
||||
checkNotNull(region.getWorld(),
|
||||
"World cannot be null (use the other constructor for the region)");
|
||||
EditSession session = new EditSessionBuilder(region.getWorld()).allowedRegionsEverywhere()
|
||||
.autoQueue(false).build();
|
||||
this.clipboard = new BlockArrayClipboard(region, ReadOnlyClipboard.of(session, region));
|
||||
}
|
||||
|
||||
public
|
||||
@Nullable
|
||||
Clipboard getClipboard() {
|
||||
public Clipboard getClipboard() {
|
||||
return clipboard;
|
||||
}
|
||||
|
||||
@ -104,7 +105,8 @@ public class Schematic {
|
||||
}
|
||||
}
|
||||
|
||||
public EditSession paste(World world, BlockVector3 to, boolean allowUndo, boolean pasteAir, @Nullable Transform transform) {
|
||||
public EditSession paste(World world, BlockVector3 to, boolean allowUndo, boolean pasteAir,
|
||||
@Nullable Transform transform) {
|
||||
return paste(world, to, allowUndo, pasteAir, true, transform);
|
||||
}
|
||||
|
||||
@ -118,14 +120,16 @@ public class Schematic {
|
||||
* @param transform
|
||||
* @return
|
||||
*/
|
||||
public EditSession paste(World world, BlockVector3 to, boolean allowUndo, boolean pasteAir, boolean copyEntities, @Nullable Transform transform) {
|
||||
public EditSession paste(World world, BlockVector3 to, boolean allowUndo, boolean pasteAir,
|
||||
boolean copyEntities, @Nullable Transform transform) {
|
||||
checkNotNull(world);
|
||||
checkNotNull(to);
|
||||
EditSession editSession;
|
||||
if (world instanceof EditSession) {
|
||||
editSession = (EditSession) world;
|
||||
} else {
|
||||
EditSessionBuilder builder = new EditSessionBuilder(world).autoQueue(true).checkMemory(false).allowedRegionsEverywhere().limitUnlimited();
|
||||
EditSessionBuilder builder = new EditSessionBuilder(world).autoQueue(true)
|
||||
.checkMemory(false).allowedRegionsEverywhere().limitUnlimited();
|
||||
if (allowUndo) {
|
||||
editSession = builder.build();
|
||||
} else {
|
||||
@ -141,7 +145,8 @@ public class Schematic {
|
||||
editSession.flushQueue();
|
||||
return editSession;
|
||||
}
|
||||
ForwardExtentCopy copy = new ForwardExtentCopy(extent, clipboard.getRegion(), clipboard.getOrigin(), editSession, to);
|
||||
ForwardExtentCopy copy = new ForwardExtentCopy(extent, clipboard.getRegion(),
|
||||
clipboard.getOrigin(), editSession, to);
|
||||
if (transform != null && !transform.isIdentity()) {
|
||||
copy.setTransform(transform);
|
||||
}
|
||||
@ -165,16 +170,13 @@ public class Schematic {
|
||||
|
||||
public void paste(Extent extent, BlockVector3 to, boolean pasteAir, Transform transform) {
|
||||
checkNotNull(transform);
|
||||
Region region = clipboard.getRegion();
|
||||
Extent source = clipboard;
|
||||
if (transform != null) {
|
||||
source = new BlockTransformExtent(clipboard, transform);
|
||||
}
|
||||
ForwardExtentCopy copy = new ForwardExtentCopy(source, clipboard.getRegion(), clipboard.getOrigin(), extent, to);
|
||||
if (transform != null) {
|
||||
copy.setTransform(transform);
|
||||
}
|
||||
copy.setCopyingBiomes(!(clipboard instanceof BlockArrayClipboard) || ((BlockArrayClipboard) clipboard).IMP.hasBiomes());
|
||||
Extent source = new BlockTransformExtent(clipboard, transform);
|
||||
ForwardExtentCopy copy = new ForwardExtentCopy(source, clipboard.getRegion(),
|
||||
clipboard.getOrigin(), extent, to);
|
||||
copy.setTransform(transform);
|
||||
copy.setCopyingBiomes(
|
||||
!(clipboard instanceof BlockArrayClipboard) || ((BlockArrayClipboard) clipboard).IMP
|
||||
.hasBiomes());
|
||||
if (extent instanceof EditSession) {
|
||||
EditSession editSession = (EditSession) extent;
|
||||
Mask sourceMask = editSession.getSourceMask();
|
||||
@ -190,13 +192,14 @@ public class Schematic {
|
||||
Operations.completeBlindly(copy);
|
||||
}
|
||||
|
||||
public void paste(Extent extent, BlockVector3 to, final boolean pasteAir) {
|
||||
public void paste(Extent extent, BlockVector3 to, boolean pasteAir) {
|
||||
Region region = clipboard.getRegion().clone();
|
||||
final int maxY = extent.getMaximumPoint().getBlockY();
|
||||
final BlockVector3 bot = clipboard.getMinimumPoint();
|
||||
final BlockVector3 origin = clipboard.getOrigin();
|
||||
|
||||
final boolean copyBiomes = !(clipboard instanceof BlockArrayClipboard) || ((BlockArrayClipboard) clipboard).IMP.hasBiomes();
|
||||
final boolean copyBiomes =
|
||||
!(clipboard instanceof BlockArrayClipboard) || ((BlockArrayClipboard) clipboard).IMP
|
||||
.hasBiomes();
|
||||
|
||||
// Optimize for BlockArrayClipboard
|
||||
if (clipboard instanceof BlockArrayClipboard && region instanceof CuboidRegion) {
|
||||
@ -209,9 +212,11 @@ public class Schematic {
|
||||
if (copyBiomes) {
|
||||
bac.IMP.forEach(new FaweClipboard.BlockReader() {
|
||||
MutableBlockVector2 mpos2d = new MutableBlockVector2();
|
||||
|
||||
{
|
||||
mpos2d.setComponents(Integer.MIN_VALUE, Integer.MIN_VALUE);
|
||||
}
|
||||
|
||||
@Override
|
||||
public <B extends BlockStateHolder<B>> void run(int x, int y, int z, B block) {
|
||||
try {
|
||||
@ -225,7 +230,9 @@ public class Schematic {
|
||||
return;
|
||||
}
|
||||
extent.setBlock(xx, y + rely, zz, block);
|
||||
} catch (WorldEditException e) { throw new RuntimeException(e);}
|
||||
} catch (WorldEditException e) {
|
||||
throw new RuntimeException(e);
|
||||
}
|
||||
}
|
||||
}, true);
|
||||
} else {
|
||||
@ -234,7 +241,9 @@ public class Schematic {
|
||||
public <B extends BlockStateHolder<B>> void run(int x, int y, int z, B block) {
|
||||
try {
|
||||
extent.setBlock(x + relx, y + rely, z + relz, block);
|
||||
} catch (WorldEditException e) { throw new RuntimeException(e);}
|
||||
} catch (WorldEditException e) {
|
||||
throw new RuntimeException(e);
|
||||
}
|
||||
}
|
||||
}, pasteAir);
|
||||
}
|
||||
@ -243,12 +252,14 @@ public class Schematic {
|
||||
final int relx = to.getBlockX() - origin.getBlockX();
|
||||
final int rely = to.getBlockY() - origin.getBlockY();
|
||||
final int relz = to.getBlockZ() - origin.getBlockZ();
|
||||
RegionVisitor visitor = new RegionVisitor(region, new RegionFunction() {
|
||||
// MutableBlockVector2 mpos2d_2 = new MutableBlockVector2();
|
||||
Operation visitor = new RegionVisitor(region, new RegionFunction() {
|
||||
// MutableBlockVector2 mpos2d_2 = new MutableBlockVector2();
|
||||
MutableBlockVector2 mpos2d = new MutableBlockVector2();
|
||||
|
||||
{
|
||||
mpos2d.setComponents(Integer.MIN_VALUE, Integer.MIN_VALUE);
|
||||
}
|
||||
|
||||
@Override
|
||||
public boolean apply(BlockVector3 mutable) throws WorldEditException {
|
||||
BlockStateHolder block = clipboard.getBlock(mutable);
|
||||
@ -257,7 +268,8 @@ public class Schematic {
|
||||
if (copyBiomes && xx != mpos2d.getBlockX() && zz != mpos2d.getBlockZ()) {
|
||||
mpos2d.setComponents(xx, zz);
|
||||
// extent.setBiome(mpos2d, clipboard.getBiome(mpos2d_2.setComponents(mutable.getBlockX(), mutable.getBlockZ())));
|
||||
extent.setBiome(mpos2d, clipboard.getBiome(BlockVector2.at(mutable.getBlockX(), mutable.getBlockZ())));
|
||||
extent.setBiome(mpos2d, clipboard
|
||||
.getBiome(BlockVector2.at(mutable.getBlockX(), mutable.getBlockZ())));
|
||||
}
|
||||
if (!pasteAir && block.getBlockType().getMaterial().isAir()) {
|
||||
return false;
|
||||
@ -275,11 +287,14 @@ public class Schematic {
|
||||
// entities
|
||||
for (Entity entity : clipboard.getEntities()) {
|
||||
// skip players on pasting schematic
|
||||
if (entity.getState() != null && entity.getState().getType().getId().equals("minecraft:player")) {
|
||||
if (entity.getState() != null && entity.getState().getType().getId()
|
||||
.equals("minecraft:player")) {
|
||||
continue;
|
||||
}
|
||||
Location pos = entity.getLocation();
|
||||
Location newPos = new Location(pos.getExtent(), pos.getX() + entityOffsetX, pos.getY() + entityOffsetY, pos.getZ() + entityOffsetZ, pos.getYaw(), pos.getPitch());
|
||||
Location newPos = new Location(pos.getExtent(), pos.getX() + entityOffsetX,
|
||||
pos.getY() + entityOffsetY, pos.getZ() + entityOffsetZ, pos.getYaw(),
|
||||
pos.getPitch());
|
||||
extent.createEntity(newPos, entity.getState());
|
||||
}
|
||||
}
|
||||
|
@ -10,8 +10,8 @@ public class CleanTextureUtil extends TextureUtil {
|
||||
super(parent.getFolder());
|
||||
this.min = minPercent;
|
||||
this.max = maxPercent;
|
||||
int minIndex = ((parent.distances.length - 1) * minPercent) / 100;
|
||||
int maxIndex = ((parent.distances.length - 1) * maxPercent) / 100;
|
||||
int minIndex = (parent.distances.length - 1) * minPercent / 100;
|
||||
int maxIndex = (parent.distances.length - 1) * maxPercent / 100;
|
||||
long min = parent.distances[minIndex];
|
||||
long max = parent.distances[maxIndex];
|
||||
for (; minIndex > 0 && parent.distances[minIndex - 1] == min; minIndex--) ;
|
||||
@ -44,4 +44,4 @@ public class CleanTextureUtil extends TextureUtil {
|
||||
public int getMax() {
|
||||
return max;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
@ -1,5 +1,7 @@
|
||||
package com.boydti.fawe.util;
|
||||
|
||||
import static com.google.common.base.Preconditions.checkNotNull;
|
||||
|
||||
import com.boydti.fawe.Fawe;
|
||||
import com.boydti.fawe.FaweAPI;
|
||||
import com.boydti.fawe.config.BBC;
|
||||
@ -24,12 +26,9 @@ import com.sk89q.worldedit.extent.inventory.BlockBag;
|
||||
import com.sk89q.worldedit.regions.Region;
|
||||
import com.sk89q.worldedit.util.eventbus.EventBus;
|
||||
import com.sk89q.worldedit.world.World;
|
||||
|
||||
import java.util.UUID;
|
||||
import javax.annotation.Nonnull;
|
||||
import javax.annotation.Nullable;
|
||||
import java.util.UUID;
|
||||
|
||||
import static com.google.common.base.Preconditions.checkNotNull;
|
||||
|
||||
public class EditSessionBuilder {
|
||||
private World world;
|
||||
@ -294,7 +293,7 @@ public class EditSessionBuilder {
|
||||
}
|
||||
if (checkMemory) {
|
||||
if (MemUtil.isMemoryLimitedSlow()) {
|
||||
if (Perm.hasPermission(player, "worldedit.fast")) {
|
||||
if (Permission.hasPermission(player.toWorldEditPlayer(), "worldedit.fast")) {
|
||||
BBC.WORLDEDIT_OOM_ADMIN.send(player);
|
||||
}
|
||||
throw FaweException.LOW_MEMORY;
|
||||
|
@ -15,14 +15,14 @@ public final class IOUtil {
|
||||
int ch4 = in.read();
|
||||
if ((ch1 | ch2 | ch3 | ch4) < 0)
|
||||
throw new EOFException();
|
||||
return ((ch1 << 24) + (ch2 << 16) + (ch3 << 8) + (ch4 << 0));
|
||||
return (ch1 << 24) + (ch2 << 16) + (ch3 << 8) + (ch4 << 0);
|
||||
}
|
||||
|
||||
public static void writeInt(OutputStream out, int v) throws IOException {
|
||||
out.write((v >>> 24) & 0xFF);
|
||||
out.write((v >>> 16) & 0xFF);
|
||||
out.write((v >>> 8) & 0xFF);
|
||||
out.write((v >>> 0) & 0xFF);
|
||||
out.write(v >>> 24 & 0xFF);
|
||||
out.write(v >>> 16 & 0xFF);
|
||||
out.write(v >>> 8 & 0xFF);
|
||||
out.write(v >>> 0 & 0xFF);
|
||||
}
|
||||
|
||||
public static int readVarInt(InputStream in) throws IOException {
|
||||
@ -30,7 +30,7 @@ public final class IOUtil {
|
||||
int offset = 0;
|
||||
int b;
|
||||
while ((b = in.read()) > 127) {
|
||||
i |= (b - 128) << offset;
|
||||
i |= b - 128 << offset;
|
||||
offset += 7;
|
||||
}
|
||||
i |= b << offset;
|
||||
|
@ -17,12 +17,12 @@ public class ImgurUtility {
|
||||
return uploadImage(new FileInputStream(file));
|
||||
}
|
||||
|
||||
public static URL uploadImage(InputStream is) throws IOException {
|
||||
is = new BufferedInputStream(is);
|
||||
public static URL uploadImage(InputStream inputStream) throws IOException {
|
||||
inputStream = new BufferedInputStream(inputStream);
|
||||
FastByteArrayOutputStream baos = new FastByteArrayOutputStream(Short.MAX_VALUE);
|
||||
int d;
|
||||
while ((d = is.read()) != -1) {
|
||||
baos.write(d);
|
||||
int i;
|
||||
while ((i = inputStream.read()) != -1) {
|
||||
baos.write(i);
|
||||
}
|
||||
baos.flush();
|
||||
return uploadImage(baos.toByteArray());
|
||||
|
@ -1,44 +0,0 @@
|
||||
package com.boydti.fawe.util;
|
||||
|
||||
import com.boydti.fawe.object.FawePlayer;
|
||||
|
||||
public enum Perm {
|
||||
/*
|
||||
* Permission related functions
|
||||
*/
|
||||
ADMIN("fawe.admin", "admin");
|
||||
|
||||
public String s;
|
||||
public String cat;
|
||||
|
||||
Perm(String perm, String cat) {
|
||||
this.s = perm;
|
||||
this.cat = cat;
|
||||
}
|
||||
|
||||
public boolean has(FawePlayer<?> player) {
|
||||
return this.hasPermission(player, this);
|
||||
}
|
||||
|
||||
public boolean hasPermission(FawePlayer<?> player, Perm perm) {
|
||||
return hasPermission(player, perm.s);
|
||||
}
|
||||
|
||||
public static boolean hasPermission(FawePlayer<?> player, String perm) {
|
||||
if (player == null || player.hasPermission(ADMIN.s)) {
|
||||
return true;
|
||||
}
|
||||
if (player.hasPermission(perm)) {
|
||||
return true;
|
||||
}
|
||||
final String[] nodes = perm.split("\\.");
|
||||
final StringBuilder n = new StringBuilder();
|
||||
for (int i = 0; i < nodes.length - 1; i++) {
|
||||
n.append(nodes[i]).append(".");
|
||||
if (player.hasPermission(n + "*")) {
|
||||
return true;
|
||||
}
|
||||
}
|
||||
return false;
|
||||
}
|
||||
}
|
@ -0,0 +1,37 @@
|
||||
package com.boydti.fawe.util;
|
||||
|
||||
import com.sk89q.worldedit.util.auth.Subject;
|
||||
|
||||
public enum Permission {
|
||||
/*
|
||||
* Permission related functions
|
||||
*/
|
||||
ADMIN("fawe.admin", "admin");
|
||||
|
||||
public String permission;
|
||||
public String cat;
|
||||
|
||||
Permission(String permission, String category) {
|
||||
this.permission = permission;
|
||||
this.cat = category;
|
||||
}
|
||||
|
||||
|
||||
public static boolean hasPermission(Subject player, String permission) {
|
||||
if (player == null || player.hasPermission(ADMIN.permission)) {
|
||||
return true;
|
||||
}
|
||||
if (player.hasPermission(permission)) {
|
||||
return true;
|
||||
}
|
||||
final String[] nodes = permission.split("\\.");
|
||||
final StringBuilder n = new StringBuilder();
|
||||
for (int i = 0; i < nodes.length - 1; i++) {
|
||||
n.append(nodes[i]).append(".");
|
||||
if (player.hasPermission(n + "*")) {
|
||||
return true;
|
||||
}
|
||||
}
|
||||
return false;
|
||||
}
|
||||
}
|
@ -21,9 +21,9 @@ public class RandomTextureUtil extends CachedTextureUtil {
|
||||
int red1 = (c1 >> 16) & 0xFF;
|
||||
int green1 = (c1 >> 8) & 0xFF;
|
||||
int blue1 = (c1 >> 0) & 0xFF;
|
||||
byte red2 = (byte) ((c2 >> 16));
|
||||
byte green2 = (byte) ((c2 >> 8));
|
||||
byte blue2 = (byte) ((c2 >> 0));
|
||||
byte red2 = (byte) (c2 >> 16);
|
||||
byte green2 = (byte) (c2 >> 8);
|
||||
byte blue2 = (byte) (c2 >> 0);
|
||||
int red = MathMan.clamp(red1 + random(red2), 0, 255);
|
||||
int green = MathMan.clamp(green1 + random(green2), 0, 255);
|
||||
int blue = MathMan.clamp(blue1 + random(blue2), 0, 255);
|
||||
|
@ -8,10 +8,8 @@ import java.util.Comparator;
|
||||
import java.util.List;
|
||||
import java.util.Map;
|
||||
import java.util.Map.Entry;
|
||||
import java.util.Objects;
|
||||
import java.util.Set;
|
||||
import java.util.function.Function;
|
||||
import java.util.stream.Collectors;
|
||||
import java.util.stream.IntStream;
|
||||
|
||||
public class StringMan {
|
||||
@ -37,10 +35,8 @@ public class StringMan {
|
||||
}
|
||||
|
||||
public static boolean containsAny(CharSequence sequence, String any) {
|
||||
for (int i = 0; i < sequence.length(); i++) {
|
||||
if (any.indexOf(sequence.charAt(i)) != -1) return true;
|
||||
}
|
||||
return false;
|
||||
return IntStream.range(0, sequence.length())
|
||||
.anyMatch(i -> any.indexOf(sequence.charAt(i)) != -1);
|
||||
}
|
||||
|
||||
public static boolean containsIgnoreCase(String haystack, String needle) {
|
||||
@ -122,14 +118,11 @@ public class StringMan {
|
||||
int len = string.length();
|
||||
for (int i = len - 1; i >= 0; i--) {
|
||||
char c = string.charAt(i);
|
||||
switch (c) {
|
||||
case '-':
|
||||
val = -val;
|
||||
break;
|
||||
default:
|
||||
val = val + (c - 48) * numIndex;
|
||||
numIndex *= 10;
|
||||
break;
|
||||
if (c == '-') {
|
||||
val = -val;
|
||||
} else {
|
||||
val = val + (c - 48) * numIndex;
|
||||
numIndex *= 10;
|
||||
}
|
||||
}
|
||||
return val;
|
||||
@ -518,7 +511,8 @@ public class StringMan {
|
||||
}
|
||||
|
||||
public static boolean isEqualIgnoreCase(String a, String b) {
|
||||
return ((a == b) || ((a != null) && (b != null) && (a.length() == b.length()) && a.equalsIgnoreCase(b)));
|
||||
return a == b ||
|
||||
a != null && b != null && a.length() == b.length() && a.equalsIgnoreCase(b);
|
||||
}
|
||||
|
||||
public static String repeat(String s, int n) {
|
||||
|
@ -32,7 +32,7 @@ public class WEManager {
|
||||
if (!(currentExtent instanceof NullExtent)) {
|
||||
field.set(parent, new NullExtent((Extent) field.get(parent), reason));
|
||||
}
|
||||
} catch (final Exception e) {
|
||||
} catch (Exception e) {
|
||||
e.printStackTrace();
|
||||
}
|
||||
throw reason;
|
||||
@ -42,41 +42,33 @@ public class WEManager {
|
||||
cancelEditSafe(parent, reason);
|
||||
}
|
||||
|
||||
public boolean maskContains(final HashSet<RegionWrapper> mask, final int x, final int z) {
|
||||
for (final RegionWrapper region : mask) {
|
||||
if ((x >= region.minX) && (x <= region.maxX) && (z >= region.minZ) && (z <= region.maxZ)) {
|
||||
public boolean maskContains(HashSet<RegionWrapper> mask, int x, int z) {
|
||||
for (RegionWrapper region : mask) {
|
||||
if (x >= region.minX && x <= region.maxX && z >= region.minZ && z <= region.maxZ) {
|
||||
return true;
|
||||
}
|
||||
}
|
||||
return false;
|
||||
}
|
||||
|
||||
public boolean maskContains(RegionWrapper[] mask, final int x, final int z) {
|
||||
public boolean maskContains(RegionWrapper[] mask, int x, int z) {
|
||||
switch (mask.length) {
|
||||
case 0:
|
||||
return false;
|
||||
case 1:
|
||||
return mask[0].isIn(x, z);
|
||||
default:
|
||||
for (final RegionWrapper region : mask) {
|
||||
if (region.isIn(x, z)) {
|
||||
return true;
|
||||
}
|
||||
}
|
||||
return false;
|
||||
return Arrays.stream(mask).anyMatch(region -> region.isIn(x, z));
|
||||
}
|
||||
}
|
||||
|
||||
@Deprecated
|
||||
public Region[] getMask(final FawePlayer<?> player) {
|
||||
public Region[] getMask(FawePlayer<?> player) {
|
||||
return getMask(player, FaweMaskManager.MaskType.getDefaultMaskType());
|
||||
}
|
||||
|
||||
public boolean isIn(int x, int y, int z, Region region) {
|
||||
if (region.contains(x, y, z)) {
|
||||
return true;
|
||||
}
|
||||
return false;
|
||||
return region.contains(x, y, z);
|
||||
}
|
||||
|
||||
/**
|
||||
@ -85,7 +77,7 @@ public class WEManager {
|
||||
* @param player
|
||||
* @return
|
||||
*/
|
||||
public Region[] getMask(final FawePlayer<?> player, FaweMaskManager.MaskType type) {
|
||||
public Region[] getMask(FawePlayer<?> player, FaweMaskManager.MaskType type) {
|
||||
if (!Settings.IMP.REGION_RESTRICTIONS || player.hasPermission("fawe.bypass") || player.hasPermission("fawe.bypass.regions")) {
|
||||
return new Region[]{RegionWrapper.GLOBAL()};
|
||||
}
|
||||
@ -129,7 +121,7 @@ public class WEManager {
|
||||
}
|
||||
}
|
||||
Set<FaweMask> tmpMasks = new HashSet<>();
|
||||
for (final FaweMaskManager manager : managers) {
|
||||
for (FaweMaskManager manager : managers) {
|
||||
if (player.hasPermission("fawe." + manager.getKey())) {
|
||||
try {
|
||||
if (manager.isExclusive() && !masks.isEmpty()) continue;
|
||||
@ -154,17 +146,19 @@ public class WEManager {
|
||||
}
|
||||
|
||||
|
||||
public boolean intersects(final Region region1, final Region region2) {
|
||||
public boolean intersects(Region region1, Region region2) {
|
||||
BlockVector3 rg1P1 = region1.getMinimumPoint();
|
||||
BlockVector3 rg1P2 = region1.getMaximumPoint();
|
||||
BlockVector3 rg2P1 = region2.getMinimumPoint();
|
||||
BlockVector3 rg2P2 = region2.getMaximumPoint();
|
||||
|
||||
return (rg1P1.getBlockX() <= rg2P2.getBlockX()) && (rg1P2.getBlockX() >= rg2P1.getBlockX()) && (rg1P1.getBlockZ() <= rg2P2.getBlockZ()) && (rg1P2.getBlockZ() >= rg2P1.getBlockZ());
|
||||
return rg1P1.getBlockX() <= rg2P2.getBlockX() && rg1P2.getBlockX() >= rg2P1.getBlockX() &&
|
||||
rg1P1.getBlockZ() <= rg2P2.getBlockZ() &&
|
||||
rg1P2.getBlockZ() >= rg2P1.getBlockZ();
|
||||
}
|
||||
|
||||
public boolean regionContains(final Region selection, final HashSet<Region> mask) {
|
||||
for (final Region region : mask) {
|
||||
public boolean regionContains(Region selection, HashSet<Region> mask) {
|
||||
for (Region region : mask) {
|
||||
if (this.intersects(region, selection)) {
|
||||
return true;
|
||||
}
|
||||
@ -172,29 +166,29 @@ public class WEManager {
|
||||
return false;
|
||||
}
|
||||
|
||||
public boolean delay(final FawePlayer<?> player, final String command) {
|
||||
public boolean delay(FawePlayer<?> player, String command) {
|
||||
final long start = System.currentTimeMillis();
|
||||
return this.delay(player, () -> {
|
||||
try {
|
||||
if ((System.currentTimeMillis() - start) > 1000) {
|
||||
if (System.currentTimeMillis() - start > 1000) {
|
||||
BBC.WORLDEDIT_RUN.send(FawePlayer.wrap(player));
|
||||
}
|
||||
TaskManager.IMP.task(() -> {
|
||||
final long start1 = System.currentTimeMillis();
|
||||
player.executeCommand(command.substring(1));
|
||||
TaskManager.IMP.later(() -> SetQueue.IMP.addEmptyTask(() -> {
|
||||
if ((System.currentTimeMillis() - start1) > 1000) {
|
||||
if (System.currentTimeMillis() - start1 > 1000) {
|
||||
BBC.WORLDEDIT_COMPLETE.send(FawePlayer.wrap(player));
|
||||
}
|
||||
}), 2);
|
||||
});
|
||||
} catch (final Exception e) {
|
||||
} catch (Exception e) {
|
||||
e.printStackTrace();
|
||||
}
|
||||
}, false, false);
|
||||
}
|
||||
|
||||
public boolean delay(final FawePlayer<?> player, final Runnable whenDone, final boolean delayed, final boolean onlyDelayedExecution) {
|
||||
public boolean delay(FawePlayer<?> player, Runnable whenDone, boolean delayed, boolean onlyDelayedExecution) {
|
||||
final boolean free = SetQueue.IMP.addEmptyTask(null);
|
||||
if (free) {
|
||||
if (delayed) {
|
||||
@ -202,14 +196,14 @@ public class WEManager {
|
||||
whenDone.run();
|
||||
}
|
||||
} else {
|
||||
if ((whenDone != null) && !onlyDelayedExecution) {
|
||||
if (whenDone != null && !onlyDelayedExecution) {
|
||||
whenDone.run();
|
||||
} else {
|
||||
return false;
|
||||
}
|
||||
}
|
||||
} else {
|
||||
if (!delayed && (player != null)) {
|
||||
if (!delayed && player != null) {
|
||||
BBC.WORLDEDIT_DELAYED.send(player);
|
||||
}
|
||||
SetQueue.IMP.addEmptyTask(whenDone);
|
||||
|
@ -1,21 +0,0 @@
|
||||
package com.boydti.fawe.util.chat;
|
||||
|
||||
import com.boydti.fawe.object.FawePlayer;
|
||||
|
||||
public interface ChatManager<T> {
|
||||
T builder();
|
||||
|
||||
void color(Message message, String color);
|
||||
|
||||
void tooltip(Message message, Message... tooltip);
|
||||
|
||||
void command(Message message, String command);
|
||||
|
||||
void text(Message message, String text);
|
||||
|
||||
void send(Message message, FawePlayer player);
|
||||
|
||||
void suggest(Message message, String command);
|
||||
|
||||
void link(Message message, String url);
|
||||
}
|
@ -1,127 +0,0 @@
|
||||
package com.boydti.fawe.util.chat;
|
||||
|
||||
import com.boydti.fawe.Fawe;
|
||||
import com.boydti.fawe.config.BBC;
|
||||
import com.boydti.fawe.object.FawePlayer;
|
||||
import com.sk89q.worldedit.extension.platform.Actor;
|
||||
import java.io.Serializable;
|
||||
import java.util.Objects;
|
||||
|
||||
public class Message {
|
||||
|
||||
private Object builder;
|
||||
private boolean active;
|
||||
|
||||
public Message() {
|
||||
try {
|
||||
reset(Fawe.get().getChatManager());
|
||||
} catch (Throwable e) {
|
||||
Fawe.debug("Doesn't support fancy chat for " + Fawe.imp().getPlatform());
|
||||
Fawe.get().setChatManager(new PlainChatManager());
|
||||
reset(Fawe.get().getChatManager());
|
||||
}
|
||||
active = !(Fawe.get().getChatManager() instanceof PlainChatManager);
|
||||
}
|
||||
|
||||
public Message(String text) {
|
||||
this();
|
||||
text(text);
|
||||
}
|
||||
|
||||
public <T> T $(ChatManager<T> manager) {
|
||||
return (T) this.builder;
|
||||
}
|
||||
|
||||
public <T> T reset(ChatManager<T> manager) {
|
||||
return (T) (this.builder = manager.builder());
|
||||
}
|
||||
|
||||
public boolean supportsInteraction() {
|
||||
return active;
|
||||
}
|
||||
|
||||
public Message text(BBC caption, Object... args) {
|
||||
return text(caption.format(args));
|
||||
}
|
||||
|
||||
public Message text(Serializable text) {
|
||||
Fawe.get().getChatManager().text(this, BBC.color(Objects.toString(text)));
|
||||
return this;
|
||||
}
|
||||
|
||||
public Message link(String text) {
|
||||
Fawe.get().getChatManager().link(this, text);
|
||||
return this;
|
||||
}
|
||||
|
||||
public Message tooltip(Message... tooltip) {
|
||||
Fawe.get().getChatManager().tooltip(this, tooltip);
|
||||
return this;
|
||||
}
|
||||
|
||||
public Message tooltip(String tooltip) {
|
||||
return tooltip(new Message(tooltip));
|
||||
}
|
||||
|
||||
public Message command(String command) {
|
||||
Fawe.get().getChatManager().command(this, "/" + command);
|
||||
return this;
|
||||
}
|
||||
|
||||
public Message newline() {
|
||||
return text("\n");
|
||||
}
|
||||
|
||||
public Message cmdTip(String commandAndTooltip) {
|
||||
return tooltip(commandAndTooltip).command(commandAndTooltip);
|
||||
}
|
||||
|
||||
public Message linkTip(String linkAndTooltip) {
|
||||
return tooltip(linkAndTooltip).link(linkAndTooltip);
|
||||
}
|
||||
|
||||
public Message cmdOptions(String prefix, String suffix, String... options) {
|
||||
for (int i = 0; i < options.length; i++) {
|
||||
if (i != 0) text(" | ");
|
||||
text("[" + options[i] + "]")
|
||||
.cmdTip(prefix + options[i] + suffix);
|
||||
}
|
||||
return this;
|
||||
}
|
||||
|
||||
public Message suggestTip(String commandAndTooltip) {
|
||||
return tooltip(commandAndTooltip).suggest(commandAndTooltip);
|
||||
}
|
||||
|
||||
public Message suggest(String command) {
|
||||
Fawe.get().getChatManager().suggest(this, command);
|
||||
return this;
|
||||
}
|
||||
|
||||
public void send(Actor player) {
|
||||
send(FawePlayer.wrap(player));
|
||||
}
|
||||
|
||||
public void send(FawePlayer player) {
|
||||
Fawe.get().getChatManager().send(this, player);
|
||||
}
|
||||
|
||||
public Message paginate(String baseCommand, int page, int totalPages) {
|
||||
if (!active) {
|
||||
return text(BBC.PAGE_FOOTER.format(baseCommand, page + 1));
|
||||
}
|
||||
if (page < totalPages && page > 1) { // Back | Next
|
||||
this.text("<<").command(baseCommand + " " + (page - 1)).text(" | ").text(">>")
|
||||
.command(baseCommand + " " + (page + 1));
|
||||
} else if (page <= 1 && totalPages > page) { // Next
|
||||
this.text(" -").text(" | ").text(">>")
|
||||
.command(baseCommand + " " + (page + 1));
|
||||
|
||||
} else if (page == totalPages && totalPages > 1) { // Back
|
||||
this.text("<<").command(baseCommand + " " + (page - 1)).text(" | ").text("- ");
|
||||
} else {
|
||||
this.text(" - | - ");
|
||||
}
|
||||
return this;
|
||||
}
|
||||
}
|
Some files were not shown because too many files have changed in this diff Show More
Loading…
x
Reference in New Issue
Block a user